![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | Sag.png | 2020-08-10 12:07 | 220K | |
![[IMG]](/icons/image2.gif) | metal.jpg | 2020-07-28 12:29 | 62K | |
![[IMG]](/icons/image2.gif) | Ring.jpg | 2020-07-28 12:24 | 40K | |
![[IMG]](/icons/image2.gif) | 3dvolume.jpg | 2020-07-28 12:20 | 29K | |
![[IMG]](/icons/image2.gif) | Picture1_22.jpg | 2020-07-28 12:13 | 43K | |
![[IMG]](/icons/image2.gif) | Coronal Faceg_1.png | 2020-07-10 15:34 | 175K | |
![[IMG]](/icons/image2.gif) | Coronal Faceg.png | 2020-07-10 15:34 | 175K | |
![[IMG]](/icons/image2.gif) | Coronal CT Skull_1.png | 2020-07-10 15:23 | 91K | |
![[IMG]](/icons/image2.gif) | Coronal CT Skull.png | 2020-07-10 15:22 | 91K | |
![[IMG]](/icons/image2.gif) | Lateral Skull_1.jpg | 2020-07-10 15:17 | 42K | |
![[IMG]](/icons/image2.gif) | Lateral Skull.jpg | 2020-07-10 15:15 | 42K | |
![[IMG]](/icons/image2.gif) | Hip Image_1.jpg | 2020-07-09 13:28 | 21K | |
![[IMG]](/icons/image2.gif) | 1593113527Compton.jpg | 2020-06-25 19:32 | 14K | |
![[IMG]](/icons/image2.gif) | Unit 4 Emission specturm image 2_1.jpg | 2020-06-18 16:42 | 25K | |
![[IMG]](/icons/image2.gif) | Picture5_3.jpg | 2020-06-15 21:49 | 20K | |
![[IMG]](/icons/image2.gif) | 6_2.png | 2020-06-15 16:19 | 57K | |
![[IMG]](/icons/image2.gif) | 5_2.jpg | 2020-06-15 15:41 | 27K | |
![[IMG]](/icons/image2.gif) | Picture2_13.jpg | 2020-06-15 14:39 | 11K | |
![[IMG]](/icons/image2.gif) | Unit 4 Emission specturm image 2.jpg | 2020-06-11 19:46 | 25K | |
![[IMG]](/icons/image2.gif) | Unit 4 Emission specturm image_1.jpg | 2020-06-09 13:32 | 17K | |
![[IMG]](/icons/image2.gif) | Unit 4 Emission specturm image.jpg | 2020-06-09 13:24 | 17K | |
![[IMG]](/icons/image2.gif) | Compton.jpg | 2020-06-05 20:37 | 14K | |
![[IMG]](/icons/image2.gif) | 1591382313Hip Image.jpg | 2020-06-05 18:38 | 21K | |
![[IMG]](/icons/image2.gif) | 1591382313Abdomen Image.jpg | 2020-06-05 18:38 | 62K | |
![[IMG]](/icons/image2.gif) | 1591382313Chest Image.jpg | 2020-06-05 18:38 | 23K | |
![[IMG]](/icons/image2.gif) | PELVIS_1.jpg | 2020-06-03 17:59 | 63K | |
![[IMG]](/icons/image2.gif) | PELVIS.jpg | 2020-06-03 17:56 | 63K | |
![[IMG]](/icons/image2.gif) | Picture2_7.png | 2020-06-03 17:13 | 250K | |
![[IMG]](/icons/image2.gif) | Unit 3 Cooling chart_1.jpg | 2020-06-01 12:51 | 45K | |
![[IMG]](/icons/image2.gif) | Unit 3 Tube diagram_2.jpg | 2020-06-01 12:47 | 19K | |
![[IMG]](/icons/image2.gif) | Unit 3 Tube diagram_1.jpg | 2020-06-01 12:21 | 19K | |
![[IMG]](/icons/image2.gif) | Unit 3 Tube diagram.jpg | 2020-06-01 12:20 | 19K | |
![[IMG]](/icons/image2.gif) | Unit 3 Cooling chart.jpg | 2020-05-29 16:10 | 45K | |
![[IMG]](/icons/image2.gif) | Unit 3 Tube rating chart.jpg | 2020-05-29 13:28 | 49K | |
![[IMG]](/icons/image2.gif) | Image 8_5.png | 2020-05-28 14:54 | 176K | |
![[IMG]](/icons/image2.gif) | Image 8_4.png | 2020-05-28 14:53 | 176K | |
![[IMG]](/icons/image2.gif) | Image 8_3.png | 2020-05-28 14:52 | 176K | |
![[IMG]](/icons/image2.gif) | Image 9_1.png | 2020-05-28 14:46 | 202K | |
![[IMG]](/icons/image2.gif) | Coronal vessels_1.jpg | 2020-05-26 15:04 | 52K | |
![[IMG]](/icons/image2.gif) | Coronal vessels.jpg | 2020-05-26 15:01 | 52K | |
![[IMG]](/icons/image2.gif) | large intestine quiz.jpg | 2020-05-21 14:42 | 61K | |
![[IMG]](/icons/image2.gif) | gall bladder quiz.jpg | 2020-05-21 14:37 | 71K | |
![[IMG]](/icons/image2.gif) | pulse.jpg | 2020-05-19 13:36 | 165K | |
![[IMG]](/icons/image2.gif) | Lat Elbow CT-2_1.jpg | 2020-05-15 17:05 | 42K | |
![[IMG]](/icons/image2.gif) | Lat Elbow CT-2.jpg | 2020-05-15 17:04 | 42K | |
![[IMG]](/icons/image2.gif) | Prone.jpg | 2020-05-14 14:35 | 8.3K | |
![[IMG]](/icons/image2.gif) | Pigg o stat.png | 2020-05-14 14:29 | 480K | |
![[IMG]](/icons/image2.gif) | X-ray circuit diagram _ small_2.jpg | 2020-05-14 12:57 | 42K | |
![[IMG]](/icons/image2.gif) | X-ray circuit diagram _ small_1.jpg | 2020-05-14 12:56 | 42K | |
![[IMG]](/icons/image2.gif) | X-ray circuit diagram _ small.jpg | 2020-05-14 12:54 | 42K | |
![[IMG]](/icons/image2.gif) | image00906.jpg | 2020-05-13 01:02 | 24K | |
![[IMG]](/icons/image2.gif) | Picture3_1.jpg | 2020-05-13 00:43 | 50K | |
![[IMG]](/icons/image2.gif) | Picture1_21.jpg | 2020-05-13 00:36 | 49K | |
![[IMG]](/icons/image2.gif) | MUGA.jpg | 2020-05-12 02:16 | 26K | |
![[IMG]](/icons/image2.gif) | Uterus.jpg | 2020-05-12 02:09 | 39K | |
![[IMG]](/icons/image2.gif) | Linear transducer.jpg | 2020-05-12 01:45 | 4.4K | |
![[IMG]](/icons/image2.gif) | hyperechoic.jpg | 2020-05-12 01:24 | 28K | |
![[IMG]](/icons/image2.gif) | 1_5.jpg | 2020-05-06 11:26 | 60K | |
![[IMG]](/icons/image2.gif) | 1_4.jpg | 2020-05-06 11:24 | 60K | |
![[IMG]](/icons/image2.gif) | 2_7.jpg | 2020-05-04 17:32 | 39K | |
![[IMG]](/icons/image2.gif) | 3_3.jpg | 2020-05-04 17:29 | 11K | |
![[IMG]](/icons/image2.gif) | 4.jpg | 2020-05-04 17:28 | 11K | |
![[IMG]](/icons/image2.gif) | 6_1.jpg | 2020-05-04 17:23 | 21K | |
![[IMG]](/icons/image2.gif) | n.jpg | 2020-05-04 17:22 | 71K | |
![[IMG]](/icons/image2.gif) | 5_1.jpg | 2020-05-04 17:19 | 27K | |
![[IMG]](/icons/image2.gif) | 7.jpg | 2020-05-04 17:03 | 79K | |
![[IMG]](/icons/image2.gif) | a_3.jpg | 2020-05-01 17:43 | 68K | |
![[IMG]](/icons/image2.gif) | d_7.jpg | 2020-05-01 17:41 | 81K | |
![[IMG]](/icons/image2.gif) | d_6.jpg | 2020-05-01 17:40 | 81K | |
![[IMG]](/icons/image2.gif) | d_5.jpg | 2020-05-01 17:38 | 81K | |
![[IMG]](/icons/image2.gif) | d_4.jpg | 2020-05-01 17:36 | 81K | |
![[IMG]](/icons/image2.gif) | d.jpg | 2020-05-01 17:33 | 81K | |
![[IMG]](/icons/image2.gif) | d_3.jpg | 2020-05-01 17:31 | 81K | |
![[IMG]](/icons/image2.gif) | d_2.jpg | 2020-05-01 17:31 | 81K | |
![[IMG]](/icons/image2.gif) | d_1.jpg | 2020-05-01 17:30 | 81K | |
![[IMG]](/icons/image2.gif) | b.jpg | 2020-05-01 17:25 | 85K | |
![[IMG]](/icons/image2.gif) | a_2.jpg | 2020-05-01 16:46 | 68K | |
![[IMG]](/icons/image2.gif) | a_1.jpg | 2020-05-01 16:43 | 68K | |
![[IMG]](/icons/image2.gif) | a.jpg | 2020-05-01 16:40 | 68K | |
![[IMG]](/icons/image2.gif) | 2_6.jpg | 2020-04-27 18:37 | 195K | |
![[IMG]](/icons/image2.gif) | 2_5.jpg | 2020-04-27 18:13 | 195K | |
![[IMG]](/icons/image2.gif) | 2_4.jpg | 2020-04-27 18:06 | 195K | |
![[IMG]](/icons/image2.gif) | quad_1.jpg | 2020-04-27 18:04 | 58K | |
![[IMG]](/icons/image2.gif) | 2_3.jpg | 2020-04-27 18:01 | 195K | |
![[IMG]](/icons/image2.gif) | 1_3.jpg | 2020-04-27 17:49 | 42K | |
![[IMG]](/icons/image2.gif) | quad.jpg | 2020-04-27 17:42 | 58K | |
![[IMG]](/icons/image2.gif) | Flammable label.png | 2020-04-22 14:05 | 13K | |
![[IMG]](/icons/image2.gif) | 1587481323Chapter 16 Retroperitoneal Fibrosis.png | 2020-04-21 15:02 | 227K | |
![[IMG]](/icons/image2.gif) | 1587481323Chapter 16 Adrenal cyst.png | 2020-04-21 15:02 | 259K | |
![[IMG]](/icons/image2.gif) | 1587481323Chapter 16 Adrenal hemorrhage.png | 2020-04-21 15:02 | 40K | |
![[IMG]](/icons/image2.gif) | 1587481323Chapter 15 Simple Renal Cyst.png | 2020-04-21 15:02 | 52K | |
![[IMG]](/icons/image2.gif) | 1587481323Chapter 15 Color Doppler on Renal Cyst.png | 2020-04-21 15:02 | 362K | |
![[IMG]](/icons/image2.gif) | 1587481323Chapter 15 Medullary Sponge Kidney.png | 2020-04-21 15:02 | 68K | |
![[IMG]](/icons/image2.gif) | 1587481323Chapter 15 Polycystic Kidney Disease.png | 2020-04-21 15:02 | 72K | |
![[IMG]](/icons/image2.gif) | 1587481323Chapter 15 Lupus nephritis.png | 2020-04-21 15:02 | 61K | |
![[IMG]](/icons/image2.gif) | 1587481323Chapter 15 Angiomyolipoma.png | 2020-04-21 15:02 | 106K | |
![[IMG]](/icons/image2.gif) | 1587481323Chapter 15 Bilateral Bladder Diverticula.png | 2020-04-21 15:02 | 59K | |
![[IMG]](/icons/image2.gif) | 1587481323Chapter 15 Twinkle Sign Artifact.png | 2020-04-21 15:02 | 202K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 14 Liver Abscess.png | 2020-04-21 15:02 | 77K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 14 Lymphocele.png | 2020-04-21 15:02 | 101K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 14 Loculated Ascites.png | 2020-04-21 15:02 | 61K | |
![[IMG]](/icons/image2.gif) | 1587481322Chpater 13 Acute Appendicitis.png | 2020-04-21 15:02 | 544K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 13 Small Bowel Obstruction.png | 2020-04-21 15:02 | 292K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 13 Gastric Carcinoma.png | 2020-04-21 15:02 | 250K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 12 Chronic Pancreatitis 2.png | 2020-04-21 15:02 | 304K | |
![[IMG]](/icons/image2.gif) | 1587481322Chpater 12 Dilated Panc Duct due to Mass in HOP.png | 2020-04-21 15:02 | 212K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 12 Chronic Pancreatitis.png | 2020-04-21 15:02 | 208K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 12 Pancreatic Pseudocyst.png | 2020-04-21 15:02 | 275K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 12 Adenocarcinoma.png | 2020-04-21 15:02 | 123K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 12 Acute Pancreatitis.png | 2020-04-21 15:02 | 60K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 11 Splenic hematoma.png | 2020-04-21 15:02 | 267K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 11 Cavernous Hemangioma.png | 2020-04-21 15:02 | 80K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 11 Splenic Infarct.png | 2020-04-21 15:02 | 208K | |
![[IMG]](/icons/image2.gif) | 1587481322Chpater 11 Splenic Abscess.png | 2020-04-21 15:02 | 95K | |
![[IMG]](/icons/image2.gif) | 1587481322Chapter 11 Splenomegaly.png | 2020-04-21 15:02 | 49K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 10 Acute cholecystitis.png | 2020-04-21 15:02 | 348K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 10 WES Sign.png | 2020-04-21 15:02 | 289K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 10 Choledocolithiasis.png | 2020-04-21 15:02 | 321K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 10 Dilated Intrahepatic Ducts.png | 2020-04-21 15:02 | 318K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 10 Gallstone.png | 2020-04-21 15:02 | 200K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 10 Gallbladder carcinoma.png | 2020-04-21 15:02 | 229K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 10 Adenomyomatosis.png | 2020-04-21 15:02 | 83K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 10 Cholesterolosis.png | 2020-04-21 15:02 | 152K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 10 Gallbladder sludge with microlithiasis.png | 2020-04-21 15:02 | 262K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 09 Polycystic Liver Disease.png | 2020-04-21 15:02 | 364K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 09 Simple Hepatic Cyst.png | 2020-04-21 15:02 | 99K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 09 Late stage cirrhosis.png | 2020-04-21 15:02 | 260K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 09 Focal fatty infiltrate.png | 2020-04-21 15:02 | 127K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 09 Hepatic Adenoma.png | 2020-04-21 15:02 | 372K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 09 Fatty liver.png | 2020-04-21 15:02 | 298K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 09 Metastases to the Liver.png | 2020-04-21 15:02 | 62K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 09 Cavernous Hemangioma.png | 2020-04-21 15:02 | 85K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 09 Portal Hypertension.png | 2020-04-21 15:02 | 321K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 09 Hepatocellular Carcinoma with Ascites.png | 2020-04-21 15:02 | 155K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 08 Aneurysm with True Lumen vs Residual Lumen from plaque_2.png | 2020-04-21 15:02 | 306K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 08 Aneurysm with True Lumen vs Residual Lumen from plaque_1.png | 2020-04-21 15:02 | 306K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 08 Aneurysm with True Lumen vs Residual Lumen from plaque.png | 2020-04-21 15:02 | 306K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 08 Fusiform Aneurysm.png | 2020-04-21 15:02 | 257K | |
![[IMG]](/icons/image2.gif) | 1587481321Chapter 08 Saccular Aneurysm.png | 2020-04-21 15:02 | 148K | |
![[IMG]](/icons/image2.gif) | 1587481320Chapter 19.20 Increased Color Doppler Scale.png | 2020-04-21 15:02 | 455K | |
![[IMG]](/icons/image2.gif) | 1587481320Chapter 19.20 Aliasing.png | 2020-04-21 15:02 | 347K | |
![[IMG]](/icons/image2.gif) | 1587481320Chapter 19.20 Steer the Color Box.png | 2020-04-21 15:02 | 371K | |
![[IMG]](/icons/image2.gif) | 1587481320Chapter 19.20 Increase Pulsed Doppler Gain.png | 2020-04-21 15:02 | 398K | |
![[IMG]](/icons/image2.gif) | 1587481320Chapter 19.20 Increase Wall Filter.png | 2020-04-21 15:02 | 514K | |
![[IMG]](/icons/image2.gif) | 1587481318Chapter 4 Spatial Pulse Length.png | 2020-04-21 15:01 | 7.8K | |
![[IMG]](/icons/image2.gif) | 1587481318Chapter 4 Pulse Duration.png | 2020-04-21 15:01 | 8.5K | |
![[IMG]](/icons/image2.gif) | 1587481318Chapter 1.2 In Phase Wave Constructive.png | 2020-04-21 15:01 | 552K | |
![[IMG]](/icons/image2.gif) | 1587481315Chapter 57 Omphalocele_1.png | 2020-04-21 15:01 | 154K | |
![[IMG]](/icons/image2.gif) | 1587481315Chapter 52 Umbilical Vein and Left Portal Vein_1.png | 2020-04-21 15:01 | 48K | |
![[IMG]](/icons/image2.gif) | 1587481315Chapter 57 Ascites Hydropic Fetus_2.png | 2020-04-21 15:01 | 391K | |
![[IMG]](/icons/image2.gif) | 1587481315Chapter 51 Foramen Ovale Interventricular Septum_2.png | 2020-04-21 15:01 | 238K | |
![[IMG]](/icons/image2.gif) | 1587481315Chapter 51 Nuchal Skin Fold_1.png | 2020-04-21 15:01 | 184K | |
![[IMG]](/icons/image2.gif) | 1587481315Chapter 51 Cisterna Magna Cerebellum Msmt_2.png | 2020-04-21 15:01 | 183K | |
![[IMG]](/icons/image2.gif) | 1587481315Chapter 51 Fetal Hair Placenta Amniotic Fluid_3.png | 2020-04-21 15:01 | 195K | |
![[IMG]](/icons/image2.gif) | 1587481315Chapter 51 Thalamus CSP Placenta BPD HC_4.png | 2020-04-21 15:01 | 281K | |
![[IMG]](/icons/image2.gif) | 1587481315Chapter 49 Secondary Yolk Sac_1.png | 2020-04-21 15:01 | 224K | |
![[IMG]](/icons/image2.gif) | 1587481315Chapter 49 Gestational sac.png | 2020-04-21 15:01 | 246K | |
![[IMG]](/icons/image2.gif) | 1587481314Chapter 57 Omphalocele.png | 2020-04-21 15:01 | 154K | |
![[IMG]](/icons/image2.gif) | 1587481314Chapter 57 Ascites Hydropic Fetus_1.png | 2020-04-21 15:01 | 391K | |
![[IMG]](/icons/image2.gif) | 1587481314Chapter 57 Ascites Hydropic Fetus.png | 2020-04-21 15:01 | 391K | |
![[IMG]](/icons/image2.gif) | 1587481314Chapter 57 Battledore or Marginal insertion.png | 2020-04-21 15:01 | 182K | |
![[IMG]](/icons/image2.gif) | 1587481314Chapter 56 Molar Pregnancy or Hydatidiform Mole.png | 2020-04-21 15:01 | 286K | |
![[IMG]](/icons/image2.gif) | 1587481314Chapter 56 Placental Lake.jpg | 2020-04-21 15:01 | 26K | |
![[IMG]](/icons/image2.gif) | 1587481314Chapter 56 Battledore insertion.png | 2020-04-21 15:01 | 217K | |
![[IMG]](/icons/image2.gif) | 1587481314Chapter 56 Velamentous Insertion.jpg | 2020-04-21 15:01 | 29K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 53 Umbilical Vein Fat Rind Transverse_2.png | 2020-04-21 15:01 | 234K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 53 Umbilical Vein Fat Rind Transverse_1.png | 2020-04-21 15:01 | 234K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 53 Umbilical Vein Fat Rind Transverse.png | 2020-04-21 15:01 | 234K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 52 Distal Femoral Epiphysis.png | 2020-04-21 15:01 | 297K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 52 Umbilical Vein and Left Portal Vein.png | 2020-04-21 15:01 | 48K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 52 Thalamus.png | 2020-04-21 15:01 | 246K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 52 Frontal Horns of Lateral Ventricles.png | 2020-04-21 15:01 | 320K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 52 Gestational Sac.png | 2020-04-21 15:01 | 41K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Transverse Renal Pelvis and Kidneys_1.png | 2020-04-21 15:01 | 264K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Transverse Renal Pelvis and Kidneys.png | 2020-04-21 15:01 | 264K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Foramen Ovale Interventricular Septum_1.png | 2020-04-21 15:01 | 238K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Foramen Ovale Interventricular Septum.png | 2020-04-21 15:01 | 238K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Diaphragm Lungs Heart_1.png | 2020-04-21 15:01 | 167K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Diaphragm Lungs Heart.png | 2020-04-21 15:01 | 167K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Longitudinal Spine.png | 2020-04-21 15:01 | 266K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Transverse Lumbar Spine at Liver Lt Kidney Level_1.png | 2020-04-21 15:01 | 231K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Transverse Lumbar Spine at Liver Lt Kidney Level.png | 2020-04-21 15:01 | 231K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Nuchal Skin Fold.png | 2020-04-21 15:01 | 184K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Dural Fold.png | 2020-04-21 15:01 | 206K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Cisterna Magna Cerebellum Msmt_1.png | 2020-04-21 15:01 | 183K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Cisterna Magna Cerebellum Msmt.png | 2020-04-21 15:01 | 183K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Cerebellum Msmt.png | 2020-04-21 15:01 | 176K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Fetal Hair Placenta Amniotic Fluid_2.png | 2020-04-21 15:01 | 195K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Fetal Hair Placenta Amniotic Fluid_1.png | 2020-04-21 15:01 | 195K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Fetal Hair Placenta Amniotic Fluid.png | 2020-04-21 15:01 | 195K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Thalamus CSP_1.png | 2020-04-21 15:01 | 262K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Thalamus CSP.png | 2020-04-21 15:01 | 262K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Thalamus CSP Placenta BPD HC_3.png | 2020-04-21 15:01 | 281K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Thalamus CSP Placenta BPD HC_2.png | 2020-04-21 15:01 | 281K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Thalamus CSP Placenta BPD HC_1.png | 2020-04-21 15:01 | 281K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Thalamus CSP Placenta BPD HC.png | 2020-04-21 15:01 | 281K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Lat Vent and Choroid Plexus_1.png | 2020-04-21 15:01 | 183K | |
![[IMG]](/icons/image2.gif) | 1587481313Chapter 51 Lat Vent and Choroid Plexus.png | 2020-04-21 15:01 | 183K | |
![[IMG]](/icons/image2.gif) | 1587481312Chapter 49 YS Embryo Gestational Sac_2.png | 2020-04-21 15:01 | 248K | |
![[IMG]](/icons/image2.gif) | 1587481312Chapter 49 YS Embryo Gestational Sac_1.png | 2020-04-21 15:01 | 248K | |
![[IMG]](/icons/image2.gif) | 1587481312Chapter 49 YS Embryo Gestational Sac.png | 2020-04-21 15:01 | 248K | |
![[IMG]](/icons/image2.gif) | 1587481312Chapter 49 Secondary Yolk Sac.png | 2020-04-21 15:01 | 224K | |
![[IMG]](/icons/image2.gif) | 1587481312Chp 49 Gestational sac.png | 2020-04-21 15:01 | 246K | |
![[IMG]](/icons/image2.gif) | 1587481312Final Transverse Abdomen A through H_2.png | 2020-04-21 15:01 | 103K | |
![[IMG]](/icons/image2.gif) | 1587481312Final Transverse Liver HV.png | 2020-04-21 15:01 | 96K | |
![[IMG]](/icons/image2.gif) | 1587481312Final Liver Transverse LV CL LLL.png | 2020-04-21 15:01 | 506K | |
![[IMG]](/icons/image2.gif) | 1587481312Final 18 19 20.png | 2020-04-21 15:01 | 48K | |
![[IMG]](/icons/image2.gif) | 1587481312Final Long GB.png | 2020-04-21 15:01 | 41K | |
![[IMG]](/icons/image2.gif) | 1587481312Final Transverse Abdomen A through H_1.png | 2020-04-21 15:01 | 103K | |
![[IMG]](/icons/image2.gif) | 1587481312Final Transverse Abdomen A through H.png | 2020-04-21 15:01 | 103K | |
![[IMG]](/icons/image2.gif) | 1587481312Chapter 11 What is being measured in this image accessory.png | 2020-04-21 15:01 | 296K | |
![[IMG]](/icons/image2.gif) | 1587481312Chapter 09 Identify what structure the arrows are pointing to.png | 2020-04-21 15:01 | 268K | |
![[IMG]](/icons/image2.gif) | 1587481312Final Long Aorta with Branches.png | 2020-04-21 15:01 | 76K | |
![[IMG]](/icons/image2.gif) | 1587481312Chapter 15 What structures are the arrows pointing to and 24_1.png | 2020-04-21 15:01 | 593K | |
![[IMG]](/icons/image2.gif) | 1587481312Final Double Right Ureteral Jets.png | 2020-04-21 15:01 | 354K | |
![[IMG]](/icons/image2.gif) | 1587481312Chapter 08 Celiac Axis transverse branches.png | 2020-04-21 15:01 | 227K | |
![[IMG]](/icons/image2.gif) | 1587481310Chapter 16 What structure is 23 24 25_2.png | 2020-04-21 15:01 | 550K | |
![[IMG]](/icons/image2.gif) | 1587481310Chapter 16 What structure is 23 24 25_1.png | 2020-04-21 15:01 | 550K | |
![[IMG]](/icons/image2.gif) | 1587481310Chapter 16 What structure is 23 24 25.png | 2020-04-21 15:01 | 550K | |
![[IMG]](/icons/image2.gif) | 1587481310Chapter 15 What part of the kidney is the arrow.png | 2020-04-21 15:01 | 354K | |
![[IMG]](/icons/image2.gif) | 1587481310Chapter 15 What structures are the arrows pointing to and 24.png | 2020-04-21 15:01 | 593K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 12 Transverse abdomen A through H and 24 25_6.png | 2020-04-21 15:01 | 80K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 12 Transverse abdomen A through H and 24 25_5.png | 2020-04-21 15:01 | 80K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 12 Transverse abdomen A through H and 24 25_4.png | 2020-04-21 15:01 | 80K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 12 Transverse abdomen A through H and 24 25_3.png | 2020-04-21 15:01 | 80K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 12 Transverse abdomen A through H and 24 25_2.png | 2020-04-21 15:01 | 80K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 12 Transverse abdomen A through H and 24 25_1.png | 2020-04-21 15:01 | 80K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 12 Transverse abdomen A through H and 24 25.png | 2020-04-21 15:01 | 80K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 11 What splenic measurement is being obtained scan plan and identify 25_2.png | 2020-04-21 15:01 | 483K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 11 What splenic measurement is being obtained scan plan and identify 25_1.png | 2020-04-21 15:01 | 483K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 11 What splenic measurement is being obtained scan plan and identify 25.png | 2020-04-21 15:01 | 483K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 11 What is being measured in this image wandering.png | 2020-04-21 15:01 | 296K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 11 What scan plane was this image obtained trv.png | 2020-04-21 15:01 | 389K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 11 What scan plane was this image obtained sag.png | 2020-04-21 15:01 | 419K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 10 Whar part of the GB is 23 24 25_3.png | 2020-04-21 15:01 | 141K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 10 Whar part of the GB is 23 24 25_2.png | 2020-04-21 15:01 | 141K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 10 Whar part of the GB is 23 24 25_1.png | 2020-04-21 15:01 | 141K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 10 Whar part of the GB is 23 24 25.png | 2020-04-21 15:01 | 141K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 10 What scan plane was this image taken trv.png | 2020-04-21 15:01 | 251K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 09 What lobe is 34 or structure is 35_1.png | 2020-04-21 15:01 | 253K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 09 What lobe is 34 or structure is 35.png | 2020-04-21 15:01 | 253K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 09 What vessel or structure is identified as 31 32 33_2.png | 2020-04-21 15:01 | 369K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 09 What vessel or structure is identified as 31 32 33_1.png | 2020-04-21 15:01 | 369K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 09 What vessel or structure is identified as 31 32 33.png | 2020-04-21 15:01 | 369K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 09 What structure is identified as 28 29 30_2.png | 2020-04-21 15:01 | 289K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 09 What structure is identified as 28 29 30_1.png | 2020-04-21 15:01 | 289K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 09 What structure is identified as 28 29 30.png | 2020-04-21 15:01 | 289K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 9 Identify what structure the arrows are pointing to_1.png | 2020-04-21 15:01 | 268K | |
![[IMG]](/icons/image2.gif) | 1587481309Chapter 9 Identify what structure the arrows are pointing to.png | 2020-04-21 15:01 | 268K | |
![[IMG]](/icons/image2.gif) | 1587481308Chapter 8 Celiac Axis transverse branches_2.png | 2020-04-21 15:01 | 227K | |
![[IMG]](/icons/image2.gif) | 1587481308Chapter 8 Celiac Axis transverse branches_1.png | 2020-04-21 15:01 | 227K | |
![[IMG]](/icons/image2.gif) | 1587481308Chapter 8 Celiac Axis transverse branches.png | 2020-04-21 15:01 | 227K | |
![[IMG]](/icons/image2.gif) | 1587481308Chapter 8 What structure is labeled as 16 or 17_1.png | 2020-04-21 15:01 | 170K | |
![[IMG]](/icons/image2.gif) | 1587481308Chapter 8 What structure is labeled as 16 or 17.png | 2020-04-21 15:01 | 170K | |
![[IMG]](/icons/image2.gif) | 1587481308Chapter 42 This image demonstrates a ____ uterus.png | 2020-04-21 15:01 | 322K | |
![[IMG]](/icons/image2.gif) | 1587481308Chapter 45 Patient hx pelvic fullness discomfort.emf.jpg | 2020-04-21 15:01 | 41K | |
![[IMG]](/icons/image2.gif) | 1587481308Chapter 43 Sagittal image shows a.jpg | 2020-04-21 15:01 | 20K | |
![[IMG]](/icons/image2.gif) | 1587481308Chapter 43 This image demonstrates an echogenic.png_1.jpg | 2020-04-21 15:01 | 53K | |
![[IMG]](/icons/image2.gif) | 1587481308Chapter 43 EV view demonstrates an _1.jpg | 2020-04-21 15:01 | 79K | |
![[IMG]](/icons/image2.gif) | 1587481308Chapter 42 The endometrium is during ___ phase.png | 2020-04-21 15:01 | 395K | |
![[IMG]](/icons/image2.gif) | 1587481308Chapter 46 This image demonstrate mulitple choice.jpg | 2020-04-21 15:01 | 32K | |
![[IMG]](/icons/image2.gif) | 1587481307Chapter 46 String of Pearls.jpg | 2020-04-21 15:01 | 61K | |
![[IMG]](/icons/image2.gif) | 1587481307Chapter 46 Normal ovary in follicular phase.jpg | 2020-04-21 15:01 | 45K | |
![[IMG]](/icons/image2.gif) | 1587481307Chapter 46 Vascular pedicle.jpg | 2020-04-21 15:01 | 63K | |
![[IMG]](/icons/image2.gif) | 1587481307Chapter 46 This image demonstrates ___ extending from.emf.jpg | 2020-04-21 15:01 | 50K | |
![[IMG]](/icons/image2.gif) | 1587481307Chapter 46 This image demonstrate mulitple choice.emf.jpg | 2020-04-21 15:01 | 32K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 45 An endometrioma is well-defined.jpg | 2020-04-21 15:01 | 35K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 45 Patient hx fever vaginal discharge and acute.png | 2020-04-21 15:01 | 397K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 45 Patient hx pelvic fullness discomfort.emf_1.jpg | 2020-04-21 15:01 | 41K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 44 Transbadominal image of this ovary.jpg | 2020-04-21 15:01 | 35K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 44 This mass demonstrates a.jpg | 2020-04-21 15:01 | 85K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 44 This sagittal image of the RUQ.jpg | 2020-04-21 15:01 | 103K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 44 This TV coronal image.jpg | 2020-04-21 15:01 | 41K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 44 The term.jpg | 2020-04-21 15:01 | 41K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 43 This image demonstrates an echogenic.png.jpg | 2020-04-21 15:01 | 53K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 43 EV view demonstrates an .jpg | 2020-04-21 15:01 | 79K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 43 These arrows are pointing to.jpg | 2020-04-21 15:01 | 61K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 43 Calcific myoma.jpg | 2020-04-21 15:01 | 61K | |
![[IMG]](/icons/image2.gif) | 1587481306Chapter 43 Sagittal image.jpg | 2020-04-21 15:01 | 58K | |
![[IMG]](/icons/image2.gif) | 1587481305Uterus2.png | 2020-04-21 15:01 | 322K | |
![[IMG]](/icons/image2.gif) | 1587481305Endo1.png | 2020-04-21 15:01 | 395K | |
![[IMG]](/icons/image2.gif) | 1587481305Uterus1.jpg | 2020-04-21 15:01 | 26K | |
![[IMG]](/icons/image2.gif) | 1587481231MR Head.png | 2020-04-21 15:00 | 59K | |
![[IMG]](/icons/image2.gif) | 1587481231MRA Abdominal Ao and branches_1.png | 2020-04-21 15:00 | 154K | |
![[IMG]](/icons/image2.gif) | 1587481231MRI Coronal Abdomen.png | 2020-04-21 15:00 | 255K | |
![[IMG]](/icons/image2.gif) | 1587481231MRA Abdominal Ao and branches.png | 2020-04-21 15:00 | 154K | |
![[IMG]](/icons/image2.gif) | 1587481231Brain final.png | 2020-04-21 15:00 | 27K | |
![[IMG]](/icons/image2.gif) | 1587481231RUQ Regions.png | 2020-04-21 15:00 | 41K | |
![[IMG]](/icons/image2.gif) | 1587481229Bladder UT Ov 18 19 20_2.png | 2020-04-21 15:00 | 59K | |
![[IMG]](/icons/image2.gif) | 1587481229Bladder UT Ov 18 19 20_1.png | 2020-04-21 15:00 | 59K | |
![[IMG]](/icons/image2.gif) | 1587481229Bladder UT Ov 18 19 20.png | 2020-04-21 15:00 | 59K | |
![[IMG]](/icons/image2.gif) | 1587481229Bladder UT Ov.png | 2020-04-21 15:00 | 54K | |
![[IMG]](/icons/image2.gif) | 1587481229Bladder ureters.png | 2020-04-21 15:00 | 199K | |
![[IMG]](/icons/image2.gif) | 1587481229Spleen 2.png | 2020-04-21 15:00 | 287K | |
![[IMG]](/icons/image2.gif) | 1587481228Spleen 1.png | 2020-04-21 15:00 | 274K | |
![[IMG]](/icons/image2.gif) | 1587481228CT Abdomen 14 15 16 17 18_4.png | 2020-04-21 15:00 | 45K | |
![[IMG]](/icons/image2.gif) | 1587481228CT Abdomen 14 15 16 17 18_3.png | 2020-04-21 15:00 | 45K | |
![[IMG]](/icons/image2.gif) | 1587481228CT Abdomen 14 15 16 17 18_2.png | 2020-04-21 15:00 | 45K | |
![[IMG]](/icons/image2.gif) | 1587481228CT Abdomen 14 15 16 17 18_1.png | 2020-04-21 15:00 | 45K | |
![[IMG]](/icons/image2.gif) | 1587481228CT Abdomen 14 15 16 17 18.png | 2020-04-21 15:00 | 45K | |
![[IMG]](/icons/image2.gif) | 1587481228Kidney Chapter 07.png | 2020-04-21 15:00 | 66K | |
![[IMG]](/icons/image2.gif) | 1587481228Kidney 16 17 18 19_3.png | 2020-04-21 15:00 | 267K | |
![[IMG]](/icons/image2.gif) | 1587481228Kidney 16 17 18 19_2.png | 2020-04-21 15:00 | 267K | |
![[IMG]](/icons/image2.gif) | 1587481228Kidney 16 17 18 19_1.png | 2020-04-21 15:00 | 267K | |
![[IMG]](/icons/image2.gif) | 1587481228Kidney 16 17 18 19.png | 2020-04-21 15:00 | 267K | |
![[IMG]](/icons/image2.gif) | 1587481228Pancreas 19 20_1.png | 2020-04-21 15:00 | 48K | |
![[IMG]](/icons/image2.gif) | 1587481228Pancreas 19 20.png | 2020-04-21 15:00 | 48K | |
![[IMG]](/icons/image2.gif) | 1587481228CT Abdomen 16 17 18_2.png | 2020-04-21 15:00 | 207K | |
![[IMG]](/icons/image2.gif) | 1587481228CT Abdomen 16 17 18_1.png | 2020-04-21 15:00 | 207K | |
![[IMG]](/icons/image2.gif) | 1587481228CT Abdomen 16 17 18.png | 2020-04-21 15:00 | 207K | |
![[IMG]](/icons/image2.gif) | 1587481228CT Abdomen 18 19 20_2.png | 2020-04-21 15:00 | 189K | |
![[IMG]](/icons/image2.gif) | 1587481228CT Abdomen 18 19 20_1.png | 2020-04-21 15:00 | 189K | |
![[IMG]](/icons/image2.gif) | 1587481228CT Abdomen 18 19 20.png | 2020-04-21 15:00 | 189K | |
![[IMG]](/icons/image2.gif) | 1587481228Gallbladder 17.png | 2020-04-21 15:00 | 37K | |
![[IMG]](/icons/image2.gif) | 1587481228Pancreas with CBD and Vessels 16.png | 2020-04-21 15:00 | 163K | |
![[IMG]](/icons/image2.gif) | 1587481228Liver1_2.png | 2020-04-21 15:00 | 56K | |
![[IMG]](/icons/image2.gif) | 1587481228Liver1_1.png | 2020-04-21 15:00 | 56K | |
![[IMG]](/icons/image2.gif) | 1587481228Liver1.png | 2020-04-21 15:00 | 56K | |
![[IMG]](/icons/image2.gif) | 1587481228Panc and Surrounding structures_4.png | 2020-04-21 15:00 | 50K | |
![[IMG]](/icons/image2.gif) | 1587481228Panc and Surrounding structures_3.png | 2020-04-21 15:00 | 50K | |
![[IMG]](/icons/image2.gif) | 1587481228Panc and Surrounding structures_2.png | 2020-04-21 15:00 | 50K | |
![[IMG]](/icons/image2.gif) | 1587481228Panc and Surrounding structures_1.png | 2020-04-21 15:00 | 50K | |
![[IMG]](/icons/image2.gif) | 1587481228Panc and Surrounding structures.png | 2020-04-21 15:00 | 50K | |
![[IMG]](/icons/image2.gif) | 1587481228IVC and HV_3.png | 2020-04-21 15:00 | 43K | |
![[IMG]](/icons/image2.gif) | 1587481228IVC and HV_2.png | 2020-04-21 15:00 | 43K | |
![[IMG]](/icons/image2.gif) | 1587481228IVC and HV_1.png | 2020-04-21 15:00 | 43K | |
![[IMG]](/icons/image2.gif) | 1587481228IVC and HV.png | 2020-04-21 15:00 | 43K | |
![[IMG]](/icons/image2.gif) | 1587481228AO and branches_2.png | 2020-04-21 15:00 | 314K | |
![[IMG]](/icons/image2.gif) | 1587481228AO and branches_1.png | 2020-04-21 15:00 | 314K | |
![[IMG]](/icons/image2.gif) | 1587481228AO and branches.png | 2020-04-21 15:00 | 314K | |
![[IMG]](/icons/image2.gif) | 1587481227BrainStructures_4.png | 2020-04-21 15:00 | 152K | |
![[IMG]](/icons/image2.gif) | 1587481227BrainStructures_3.png | 2020-04-21 15:00 | 152K | |
![[IMG]](/icons/image2.gif) | 1587481227BrainStructures_2.png | 2020-04-21 15:00 | 152K | |
![[IMG]](/icons/image2.gif) | 1587481227BrainStructures_1.png | 2020-04-21 15:00 | 152K | |
![[IMG]](/icons/image2.gif) | 1587481227BrainStructures.png | 2020-04-21 15:00 | 152K | |
![[IMG]](/icons/image2.gif) | 1587481227Panc and Vessels.png | 2020-04-21 15:00 | 442K | |
![[IMG]](/icons/image2.gif) | 1587481227Brain2.png | 2020-04-21 15:00 | 138K | |
![[IMG]](/icons/image2.gif) | 1587481227Brain1.png | 2020-04-21 15:00 | 193K | |
![[IMG]](/icons/image2.gif) | babygram.jpg | 2020-04-15 00:37 | 12K | |
![[IMG]](/icons/image2.gif) | Cystic duct.jpg | 2020-04-15 00:18 | 32K | |
![[IMG]](/icons/image2.gif) | Carm-boom.jpg | 2020-04-15 00:09 | 34K | |
![[IMG]](/icons/image2.gif) | MRI Image_1.jpg | 2020-04-14 00:57 | 33K | |
![[IMG]](/icons/image2.gif) | AIR_1.jpg | 2020-04-14 00:39 | 15K | |
![[IMG]](/icons/image2.gif) | Bone Density Image_2.jpg | 2020-04-14 00:19 | 21K | |
![[IMG]](/icons/image2.gif) | AIR.jpg | 2020-04-10 19:54 | 15K | |
![[IMG]](/icons/image2.gif) | Ultrasound Image_1.jpg | 2020-04-10 19:42 | 23K | |
![[IMG]](/icons/image2.gif) | Nuclear Medicine Image_1.jpg | 2020-04-10 19:39 | 23K | |
![[IMG]](/icons/image2.gif) | Bone Density Image_1.jpg | 2020-04-10 17:53 | 21K | |
![[IMG]](/icons/image2.gif) | FL Beam Alignment.jpg | 2020-04-03 14:06 | 24K | |
![[IMG]](/icons/image2.gif) | Chapter 57 Omphalocele_1.png | 2020-04-02 16:28 | 154K | |
![[IMG]](/icons/image2.gif) | Chapter 52 Umbilical Vein and Left Portal Vein_1.png | 2020-04-02 16:27 | 48K | |
![[IMG]](/icons/image2.gif) | Chapter 57 Ascites Hydropic Fetus_2.png | 2020-04-02 16:26 | 391K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Foramen Ovale Interventricular Septum_2.png | 2020-04-02 16:26 | 238K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Nuchal Skin Fold_1.png | 2020-04-02 16:25 | 184K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Cisterna Magna Cerebellum Msmt_2.png | 2020-04-02 16:22 | 183K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Fetal Hair Placenta Amniotic Fluid_3.png | 2020-04-02 16:21 | 195K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Thalamus CSP Placenta BPD HC_4.png | 2020-04-02 16:21 | 281K | |
![[IMG]](/icons/image2.gif) | Chapter 49 Secondary Yolk Sac_1.png | 2020-04-02 16:20 | 224K | |
![[IMG]](/icons/image2.gif) | Chapter 49 Gestational sac.png | 2020-04-02 16:19 | 246K | |
![[IMG]](/icons/image2.gif) | V-fib.gif | 2020-04-01 19:12 | 119K | |
![[IMG]](/icons/image2.gif) | Tachycardia.gif | 2020-04-01 19:11 | 120K | |
![[IMG]](/icons/image2.gif) | Nuclear Medicine Image.jpg | 2020-03-25 16:28 | 23K | |
![[IMG]](/icons/image2.gif) | Ultrasound Image.jpg | 2020-03-25 16:25 | 23K | |
![[IMG]](/icons/image2.gif) | MRI Image.jpg | 2020-03-25 14:56 | 33K | |
![[IMG]](/icons/image2.gif) | Bone Density Image.jpg | 2020-03-25 14:42 | 21K | |
![[IMG]](/icons/image2.gif) | Intensifier diagram for exam.jpg | 2020-03-24 12:32 | 25K | |
![[IMG]](/icons/image2.gif) | Torus FX.jpg | 2020-03-23 23:55 | 11K | |
![[IMG]](/icons/image2.gif) | Subluxation.jpg | 2020-03-23 23:54 | 8.5K | |
![[IMG]](/icons/image2.gif) | Chapter 19.20 Increased Color Doppler Scale.png | 2020-03-04 19:32 | 455K | |
![[IMG]](/icons/image2.gif) | Chapter 19.20 Aliasing.png | 2020-03-04 19:32 | 347K | |
![[IMG]](/icons/image2.gif) | Chapter 19.20 Steer the Color Box.png | 2020-03-04 19:32 | 371K | |
![[IMG]](/icons/image2.gif) | Chapter 19.20 Increase Pulsed Doppler Gain.png | 2020-03-04 19:31 | 398K | |
![[IMG]](/icons/image2.gif) | Chapter 19.20 Increase Wall Filter.png | 2020-03-04 19:30 | 514K | |
![[IMG]](/icons/image2.gif) | Chapter 4 Spatial Pulse Length.png | 2020-03-04 19:10 | 7.8K | |
![[IMG]](/icons/image2.gif) | Chapter 4 Pulse Duration.png | 2020-03-04 19:10 | 8.5K | |
![[IMG]](/icons/image2.gif) | Chapter 1.2 In Phase Wave Constructive.png | 2020-03-04 19:05 | 552K | |
![[IMG]](/icons/image2.gif) | Chapter 08 Aneurysm with True Lumen vs Residual Lumen from plaque_2.png | 2020-03-02 19:43 | 306K | |
![[IMG]](/icons/image2.gif) | Chapter 08 Aneurysm with True Lumen vs Residual Lumen from plaque_1.png | 2020-03-02 19:43 | 306K | |
![[IMG]](/icons/image2.gif) | Chapter 08 Aneurysm with True Lumen vs Residual Lumen from plaque.png | 2020-03-02 19:43 | 306K | |
![[IMG]](/icons/image2.gif) | Chapter 08 Fusiform Aneurysm.png | 2020-03-02 19:42 | 257K | |
![[IMG]](/icons/image2.gif) | Chapter 08 Saccular Aneurysm.png | 2020-03-02 19:42 | 148K | |
![[IMG]](/icons/image2.gif) | Chapter 09 Polycystic Liver Disease.png | 2020-03-02 19:38 | 364K | |
![[IMG]](/icons/image2.gif) | Chapter 09 Simple Hepatic Cyst.png | 2020-03-02 19:38 | 99K | |
![[IMG]](/icons/image2.gif) | Chapter 09 Late stage cirrhosis.png | 2020-03-02 19:37 | 260K | |
![[IMG]](/icons/image2.gif) | Chapter 09 Focal fatty infiltrate.png | 2020-03-02 19:36 | 127K | |
![[IMG]](/icons/image2.gif) | Chapter 09 Hepatic Adenoma.png | 2020-03-02 19:36 | 372K | |
![[IMG]](/icons/image2.gif) | Chapter 09 Fatty liver.png | 2020-03-02 19:35 | 298K | |
![[IMG]](/icons/image2.gif) | Chapter 09 Metastases to the Liver.png | 2020-03-02 19:35 | 62K | |
![[IMG]](/icons/image2.gif) | Chapter 09 Cavernous Hemangioma.png | 2020-03-02 19:34 | 85K | |
![[IMG]](/icons/image2.gif) | Chapter 09 Portal Hypertension.png | 2020-03-02 19:34 | 321K | |
![[IMG]](/icons/image2.gif) | Chapter 09 Hepatocellular Carcinoma with Ascites.png | 2020-03-02 19:33 | 155K | |
![[IMG]](/icons/image2.gif) | Chapter 10 Acute cholecystitis.png | 2020-03-02 19:26 | 348K | |
![[IMG]](/icons/image2.gif) | Chapter 10 WES Sign.png | 2020-03-02 19:25 | 289K | |
![[IMG]](/icons/image2.gif) | Chapter 10 Choledocolithiasis.png | 2020-03-02 19:25 | 321K | |
![[IMG]](/icons/image2.gif) | Chapter 10 Dilated Intrahepatic Ducts.png | 2020-03-02 19:25 | 318K | |
![[IMG]](/icons/image2.gif) | Chapter 10 Gallstone.png | 2020-03-02 19:24 | 200K | |
![[IMG]](/icons/image2.gif) | Chapter 10 Gallbladder carcinoma.png | 2020-03-02 19:24 | 229K | |
![[IMG]](/icons/image2.gif) | Chapter 10 Adenomyomatosis.png | 2020-03-02 19:24 | 83K | |
![[IMG]](/icons/image2.gif) | Chapter 10 Cholesterolosis.png | 2020-03-02 19:23 | 152K | |
![[IMG]](/icons/image2.gif) | Chapter 10 Gallbladder sludge with microlithiasis.png | 2020-03-02 19:23 | 262K | |
![[IMG]](/icons/image2.gif) | Chapter 11 Splenic hematoma.png | 2020-03-02 19:16 | 267K | |
![[IMG]](/icons/image2.gif) | Chapter 11 Cavernous Hemangioma.png | 2020-03-02 19:16 | 80K | |
![[IMG]](/icons/image2.gif) | Chapter 11 Splenic Infarct.png | 2020-03-02 19:14 | 208K | |
![[IMG]](/icons/image2.gif) | Chpater 11 Splenic Abscess.png | 2020-03-02 19:14 | 95K | |
![[IMG]](/icons/image2.gif) | Chapter 11 Splenomegaly.png | 2020-03-02 19:13 | 49K | |
![[IMG]](/icons/image2.gif) | Chapter 12 Chronic Pancreatitis 2.png | 2020-03-02 19:08 | 304K | |
![[IMG]](/icons/image2.gif) | Chpater 12 Dilated Panc Duct due to Mass in HOP.png | 2020-03-02 19:07 | 212K | |
![[IMG]](/icons/image2.gif) | Chapter 12 Chronic Pancreatitis.png | 2020-03-02 19:07 | 208K | |
![[IMG]](/icons/image2.gif) | Chapter 12 Pancreatic Pseudocyst.png | 2020-03-02 19:06 | 275K | |
![[IMG]](/icons/image2.gif) | Chapter 12 Adenocarcinoma.png | 2020-03-02 19:06 | 123K | |
![[IMG]](/icons/image2.gif) | Chapter 12 Acute Pancreatitis.png | 2020-03-02 19:05 | 60K | |
![[IMG]](/icons/image2.gif) | Chpater 13 Acute Appendicitis.png | 2020-03-02 18:59 | 544K | |
![[IMG]](/icons/image2.gif) | Chapter 13 Small Bowel Obstruction.png | 2020-03-02 18:58 | 292K | |
![[IMG]](/icons/image2.gif) | Chapter 13 Gastric Carcinoma.png | 2020-03-02 18:58 | 250K | |
![[IMG]](/icons/image2.gif) | Chapter 14 Liver Abscess.png | 2020-03-02 18:54 | 77K | |
![[IMG]](/icons/image2.gif) | Chapter 14 Lymphocele.png | 2020-03-02 18:53 | 101K | |
![[IMG]](/icons/image2.gif) | Chapter 14 Loculated Ascites.png | 2020-03-02 18:53 | 61K | |
![[IMG]](/icons/image2.gif) | Chapter 15 Simple Renal Cyst.png | 2020-03-02 17:23 | 52K | |
![[IMG]](/icons/image2.gif) | Chapter 15 Color Doppler on Renal Cyst.png | 2020-03-02 17:23 | 362K | |
![[IMG]](/icons/image2.gif) | Chapter 15 Medullary Sponge Kidney.png | 2020-03-02 17:22 | 68K | |
![[IMG]](/icons/image2.gif) | Chapter 15 Polycystic Kidney Disease.png | 2020-03-02 17:22 | 72K | |
![[IMG]](/icons/image2.gif) | Chapter 15 Lupus nephritis.png | 2020-03-02 17:22 | 61K | |
![[IMG]](/icons/image2.gif) | Chapter 15 Angiomyolipoma.png | 2020-03-02 17:21 | 106K | |
![[IMG]](/icons/image2.gif) | Chapter 15 Bilateral Bladder Diverticula.png | 2020-03-02 17:21 | 59K | |
![[IMG]](/icons/image2.gif) | Chapter 15 Twinkle Sign Artifact.png | 2020-03-02 17:21 | 202K | |
![[IMG]](/icons/image2.gif) | Chapter 16 Retroperitoneal Fibrosis.png | 2020-03-02 17:14 | 227K | |
![[IMG]](/icons/image2.gif) | Chapter 16 Adrenal cyst.png | 2020-03-02 17:14 | 259K | |
![[IMG]](/icons/image2.gif) | Chapter 16 Adrenal hemorrhage.png | 2020-03-02 17:14 | 40K | |
![[IMG]](/icons/image2.gif) | Chapter 57 Omphalocele.png | 2020-03-02 16:37 | 154K | |
![[IMG]](/icons/image2.gif) | Chapter 57 Ascites Hydropic Fetus_1.png | 2020-03-02 16:37 | 391K | |
![[IMG]](/icons/image2.gif) | Chapter 57 Ascites Hydropic Fetus.png | 2020-03-02 16:36 | 391K | |
![[IMG]](/icons/image2.gif) | Chapter 57 Battledore or Marginal insertion.png | 2020-03-02 16:36 | 182K | |
![[IMG]](/icons/image2.gif) | Chapter 56 Molar Pregnancy or Hydatidiform Mole.png | 2020-03-02 16:31 | 286K | |
![[IMG]](/icons/image2.gif) | Chapter 56 Placental Lake.jpg | 2020-03-02 16:31 | 26K | |
![[IMG]](/icons/image2.gif) | Chapter 56 Battledore insertion.png | 2020-03-02 16:31 | 217K | |
![[IMG]](/icons/image2.gif) | Chapter 56 Velamentous Insertion.jpg | 2020-03-02 16:30 | 29K | |
![[IMG]](/icons/image2.gif) | Chapter 53 Umbilical Vein Fat Rind Transverse_2.png | 2020-03-02 16:23 | 234K | |
![[IMG]](/icons/image2.gif) | Chapter 53 Umbilical Vein Fat Rind Transverse_1.png | 2020-03-02 16:23 | 234K | |
![[IMG]](/icons/image2.gif) | Chapter 53 Umbilical Vein Fat Rind Transverse.png | 2020-03-02 16:23 | 234K | |
![[IMG]](/icons/image2.gif) | Chapter 52 Distal Femoral Epiphysis.png | 2020-03-02 16:09 | 297K | |
![[IMG]](/icons/image2.gif) | Chapter 52 Umbilical Vein and Left Portal Vein.png | 2020-03-02 16:08 | 48K | |
![[IMG]](/icons/image2.gif) | Chapter 52 Thalamus.png | 2020-03-02 16:08 | 246K | |
![[IMG]](/icons/image2.gif) | Chapter 52 Frontal Horns of Lateral Ventricles.png | 2020-03-02 16:08 | 320K | |
![[IMG]](/icons/image2.gif) | Chapter 52 Gestational Sac.png | 2020-03-02 16:08 | 41K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Transverse Renal Pelvis and Kidneys_1.png | 2020-03-02 15:58 | 264K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Transverse Renal Pelvis and Kidneys.png | 2020-03-02 15:58 | 264K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Foramen Ovale Interventricular Septum_1.png | 2020-03-02 15:58 | 238K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Foramen Ovale Interventricular Septum.png | 2020-03-02 15:57 | 238K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Diaphragm Lungs Heart_1.png | 2020-03-02 15:57 | 167K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Diaphragm Lungs Heart.png | 2020-03-02 15:57 | 167K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Longitudinal Spine.png | 2020-03-02 15:56 | 266K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Transverse Lumbar Spine at Liver Lt Kidney Level_1.png | 2020-03-02 15:56 | 231K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Transverse Lumbar Spine at Liver Lt Kidney Level.png | 2020-03-02 15:55 | 231K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Nuchal Skin Fold.png | 2020-03-02 15:54 | 184K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Dural Fold.png | 2020-03-02 15:54 | 206K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Cisterna Magna Cerebellum Msmt_1.png | 2020-03-02 15:54 | 183K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Cisterna Magna Cerebellum Msmt.png | 2020-03-02 15:49 | 183K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Cerebellum Msmt.png | 2020-03-02 15:49 | 176K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Fetal Hair Placenta Amniotic Fluid_2.png | 2020-03-02 15:48 | 195K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Fetal Hair Placenta Amniotic Fluid_1.png | 2020-03-02 15:48 | 195K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Fetal Hair Placenta Amniotic Fluid.png | 2020-03-02 15:47 | 195K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Thalamus CSP_1.png | 2020-03-02 15:47 | 262K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Thalamus CSP.png | 2020-03-02 15:46 | 262K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Thalamus CSP Placenta BPD HC_3.png | 2020-03-02 15:46 | 281K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Thalamus CSP Placenta BPD HC_2.png | 2020-03-02 15:44 | 281K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Thalamus CSP Placenta BPD HC_1.png | 2020-03-02 15:44 | 281K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Thalamus CSP Placenta BPD HC.png | 2020-03-02 15:43 | 281K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Lat Vent and Choroid Plexus_1.png | 2020-03-02 15:43 | 183K | |
![[IMG]](/icons/image2.gif) | Chapter 51 Lat Vent and Choroid Plexus.png | 2020-03-02 15:41 | 183K | |
![[IMG]](/icons/image2.gif) | Chapter 49 YS Embryo Gestational Sac_2.png | 2020-03-02 15:28 | 248K | |
![[IMG]](/icons/image2.gif) | Chapter 49 YS Embryo Gestational Sac_1.png | 2020-03-02 15:27 | 248K | |
![[IMG]](/icons/image2.gif) | Chapter 49 YS Embryo Gestational Sac.png | 2020-03-02 15:27 | 248K | |
![[IMG]](/icons/image2.gif) | Chapter 49 Secondary Yolk Sac.png | 2020-03-02 15:27 | 224K | |
![[IMG]](/icons/image2.gif) | Chp 49 Gestational sac.png | 2020-03-02 15:26 | 246K | |
![[IMG]](/icons/image2.gif) | Pilot Humerus AEC Diagram.png | 2020-02-21 16:31 | 16K | |
![[IMG]](/icons/image2.gif) | Y View_1.jpg | 2020-02-12 17:47 | 33K | |
![[IMG]](/icons/image2.gif) | Y View.jpg | 2020-02-12 17:44 | 33K | |
![[IMG]](/icons/image2.gif) | Hill-Sachs.jpg | 2020-02-04 18:41 | 37K | |
![[IMG]](/icons/image2.gif) | Bankart.jpg | 2020-02-04 18:38 | 26K | |
![[IMG]](/icons/image2.gif) | Pilot Lat Knee for angle.png | 2020-01-23 17:03 | 25K | |
![[IMG]](/icons/image2.gif) | AP chest wires_1.png | 2019-11-18 20:25 | 397K | |
![[IMG]](/icons/image2.gif) | Pilot AP Erect_1.png | 2019-11-18 20:23 | 107K | |
![[IMG]](/icons/image2.gif) | 2019 Pig PA Chest.jpg | 2019-11-15 20:48 | 34K | |
![[IMG]](/icons/image2.gif) | 2019 Pigg lat -multiple errors.jpg | 2019-11-15 20:43 | 29K | |
![[IMG]](/icons/image2.gif) | good lat decub_1.png | 2019-11-15 20:37 | 88K | |
![[IMG]](/icons/image2.gif) | AP erect chin rotation_1.png | 2019-11-15 20:33 | 224K | |
![[IMG]](/icons/image2.gif) | pigg lateral.png | 2019-11-15 20:30 | 72K | |
![[IMG]](/icons/image2.gif) | Lateral with chair in pic_1.png | 2019-11-15 20:14 | 74K | |
![[IMG]](/icons/image2.gif) | Pilot AP Erect- rotation.png | 2019-11-15 20:11 | 81K | |
![[IMG]](/icons/image2.gif) | decub chest_1.png | 2019-11-15 19:59 | 104K | |
![[IMG]](/icons/image2.gif) | Lat arms not erect_1.png | 2019-11-15 19:54 | 116K | |
![[IMG]](/icons/image2.gif) | 15737618791536868041boxer.png | 2019-11-14 20:04 | 57K | |
![[IMG]](/icons/image2.gif) | 15737618791536868041child.png | 2019-11-14 20:04 | 62K | |
![[IMG]](/icons/image2.gif) | 15737618791536868041hand rot.png | 2019-11-14 20:04 | 78K | |
![[IMG]](/icons/image2.gif) | 15737618791536868041Picture7_2.png | 2019-11-14 20:04 | 232K | |
![[IMG]](/icons/image2.gif) | 15737618791536868041Picture6_2.jpg | 2019-11-14 20:04 | 15K | |
![[IMG]](/icons/image2.gif) | 157376187915368680411506344230hand_20w_20nail.jpg | 2019-11-14 20:04 | 35K | |
![[IMG]](/icons/image2.gif) | 15737618791536868041Picture3_13.png | 2019-11-14 20:04 | 45K | |
![[IMG]](/icons/image2.gif) | 157376187915368680411506344230hand lat rotation.jpg | 2019-11-14 20:04 | 27K | |
![[IMG]](/icons/image2.gif) | 157376187915368680411506344230Finger pa collimation.jpg | 2019-11-14 20:04 | 27K | |
![[IMG]](/icons/image2.gif) | 157376187915368680411506344230hand obl.jpg | 2019-11-14 20:04 | 28K | |
![[IMG]](/icons/image2.gif) | 15737618791536868041ulna.png | 2019-11-14 20:04 | 30K | |
![[IMG]](/icons/image2.gif) | 157376187915368680411506344230Hand lat 2.jpg | 2019-11-14 20:04 | 44K | |
![[IMG]](/icons/image2.gif) | 157376187915368680411506344230thumb ap.jpg | 2019-11-14 20:04 | 40K | |
![[IMG]](/icons/image2.gif) | 15737618791536868041Picture2.png | 2019-11-14 20:04 | 179K | |
![[IMG]](/icons/image2.gif) | 15737618791536868041finger.png | 2019-11-14 20:04 | 40K | |
![[IMG]](/icons/image2.gif) | 157376187915368680411506344230Hand anatomy_2.jpg | 2019-11-14 20:04 | 29K | |
![[IMG]](/icons/image2.gif) | 157376187915368680411506344230thumb obl.jpg | 2019-11-14 20:04 | 11K | |
![[IMG]](/icons/image2.gif) | 157376187915368680401506344230Hand anatomy_3.jpg | 2019-11-14 20:04 | 29K | |
![[IMG]](/icons/image2.gif) | 157376187915368680401506344230Hand anatomy_4.jpg | 2019-11-14 20:04 | 29K | |
![[IMG]](/icons/image2.gif) | 157376187915368680401506344230finger lat_1.jpg | 2019-11-14 20:04 | 7.8K | |
![[IMG]](/icons/image2.gif) | 157376187915368680401506344230Hand anatomy_1.jpg | 2019-11-14 20:04 | 29K | |
![[IMG]](/icons/image2.gif) | 157376187915368680401506344230Hand anatomy.jpg | 2019-11-14 20:04 | 29K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040AP forearm_1.jpg | 2019-11-14 20:04 | 20K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040img 10 lat elbow.jpg | 2019-11-14 20:04 | 21K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040img 9 lat elbow.jpg | 2019-11-14 20:04 | 19K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040img 8 obl wrist.jpg | 2019-11-14 20:04 | 10K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040img 7 navi.jpg | 2019-11-14 20:04 | 13K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040image 6 navi.jpg | 2019-11-14 20:04 | 13K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040AP forearm (pilot).jpg | 2019-11-14 20:04 | 12K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040lateral forearm.jpg | 2019-11-14 20:04 | 20K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040Lateral oblique elbow.jpg | 2019-11-14 20:04 | 15K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040med obl.png | 2019-11-14 20:04 | 68K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040diagram 7 lat elbow.jpg | 2019-11-14 20:04 | 22K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040diagram 7 lat elbow_1.jpg | 2019-11-14 20:04 | 22K | |
![[IMG]](/icons/image2.gif) | 157376187915368680401506344229Diagram 5_1.jpg | 2019-11-14 20:04 | 16K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040diagram 4 wrist.jpg | 2019-11-14 20:04 | 19K | |
![[IMG]](/icons/image2.gif) | 15737618791536868040replacement lat wrist.png | 2019-11-14 20:04 | 24K | |
![[IMG]](/icons/image2.gif) | 15737618781536868040diagram 3.png | 2019-11-14 20:04 | 97K | |
![[IMG]](/icons/image2.gif) | 15737618781536868040diagram 3_1.png | 2019-11-14 20:04 | 97K | |
![[IMG]](/icons/image2.gif) | 15737618781536868040diagram 3_2.png | 2019-11-14 20:04 | 97K | |
![[IMG]](/icons/image2.gif) | 157376187815368680401506344229lat pigg.jpg | 2019-11-14 20:04 | 19K | |
![[IMG]](/icons/image2.gif) | 157376187815368680401506344229PA pigg.jpg | 2019-11-14 20:04 | 33K | |
![[IMG]](/icons/image2.gif) | 157376187815368680401506344229sufficient lat.jpg | 2019-11-14 20:04 | 17K | |
![[IMG]](/icons/image2.gif) | 157376187815368680401506344229Good CXR.jpg | 2019-11-14 20:04 | 27K | |
![[IMG]](/icons/image2.gif) | 157376187815368680401506344229bad PA CXR 2_1.jpg | 2019-11-14 20:04 | 18K | |
![[IMG]](/icons/image2.gif) | 157376187815368680401506344229bad lat CXR 2.jpg | 2019-11-14 20:04 | 30K | |
![[IMG]](/icons/image2.gif) | 157376187815368680401506344229Bad PA CXR smaller.jpg | 2019-11-14 20:04 | 67K | |
![[IMG]](/icons/image2.gif) | 157376187815368680401506344229Bad lat CXR.jpg | 2019-11-14 20:04 | 25K | |
![[IMG]](/icons/image2.gif) | 157376187815368680401506344229PA CXR smaller.jpg | 2019-11-14 20:04 | 77K | |
![[IMG]](/icons/image2.gif) | 157376187815368680401506344229L Lat CXR.jpg | 2019-11-14 20:04 | 20K | |
![[IMG]](/icons/image2.gif) | 157376187815368680401506344229Lingula.jpg | 2019-11-14 20:04 | 17K | |
![[IMG]](/icons/image2.gif) | 157376187815368680391506344229Lungs.jpg | 2019-11-14 20:04 | 23K | |
![[IMG]](/icons/image2.gif) | 157376187815368680391506344228Decub 01.jpg | 2019-11-14 20:04 | 61K | |
![[IMG]](/icons/image2.gif) | 157376187815368680391506344228Lat CXR.jpg | 2019-11-14 20:04 | 49K | |
![[IMG]](/icons/image2.gif) | 157376187815368680391506344228Image 03.jpg | 2019-11-14 20:04 | 37K | |
![[IMG]](/icons/image2.gif) | 157376187815368680391506344228Image 02.jpg | 2019-11-14 20:04 | 20K | |
![[IMG]](/icons/image2.gif) | Picture2_12.png | 2019-11-14 18:37 | 22K | |
![[IMG]](/icons/image2.gif) | Picture1_29.png | 2019-11-14 18:35 | 191K | |
![[IMG]](/icons/image2.gif) | new4.png | 2019-11-14 15:18 | 578K | |
![[IMG]](/icons/image2.gif) | new3.png | 2019-11-14 15:13 | 111K | |
![[IMG]](/icons/image2.gif) | new2.png | 2019-11-14 15:10 | 130K | |
![[IMG]](/icons/image2.gif) | new1.png | 2019-11-14 14:51 | 143K | |
![[IMG]](/icons/image2.gif) | exam1.jpg | 2019-11-14 14:46 | 93K | |
![[IMG]](/icons/image2.gif) | Abdomen Image.jpg | 2019-11-13 14:19 | 62K | |
![[IMG]](/icons/image2.gif) | Hip Image.jpg | 2019-11-13 14:10 | 21K | |
![[IMG]](/icons/image2.gif) | Chest Image.jpg | 2019-11-13 14:02 | 23K | |
![[IMG]](/icons/image2.gif) | exam6.jpg | 2019-11-12 16:52 | 171K | |
![[IMG]](/icons/image2.gif) | exam3.jpg | 2019-11-11 20:21 | 64K | |
![[IMG]](/icons/image2.gif) | exam2.jpg | 2019-11-11 20:19 | 114K | |
![[IMG]](/icons/image2.gif) | exam4.jpg | 2019-11-11 17:01 | 162K | |
![[IMG]](/icons/image2.gif) | Caldwell.png | 2019-11-01 17:30 | 28K | |
![[IMG]](/icons/image2.gif) | waters_2.png | 2019-11-01 17:27 | 39K | |
![[IMG]](/icons/image2.gif) | Pilot IA 2_1.jpg | 2019-10-28 19:33 | 23K | |
![[IMG]](/icons/image2.gif) | thyroid cart_1.jpg | 2019-10-25 19:39 | 74K | |
![[IMG]](/icons/image2.gif) | thyroid cart.jpg | 2019-10-25 19:36 | 74K | |
![[IMG]](/icons/image2.gif) | Pilot 1 heel.jpg | 2019-10-24 18:39 | 102K | |
![[IMG]](/icons/image2.gif) | Lat foot with arrow.jpg | 2019-10-24 12:38 | 49K | |
![[IMG]](/icons/image2.gif) | Lat foot pilot _2.jpg | 2019-10-23 17:50 | 19K | |
![[IMG]](/icons/image2.gif) | Picture2_11.png | 2019-10-21 15:38 | 132K | |
![[IMG]](/icons/image2.gif) | Picture3_20.png | 2019-10-21 15:36 | 64K | |
![[IMG]](/icons/image2.gif) | Lat elbow (pilot)_2.jpg | 2019-10-15 19:28 | 14K | |
![[IMG]](/icons/image2.gif) | AP forearm_2.jpg | 2019-10-15 19:22 | 20K | |
![[IMG]](/icons/image2.gif) | Pilot IA 2.jpg | 2019-10-11 15:52 | 23K | |
![[IMG]](/icons/image2.gif) | 1570725524heel.png | 2019-10-10 16:38 | 36K | |
![[IMG]](/icons/image2.gif) | 1570725524toes obl.png | 2019-10-10 16:38 | 193K | |
![[IMG]](/icons/image2.gif) | 1570725524ap foot.png | 2019-10-10 16:38 | 76K | |
![[IMG]](/icons/image2.gif) | 1570725524toe.png | 2019-10-10 16:38 | 28K | |
![[IMG]](/icons/image2.gif) | 1570725524lat.png | 2019-10-10 16:38 | 259K | |
![[IMG]](/icons/image2.gif) | 1570725524Picture1_7.png | 2019-10-10 16:38 | 259K | |
![[IMG]](/icons/image2.gif) | 1570725523foot d.png | 2019-10-10 16:38 | 243K | |
![[IMG]](/icons/image2.gif) | 1570725523Picture1_5.png | 2019-10-10 16:38 | 107K | |
![[IMG]](/icons/image2.gif) | 1570725523Picture6_1.jpg | 2019-10-10 16:38 | 17K | |
![[IMG]](/icons/image2.gif) | 1570725523Picture5_1.jpg | 2019-10-10 16:38 | 20K | |
![[IMG]](/icons/image2.gif) | 1570725523Picture5.jpg | 2019-10-10 16:38 | 20K | |
![[IMG]](/icons/image2.gif) | 1570725523Picture2_7.jpg | 2019-10-10 16:38 | 21K | |
![[IMG]](/icons/image2.gif) | 1570725523Picture2_6.jpg | 2019-10-10 16:38 | 21K | |
![[IMG]](/icons/image2.gif) | 1570725523Picture1_2.jpg | 2019-10-10 16:38 | 14K | |
![[IMG]](/icons/image2.gif) | 1570725523Picture1_1.jpg | 2019-10-10 16:38 | 14K | |
![[IMG]](/icons/image2.gif) | 1570725523lat foot img_2.jpg | 2019-10-10 16:38 | 19K | |
![[IMG]](/icons/image2.gif) | 1570725523Picture2_6.png | 2019-10-10 16:38 | 98K | |
![[IMG]](/icons/image2.gif) | 1570725523lat foot img.jpg | 2019-10-10 16:38 | 19K | |
![[IMG]](/icons/image2.gif) | 1570725523heel img anatomy_1.jpg | 2019-10-10 16:38 | 9.6K | |
![[IMG]](/icons/image2.gif) | 1570725523heel img anatomy.jpg | 2019-10-10 16:38 | 9.6K | |
![[IMG]](/icons/image2.gif) | 1570725523oblique img anatomy B.jpg | 2019-10-10 16:38 | 14K | |
![[IMG]](/icons/image2.gif) | 1570725523oblique img anatomy A.jpg | 2019-10-10 16:38 | 19K | |
![[IMG]](/icons/image2.gif) | 1570725523tarsal_1.png | 2019-10-10 16:38 | 212K | |
![[IMG]](/icons/image2.gif) | 1570725523tarsal.png | 2019-10-10 16:38 | 212K | |
![[IMG]](/icons/image2.gif) | 1570725523foot movement_1.jpg | 2019-10-10 16:38 | 22K | |
![[IMG]](/icons/image2.gif) | 1570725523foot movement.jpg | 2019-10-10 16:38 | 22K | |
![[IMG]](/icons/image2.gif) | 15707255232 tibs.jpg | 2019-10-10 16:38 | 13K | |
![[IMG]](/icons/image2.gif) | 1570725523mortise critique with dorsiflexion.jpg | 2019-10-10 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | 1570725523dorsiflexed lateral ankle critique.jpg | 2019-10-10 16:38 | 17K | |
![[IMG]](/icons/image2.gif) | 1570725523dorsiflexed lateral ankle critique_1.jpg | 2019-10-10 16:38 | 17K | |
![[IMG]](/icons/image2.gif) | 1570725523lateral ankle critique_2.jpg | 2019-10-10 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | 1570725523lateral ankle critique_1.jpg | 2019-10-10 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | 1570725523lateral ankle critique.jpg | 2019-10-10 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | 1570725523prox tib_1.jpg | 2019-10-10 16:38 | 9.3K | |
![[IMG]](/icons/image2.gif) | 1570725523prox tib.jpg | 2019-10-10 16:38 | 9.3K | |
![[IMG]](/icons/image2.gif) | 1570725523ap mrotise critique.jpg | 2019-10-10 16:38 | 10K | |
![[IMG]](/icons/image2.gif) | 1570725523ap mrotise critique_1.jpg | 2019-10-10 16:38 | 10K | |
![[IMG]](/icons/image2.gif) | 1570725523ap mrotise critique_2.jpg | 2019-10-10 16:38 | 10K | |
![[IMG]](/icons/image2.gif) | 1570725523tibial tuberosity.jpg | 2019-10-10 16:38 | 11K | |
![[IMG]](/icons/image2.gif) | 1570725523tibfib ap labeling.jpg | 2019-10-10 16:38 | 15K | |
![[IMG]](/icons/image2.gif) | 1570725523lateral ankle labeling.jpg | 2019-10-10 16:38 | 39K | |
![[IMG]](/icons/image2.gif) | 1570725523tibial plateaus.jpg | 2019-10-10 16:38 | 10K | |
![[IMG]](/icons/image2.gif) | 1570725523mortise ankle labeling.jpg | 2019-10-10 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | 1570725523mortise ankle labeling_1.jpg | 2019-10-10 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | 1570725523mortise ankle labeling_2.jpg | 2019-10-10 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | 1570725523Picture5_11.png | 2019-10-10 16:38 | 74K | |
![[IMG]](/icons/image2.gif) | 1570725523Picture3_17.png | 2019-10-10 16:38 | 64K | |
![[IMG]](/icons/image2.gif) | 1570725523decub baby.png | 2019-10-10 16:38 | 86K | |
![[IMG]](/icons/image2.gif) | 1570725523ABD2_1.png | 2019-10-10 16:38 | 111K | |
![[IMG]](/icons/image2.gif) | 1570725523Picture2_13.jpg | 2019-10-10 16:38 | 63K | |
![[IMG]](/icons/image2.gif) | 1570725522fgggggggggggggggggggggggg.png | 2019-10-10 16:38 | 60K | |
![[IMG]](/icons/image2.gif) | 1570725522tttttt.jpg | 2019-10-10 16:38 | 14K | |
![[IMG]](/icons/image2.gif) | 1570725522Picture3_1.jpg | 2019-10-10 16:38 | 2.1K | |
![[IMG]](/icons/image2.gif) | 1570725522Picture2_9.jpg | 2019-10-10 16:38 | 3.6K | |
![[IMG]](/icons/image2.gif) | 1570725522Picture1_4.jpg | 2019-10-10 16:38 | 3.8K | |
![[IMG]](/icons/image2.gif) | 1570725522Picture12.jpg | 2019-10-10 16:38 | 24K | |
![[IMG]](/icons/image2.gif) | 1570725522stupid picture.png | 2019-10-10 16:38 | 158K | |
![[IMG]](/icons/image2.gif) | 1570725522Picture7_4.png | 2019-10-10 16:38 | 183K | |
![[IMG]](/icons/image2.gif) | 1570725522Picture7.jpg | 2019-10-10 16:38 | 19K | |
![[IMG]](/icons/image2.gif) | 1570725522Picture6.jpg | 2019-10-10 16:38 | 18K | |
![[IMG]](/icons/image2.gif) | 1570725522Picture1_6.jpg | 2019-10-10 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | 1570725522Picture4.jpg | 2019-10-10 16:38 | 17K | |
![[IMG]](/icons/image2.gif) | 1570725522ABD2.png | 2019-10-10 16:38 | 111K | |
![[IMG]](/icons/image2.gif) | 1570725522abd1.png | 2019-10-10 16:38 | 161K | |
![[IMG]](/icons/image2.gif) | decub with cut off splenic_1.png | 2019-10-03 19:47 | 145K | |
![[IMG]](/icons/image2.gif) | decub with cut off splenic.png | 2019-10-03 19:47 | 145K | |
![[IMG]](/icons/image2.gif) | hook canal.png | 2019-10-02 18:22 | 171K | |
![[IMG]](/icons/image2.gif) | pisiform canal.png | 2019-10-02 18:21 | 171K | |
![[IMG]](/icons/image2.gif) | Lat elbow (pilot)_1.jpg | 2019-10-02 13:57 | 14K | |
![[IMG]](/icons/image2.gif) | Picture1_28.png | 2019-10-02 13:37 | 185K | |
![[IMG]](/icons/image2.gif) | Picture1_27.png | 2019-10-02 13:35 | 185K | |
![[IMG]](/icons/image2.gif) | Finger- Lateral 2nd.png | 2019-09-19 15:08 | 16K | |
![[IMG]](/icons/image2.gif) | Hand - Fan Lateral - over.jpg | 2019-09-19 15:06 | 14K | |
![[IMG]](/icons/image2.gif) | PA hand with FB.png | 2019-09-19 15:04 | 56K | |
![[IMG]](/icons/image2.gif) | Pathology -Bennett_s Fracture.png | 2019-09-19 14:22 | 175K | |
![[IMG]](/icons/image2.gif) | lateral hand with thumb and finger touching.png | 2019-09-19 13:22 | 124K | |
![[IMG]](/icons/image2.gif) | AP Thumb.png | 2019-09-19 13:18 | 199K | |
![[IMG]](/icons/image2.gif) | PA 5th finger- collimation.png | 2019-09-19 13:08 | 78K | |
![[IMG]](/icons/image2.gif) | oblique hand cupped digits.png | 2019-09-19 13:03 | 69K | |
![[IMG]](/icons/image2.gif) | Picture3_19.png | 2019-09-16 17:59 | 96K | |
![[IMG]](/icons/image2.gif) | Pilot Scenario 2.png | 2019-09-16 17:24 | 24K | |
![[IMG]](/icons/image2.gif) | Pilot critique 2.png | 2019-09-16 16:48 | 202K | |
![[IMG]](/icons/image2.gif) | Pilot critique 1.png | 2019-09-16 16:40 | 26K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738AP forearm_1.jpg | 2019-09-16 16:07 | 20K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738img 10 lat elbow.jpg | 2019-09-16 16:07 | 21K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738img 9 lat elbow.jpg | 2019-09-16 16:07 | 19K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738img 8 obl wrist.jpg | 2019-09-16 16:07 | 10K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738img 7 navi.jpg | 2019-09-16 16:07 | 13K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738image 6 navi.jpg | 2019-09-16 16:07 | 13K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738AP forearm (pilot).jpg | 2019-09-16 16:07 | 12K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738lateral forearm.jpg | 2019-09-16 16:07 | 20K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738Lateral oblique elbow.jpg | 2019-09-16 16:07 | 15K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738med obl.png | 2019-09-16 16:07 | 68K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738diagram 7 lat elbow.jpg | 2019-09-16 16:07 | 22K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738diagram 7 lat elbow_1.jpg | 2019-09-16 16:07 | 22K | |
![[IMG]](/icons/image2.gif) | 156865004315686457381506344229Diagram 5_1.jpg | 2019-09-16 16:07 | 16K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738diagram 4 wrist.jpg | 2019-09-16 16:07 | 19K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738replacement lat wrist.png | 2019-09-16 16:07 | 24K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738diagram 3.png | 2019-09-16 16:07 | 97K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738diagram 3_1.png | 2019-09-16 16:07 | 97K | |
![[IMG]](/icons/image2.gif) | 15686500431568645738diagram 3_2.png | 2019-09-16 16:07 | 97K | |
![[IMG]](/icons/image2.gif) | 15686500431568644890Lat elbow (pilot).jpg | 2019-09-16 16:07 | 14K | |
![[IMG]](/icons/image2.gif) | 15686500431567021051boxer.png | 2019-09-16 16:07 | 57K | |
![[IMG]](/icons/image2.gif) | 15686500431567021051child.png | 2019-09-16 16:07 | 62K | |
![[IMG]](/icons/image2.gif) | 15686500431567021051hand rot.png | 2019-09-16 16:07 | 78K | |
![[IMG]](/icons/image2.gif) | 15686500431567021051Picture7_2.png | 2019-09-16 16:07 | 232K | |
![[IMG]](/icons/image2.gif) | 15686500431567021051Picture6_2.jpg | 2019-09-16 16:07 | 15K | |
![[IMG]](/icons/image2.gif) | 156865004315670210511506344230hand_20w_20nail.jpg | 2019-09-16 16:07 | 35K | |
![[IMG]](/icons/image2.gif) | 15686500431567021051Picture3_13.png | 2019-09-16 16:07 | 45K | |
![[IMG]](/icons/image2.gif) | 156865004315670210511506344230hand lat rotation.jpg | 2019-09-16 16:07 | 27K | |
![[IMG]](/icons/image2.gif) | 156865004315670210511506344230Finger pa collimation.jpg | 2019-09-16 16:07 | 27K | |
![[IMG]](/icons/image2.gif) | 156865004315670210511506344230hand obl.jpg | 2019-09-16 16:07 | 28K | |
![[IMG]](/icons/image2.gif) | 15686500431567021051ulna.png | 2019-09-16 16:07 | 30K | |
![[IMG]](/icons/image2.gif) | 156865004315670210511506344230Hand lat 2.jpg | 2019-09-16 16:07 | 44K | |
![[IMG]](/icons/image2.gif) | 156865004215670210511506344230thumb ap.jpg | 2019-09-16 16:07 | 40K | |
![[IMG]](/icons/image2.gif) | 15686500421567021051Picture2.png | 2019-09-16 16:07 | 179K | |
![[IMG]](/icons/image2.gif) | 15686500421567021051finger.png | 2019-09-16 16:07 | 40K | |
![[IMG]](/icons/image2.gif) | 156865004215670210511506344230Hand anatomy_2.jpg | 2019-09-16 16:07 | 29K | |
![[IMG]](/icons/image2.gif) | 156865004215670210511506344230thumb obl.jpg | 2019-09-16 16:07 | 11K | |
![[IMG]](/icons/image2.gif) | 156865004215670210511506344230Hand anatomy_3.jpg | 2019-09-16 16:07 | 29K | |
![[IMG]](/icons/image2.gif) | 156865004215670210511506344230Hand anatomy_4.jpg | 2019-09-16 16:07 | 29K | |
![[IMG]](/icons/image2.gif) | 156865004215670210511506344230finger lat_1.jpg | 2019-09-16 16:07 | 7.8K | |
![[IMG]](/icons/image2.gif) | 156865004215670210511506344230Hand anatomy_1.jpg | 2019-09-16 16:07 | 29K | |
![[IMG]](/icons/image2.gif) | 156865004215670210511506344230Hand anatomy.jpg | 2019-09-16 16:07 | 29K | |
![[IMG]](/icons/image2.gif) | 156865004215670212592 tibs.jpg | 2019-09-16 16:07 | 13K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259mortise critique with dorsiflexion.jpg | 2019-09-16 16:07 | 16K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259dorsiflexed lateral ankle critique.jpg | 2019-09-16 16:07 | 17K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259dorsiflexed lateral ankle critique_1.jpg | 2019-09-16 16:07 | 17K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259lateral ankle critique_2.jpg | 2019-09-16 16:07 | 16K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259lateral ankle critique_1.jpg | 2019-09-16 16:07 | 16K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259lateral ankle critique.jpg | 2019-09-16 16:07 | 16K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259prox tib_1.jpg | 2019-09-16 16:07 | 9.3K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259prox tib.jpg | 2019-09-16 16:07 | 9.3K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259ap mrotise critique.jpg | 2019-09-16 16:07 | 10K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259ap mrotise critique_1.jpg | 2019-09-16 16:07 | 10K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259ap mrotise critique_2.jpg | 2019-09-16 16:07 | 10K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259tibial tuberosity.jpg | 2019-09-16 16:07 | 11K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259tibfib ap labeling.jpg | 2019-09-16 16:07 | 15K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259lateral ankle labeling.jpg | 2019-09-16 16:07 | 39K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259tibial plateaus.jpg | 2019-09-16 16:07 | 10K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259mortise ankle labeling.jpg | 2019-09-16 16:07 | 16K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259mortise ankle labeling_1.jpg | 2019-09-16 16:07 | 16K | |
![[IMG]](/icons/image2.gif) | 15686500421567021259mortise ankle labeling_2.jpg | 2019-09-16 16:07 | 16K | |
![[IMG]](/icons/image2.gif) | 1568645739boxer.png | 2019-09-16 14:55 | 57K | |
![[IMG]](/icons/image2.gif) | 1568645739child.png | 2019-09-16 14:55 | 62K | |
![[IMG]](/icons/image2.gif) | 1568645739hand rot.png | 2019-09-16 14:55 | 78K | |
![[IMG]](/icons/image2.gif) | 1568645739Picture7_2.png | 2019-09-16 14:55 | 232K | |
![[IMG]](/icons/image2.gif) | 1568645739Picture6_2.jpg | 2019-09-16 14:55 | 15K | |
![[IMG]](/icons/image2.gif) | 15686457391506344230hand_20w_20nail.jpg | 2019-09-16 14:55 | 35K | |
![[IMG]](/icons/image2.gif) | 1568645739Picture3_13.png | 2019-09-16 14:55 | 45K | |
![[IMG]](/icons/image2.gif) | 15686457391506344230hand lat rotation.jpg | 2019-09-16 14:55 | 27K | |
![[IMG]](/icons/image2.gif) | 15686457391506344230Finger pa collimation.jpg | 2019-09-16 14:55 | 27K | |
![[IMG]](/icons/image2.gif) | 15686457391506344230hand obl.jpg | 2019-09-16 14:55 | 28K | |
![[IMG]](/icons/image2.gif) | 1568645739ulna.png | 2019-09-16 14:55 | 30K | |
![[IMG]](/icons/image2.gif) | 15686457391506344230Hand lat 2.jpg | 2019-09-16 14:55 | 44K | |
![[IMG]](/icons/image2.gif) | 15686457381506344230thumb ap.jpg | 2019-09-16 14:55 | 40K | |
![[IMG]](/icons/image2.gif) | 1568645738Picture2.png | 2019-09-16 14:55 | 179K | |
![[IMG]](/icons/image2.gif) | 1568645738finger.png | 2019-09-16 14:55 | 40K | |
![[IMG]](/icons/image2.gif) | 15686457381506344230Hand anatomy_2.jpg | 2019-09-16 14:55 | 29K | |
![[IMG]](/icons/image2.gif) | 15686457381506344230thumb obl.jpg | 2019-09-16 14:55 | 11K | |
![[IMG]](/icons/image2.gif) | 15686457381506344230Hand anatomy_3.jpg | 2019-09-16 14:55 | 29K | |
![[IMG]](/icons/image2.gif) | 15686457381506344230Hand anatomy_4.jpg | 2019-09-16 14:55 | 29K | |
![[IMG]](/icons/image2.gif) | 15686457381506344230finger lat_1.jpg | 2019-09-16 14:55 | 7.8K | |
![[IMG]](/icons/image2.gif) | 15686457381506344230Hand anatomy_1.jpg | 2019-09-16 14:55 | 29K | |
![[IMG]](/icons/image2.gif) | 15686457381506344230Hand anatomy.jpg | 2019-09-16 14:55 | 29K | |
![[IMG]](/icons/image2.gif) | 1568645738AP forearm_1.jpg | 2019-09-16 14:55 | 20K | |
![[IMG]](/icons/image2.gif) | 1568645738img 10 lat elbow.jpg | 2019-09-16 14:55 | 21K | |
![[IMG]](/icons/image2.gif) | 1568645738img 9 lat elbow.jpg | 2019-09-16 14:55 | 19K | |
![[IMG]](/icons/image2.gif) | 1568645738img 8 obl wrist.jpg | 2019-09-16 14:55 | 10K | |
![[IMG]](/icons/image2.gif) | 1568645738img 7 navi.jpg | 2019-09-16 14:55 | 13K | |
![[IMG]](/icons/image2.gif) | 1568645738image 6 navi.jpg | 2019-09-16 14:55 | 13K | |
![[IMG]](/icons/image2.gif) | 1568645738AP forearm (pilot).jpg | 2019-09-16 14:55 | 12K | |
![[IMG]](/icons/image2.gif) | 1568645738lateral forearm.jpg | 2019-09-16 14:55 | 20K | |
![[IMG]](/icons/image2.gif) | 1568645738Lateral oblique elbow.jpg | 2019-09-16 14:55 | 15K | |
![[IMG]](/icons/image2.gif) | 1568645738med obl.png | 2019-09-16 14:55 | 68K | |
![[IMG]](/icons/image2.gif) | 1568645738diagram 7 lat elbow.jpg | 2019-09-16 14:55 | 22K | |
![[IMG]](/icons/image2.gif) | 1568645738diagram 7 lat elbow_1.jpg | 2019-09-16 14:55 | 22K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229Diagram 5_1.jpg | 2019-09-16 14:55 | 16K | |
![[IMG]](/icons/image2.gif) | 1568645738diagram 4 wrist.jpg | 2019-09-16 14:55 | 19K | |
![[IMG]](/icons/image2.gif) | 1568645738replacement lat wrist.png | 2019-09-16 14:55 | 24K | |
![[IMG]](/icons/image2.gif) | 1568645738diagram 3.png | 2019-09-16 14:55 | 97K | |
![[IMG]](/icons/image2.gif) | 1568645738diagram 3_1.png | 2019-09-16 14:55 | 97K | |
![[IMG]](/icons/image2.gif) | 1568645738diagram 3_2.png | 2019-09-16 14:55 | 97K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229lat pigg.jpg | 2019-09-16 14:55 | 19K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229PA pigg.jpg | 2019-09-16 14:55 | 33K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229CXR Collimation.jpg | 2019-09-16 14:55 | 65K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229sufficient lat.jpg | 2019-09-16 14:55 | 17K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229Good CXR.jpg | 2019-09-16 14:55 | 27K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229bad PA CXR 2_1.jpg | 2019-09-16 14:55 | 18K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229bad lat CXR 2.jpg | 2019-09-16 14:55 | 30K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229Bad PA CXR smaller.jpg | 2019-09-16 14:55 | 67K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229Bad lat CXR.jpg | 2019-09-16 14:55 | 25K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229PA CXR smaller.jpg | 2019-09-16 14:55 | 77K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229L Lat CXR.jpg | 2019-09-16 14:55 | 20K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229Lingula.jpg | 2019-09-16 14:55 | 17K | |
![[IMG]](/icons/image2.gif) | 15686457381506344229Lungs.jpg | 2019-09-16 14:55 | 23K | |
![[IMG]](/icons/image2.gif) | 15686457381506344228Decub 02.jpg | 2019-09-16 14:55 | 59K | |
![[IMG]](/icons/image2.gif) | 15686457381506344228Decub 01.jpg | 2019-09-16 14:55 | 61K | |
![[IMG]](/icons/image2.gif) | 15686457381506344228AP erect 2.jpg | 2019-09-16 14:55 | 75K | |
![[IMG]](/icons/image2.gif) | 15686457381506344228Lat CXR.jpg | 2019-09-16 14:55 | 49K | |
![[IMG]](/icons/image2.gif) | 15686457371506344228AP erect rotation.jpg | 2019-09-16 14:55 | 46K | |
![[IMG]](/icons/image2.gif) | 15686457371506344228Image 03.jpg | 2019-09-16 14:55 | 37K | |
![[IMG]](/icons/image2.gif) | 15686457371506344228Image 02.jpg | 2019-09-16 14:55 | 20K | |
![[IMG]](/icons/image2.gif) | 15686457371506344228Image 01.jpg | 2019-09-16 14:55 | 21K | |
![[IMG]](/icons/image2.gif) | 1568644890hand lat rotation.jpg | 2019-09-16 14:41 | 27K | |
![[IMG]](/icons/image2.gif) | 1568644890Finger pa collimation.jpg | 2019-09-16 14:41 | 27K | |
![[IMG]](/icons/image2.gif) | 1568644890Finger PA marker.jpg | 2019-09-16 14:41 | 18K | |
![[IMG]](/icons/image2.gif) | 1568644890hand obl.jpg | 2019-09-16 14:41 | 28K | |
![[IMG]](/icons/image2.gif) | 1568644890hand w nail.jpg | 2019-09-16 14:41 | 35K | |
![[IMG]](/icons/image2.gif) | 1568644890finger lat bad.jpg | 2019-09-16 14:41 | 26K | |
![[IMG]](/icons/image2.gif) | 1568644890Picture3_8.jpg | 2019-09-16 14:41 | 44K | |
![[IMG]](/icons/image2.gif) | 1568644890Hand lat 2.jpg | 2019-09-16 14:41 | 44K | |
![[IMG]](/icons/image2.gif) | 1568644890thumb ap.jpg | 2019-09-16 14:41 | 40K | |
![[IMG]](/icons/image2.gif) | 1568644890Finer lateral.jpg | 2019-09-16 14:41 | 27K | |
![[IMG]](/icons/image2.gif) | 1568644890Hand anatomy_2.jpg | 2019-09-16 14:41 | 29K | |
![[IMG]](/icons/image2.gif) | 1568644890thumb obl.jpg | 2019-09-16 14:41 | 11K | |
![[IMG]](/icons/image2.gif) | 1568644890thumb ap_1.jpg | 2019-09-16 14:41 | 40K | |
![[IMG]](/icons/image2.gif) | 1568644890Hand anatomy_3.jpg | 2019-09-16 14:41 | 29K | |
![[IMG]](/icons/image2.gif) | 1568644890Hand anatomy_4.jpg | 2019-09-16 14:41 | 29K | |
![[IMG]](/icons/image2.gif) | 1568644890finger lat_1.jpg | 2019-09-16 14:41 | 7.8K | |
![[IMG]](/icons/image2.gif) | 1568644890Hand anatomy_1.jpg | 2019-09-16 14:41 | 29K | |
![[IMG]](/icons/image2.gif) | 1568644890Hand anatomy.jpg | 2019-09-16 14:41 | 29K | |
![[IMG]](/icons/image2.gif) | 1568644890Lat elbow (pilot).jpg | 2019-09-16 14:41 | 14K | |
![[IMG]](/icons/image2.gif) | 1568644890Ap forearm cutoff.jpg | 2019-09-16 14:41 | 22K | |
![[IMG]](/icons/image2.gif) | 1568644890image 10.jpg | 2019-09-16 14:41 | 23K | |
![[IMG]](/icons/image2.gif) | 1568644890Image 9.jpg | 2019-09-16 14:41 | 21K | |
![[IMG]](/icons/image2.gif) | 1568644890image 08.jpg | 2019-09-16 14:41 | 27K | |
![[IMG]](/icons/image2.gif) | 1568644890image 7.jpg | 2019-09-16 14:41 | 25K | |
![[IMG]](/icons/image2.gif) | 1568644890Navicular good.jpg | 2019-09-16 14:41 | 31K | |
![[IMG]](/icons/image2.gif) | 1568644890AP forearm.jpg | 2019-09-16 14:41 | 18K | |
![[IMG]](/icons/image2.gif) | 1568644890Image 04.jpg | 2019-09-16 14:41 | 14K | |
![[IMG]](/icons/image2.gif) | 1568644889Lat obl elbow.jpg | 2019-09-16 14:41 | 34K | |
![[IMG]](/icons/image2.gif) | 1568644889Med Obl elbow.jpg | 2019-09-16 14:41 | 12K | |
![[IMG]](/icons/image2.gif) | 1568644889Lat elbow_1.jpg | 2019-09-16 14:41 | 27K | |
![[IMG]](/icons/image2.gif) | 1568644889Lat elbow.jpg | 2019-09-16 14:41 | 27K | |
![[IMG]](/icons/image2.gif) | 1568644889Diagram 5_1.jpg | 2019-09-16 14:41 | 16K | |
![[IMG]](/icons/image2.gif) | 1568644889Test image 2.jpg | 2019-09-16 14:41 | 40K | |
![[IMG]](/icons/image2.gif) | 1568644889lat wrist.jpg | 2019-09-16 14:41 | 12K | |
![[IMG]](/icons/image2.gif) | 1568644889Diagram 1_2.jpg | 2019-09-16 14:41 | 30K | |
![[IMG]](/icons/image2.gif) | 1568644889Diagram 1_1.jpg | 2019-09-16 14:41 | 30K | |
![[IMG]](/icons/image2.gif) | 1568644889Diagram 1.jpg | 2019-09-16 14:41 | 30K | |
![[IMG]](/icons/image2.gif) | 1568644889Pneumonia.jpg | 2019-09-16 14:41 | 49K | |
![[IMG]](/icons/image2.gif) | 1568644889Pneumothorax.jpg | 2019-09-16 14:41 | 25K | |
![[IMG]](/icons/image2.gif) | 1568644889Pilot 2.jpg | 2019-09-16 14:41 | 17K | |
![[IMG]](/icons/image2.gif) | 1568644889Critique 1_1.jpg | 2019-09-16 14:41 | 26K | |
![[IMG]](/icons/image2.gif) | 1568644889lat pigg.jpg | 2019-09-16 14:41 | 19K | |
![[IMG]](/icons/image2.gif) | 1568644889PA pigg.jpg | 2019-09-16 14:41 | 33K | |
![[IMG]](/icons/image2.gif) | 1568644889CXR Collimation.jpg | 2019-09-16 14:41 | 65K | |
![[IMG]](/icons/image2.gif) | 1568644889sufficient lat.jpg | 2019-09-16 14:41 | 17K | |
![[IMG]](/icons/image2.gif) | 1568644889Good CXR.jpg | 2019-09-16 14:41 | 27K | |
![[IMG]](/icons/image2.gif) | 1568644889bad PA CXR 2_1.jpg | 2019-09-16 14:41 | 18K | |
![[IMG]](/icons/image2.gif) | 1568644889bad lat CXR 2.jpg | 2019-09-16 14:41 | 30K | |
![[IMG]](/icons/image2.gif) | 1568644889AP Erect w wires.jpg | 2019-09-16 14:41 | 35K | |
![[IMG]](/icons/image2.gif) | 1568644889Bad lat CXR.jpg | 2019-09-16 14:41 | 25K | |
![[IMG]](/icons/image2.gif) | 1568644889PA CXR smaller.jpg | 2019-09-16 14:41 | 77K | |
![[IMG]](/icons/image2.gif) | 1568644889Good lat.jpg | 2019-09-16 14:41 | 41K | |
![[IMG]](/icons/image2.gif) | 1568644889Lingula.jpg | 2019-09-16 14:41 | 17K | |
![[IMG]](/icons/image2.gif) | 1568644889Lungs.jpg | 2019-09-16 14:41 | 23K | |
![[IMG]](/icons/image2.gif) | 1568644889good lat decub.png | 2019-09-16 14:41 | 88K | |
![[IMG]](/icons/image2.gif) | 1568644889decub chest.png | 2019-09-16 14:41 | 104K | |
![[IMG]](/icons/image2.gif) | 1568644888AP chest wires.png | 2019-09-16 14:41 | 397K | |
![[IMG]](/icons/image2.gif) | 1568644888Lat arms not erect.png | 2019-09-16 14:41 | 116K | |
![[IMG]](/icons/image2.gif) | 1568644888AP erect chin rotation.png | 2019-09-16 14:41 | 224K | |
![[IMG]](/icons/image2.gif) | 1568644888picture 03.jpg | 2019-09-16 14:41 | 16K | |
![[IMG]](/icons/image2.gif) | 1568644888Lateral with chair in pic.png | 2019-09-16 14:41 | 74K | |
![[IMG]](/icons/image2.gif) | 1568644888Pilot AP Erect.png | 2019-09-16 14:41 | 107K | |
![[IMG]](/icons/image2.gif) | Good lat.jpg | 2019-09-09 13:38 | 41K | |
![[IMG]](/icons/image2.gif) | Pilot Image Eval 2 RPO.png | 2019-09-09 12:50 | 70K | |
![[IMG]](/icons/image2.gif) | Pilot - Scout test image_1.png | 2019-09-09 12:42 | 33K | |
![[IMG]](/icons/image2.gif) | Pneumonia.jpg | 2019-09-04 17:38 | 49K | |
![[IMG]](/icons/image2.gif) | Pneumothorax.jpg | 2019-09-04 17:31 | 25K | |
![[IMG]](/icons/image2.gif) | AP Erect w wires.jpg | 2019-09-04 17:21 | 35K | |
![[IMG]](/icons/image2.gif) | Critique 1_1.jpg | 2019-09-04 14:00 | 26K | |
![[IMG]](/icons/image2.gif) | Pilot 2_1.jpg | 2019-09-04 13:39 | 17K | |
![[IMG]](/icons/image2.gif) | Critique 1.jpg | 2019-09-04 13:37 | 26K | |
![[IMG]](/icons/image2.gif) | 1567021260Picture1_11.png | 2019-08-28 19:41 | 608K | |
![[IMG]](/icons/image2.gif) | 1567021260heel.png | 2019-08-28 19:41 | 36K | |
![[IMG]](/icons/image2.gif) | 1567021260toes obl.png | 2019-08-28 19:41 | 193K | |
![[IMG]](/icons/image2.gif) | 1567021260ap foot.png | 2019-08-28 19:41 | 76K | |
![[IMG]](/icons/image2.gif) | 1567021260toe.png | 2019-08-28 19:41 | 28K | |
![[IMG]](/icons/image2.gif) | 1567021260lat.png | 2019-08-28 19:41 | 259K | |
![[IMG]](/icons/image2.gif) | 1567021260Picture1_7.png | 2019-08-28 19:41 | 259K | |
![[IMG]](/icons/image2.gif) | 1567021260foot d.png | 2019-08-28 19:41 | 243K | |
![[IMG]](/icons/image2.gif) | 1567021260Picture1_5.png | 2019-08-28 19:41 | 107K | |
![[IMG]](/icons/image2.gif) | 1567021260Picture6_1.jpg | 2019-08-28 19:41 | 17K | |
![[IMG]](/icons/image2.gif) | 1567021260Picture5_1.jpg | 2019-08-28 19:41 | 20K | |
![[IMG]](/icons/image2.gif) | 1567021260Picture5.jpg | 2019-08-28 19:41 | 20K | |
![[IMG]](/icons/image2.gif) | 1567021260Picture2_7.jpg | 2019-08-28 19:41 | 21K | |
![[IMG]](/icons/image2.gif) | 1567021260Picture2_6.jpg | 2019-08-28 19:41 | 21K | |
![[IMG]](/icons/image2.gif) | 1567021260Picture1_2.jpg | 2019-08-28 19:41 | 14K | |
![[IMG]](/icons/image2.gif) | 1567021260Picture1_1.jpg | 2019-08-28 19:41 | 14K | |
![[IMG]](/icons/image2.gif) | 1567021259lat foot img_2.jpg | 2019-08-28 19:40 | 19K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture2_6.png | 2019-08-28 19:40 | 98K | |
![[IMG]](/icons/image2.gif) | 1567021259lat foot img.jpg | 2019-08-28 19:40 | 19K | |
![[IMG]](/icons/image2.gif) | 1567021259heel img anatomy_1.jpg | 2019-08-28 19:40 | 9.6K | |
![[IMG]](/icons/image2.gif) | 1567021259heel img anatomy.jpg | 2019-08-28 19:40 | 9.6K | |
![[IMG]](/icons/image2.gif) | 1567021259oblique img anatomy B.jpg | 2019-08-28 19:40 | 14K | |
![[IMG]](/icons/image2.gif) | 1567021259oblique img anatomy A.jpg | 2019-08-28 19:40 | 19K | |
![[IMG]](/icons/image2.gif) | 1567021259tarsal_1.png | 2019-08-28 19:40 | 212K | |
![[IMG]](/icons/image2.gif) | 1567021259tarsal.png | 2019-08-28 19:40 | 212K | |
![[IMG]](/icons/image2.gif) | 1567021259foot movement_1.jpg | 2019-08-28 19:40 | 22K | |
![[IMG]](/icons/image2.gif) | 1567021259foot movement.jpg | 2019-08-28 19:40 | 22K | |
![[IMG]](/icons/image2.gif) | 15670212592 tibs.jpg | 2019-08-28 19:40 | 13K | |
![[IMG]](/icons/image2.gif) | 1567021259mortise critique with dorsiflexion.jpg | 2019-08-28 19:40 | 16K | |
![[IMG]](/icons/image2.gif) | 1567021259dorsiflexed lateral ankle critique.jpg | 2019-08-28 19:40 | 17K | |
![[IMG]](/icons/image2.gif) | 1567021259dorsiflexed lateral ankle critique_1.jpg | 2019-08-28 19:40 | 17K | |
![[IMG]](/icons/image2.gif) | 1567021259lateral ankle critique_2.jpg | 2019-08-28 19:40 | 16K | |
![[IMG]](/icons/image2.gif) | 1567021259lateral ankle critique_1.jpg | 2019-08-28 19:40 | 16K | |
![[IMG]](/icons/image2.gif) | 1567021259lateral ankle critique.jpg | 2019-08-28 19:40 | 16K | |
![[IMG]](/icons/image2.gif) | 1567021259prox tib_1.jpg | 2019-08-28 19:40 | 9.3K | |
![[IMG]](/icons/image2.gif) | 1567021259prox tib.jpg | 2019-08-28 19:40 | 9.3K | |
![[IMG]](/icons/image2.gif) | 1567021259ap mrotise critique.jpg | 2019-08-28 19:40 | 10K | |
![[IMG]](/icons/image2.gif) | 1567021259ap mrotise critique_1.jpg | 2019-08-28 19:40 | 10K | |
![[IMG]](/icons/image2.gif) | 1567021259ap mrotise critique_2.jpg | 2019-08-28 19:40 | 10K | |
![[IMG]](/icons/image2.gif) | 1567021259tibial tuberosity.jpg | 2019-08-28 19:40 | 11K | |
![[IMG]](/icons/image2.gif) | 1567021259tibfib ap labeling.jpg | 2019-08-28 19:40 | 15K | |
![[IMG]](/icons/image2.gif) | 1567021259lateral ankle labeling.jpg | 2019-08-28 19:40 | 39K | |
![[IMG]](/icons/image2.gif) | 1567021259tibial plateaus.jpg | 2019-08-28 19:40 | 10K | |
![[IMG]](/icons/image2.gif) | 1567021259mortise ankle labeling.jpg | 2019-08-28 19:40 | 16K | |
![[IMG]](/icons/image2.gif) | 1567021259mortise ankle labeling_1.jpg | 2019-08-28 19:40 | 16K | |
![[IMG]](/icons/image2.gif) | 1567021259mortise ankle labeling_2.jpg | 2019-08-28 19:40 | 16K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture5_11.png | 2019-08-28 19:40 | 74K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture3_17.png | 2019-08-28 19:40 | 64K | |
![[IMG]](/icons/image2.gif) | 1567021259decub baby.png | 2019-08-28 19:40 | 86K | |
![[IMG]](/icons/image2.gif) | 1567021259ABD2_1.png | 2019-08-28 19:40 | 111K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture2_13.jpg | 2019-08-28 19:40 | 63K | |
![[IMG]](/icons/image2.gif) | 1567021259fgggggggggggggggggggggggg.png | 2019-08-28 19:40 | 60K | |
![[IMG]](/icons/image2.gif) | 1567021259tttttt.jpg | 2019-08-28 19:40 | 14K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture3_1.jpg | 2019-08-28 19:40 | 2.1K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture2_9.jpg | 2019-08-28 19:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture1_4.jpg | 2019-08-28 19:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture12.jpg | 2019-08-28 19:40 | 24K | |
![[IMG]](/icons/image2.gif) | 1567021259stupid picture.png | 2019-08-28 19:40 | 158K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture7_4.png | 2019-08-28 19:40 | 183K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture7.jpg | 2019-08-28 19:40 | 19K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture6.jpg | 2019-08-28 19:40 | 18K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture1_6.jpg | 2019-08-28 19:40 | 16K | |
![[IMG]](/icons/image2.gif) | 1567021259Picture4.jpg | 2019-08-28 19:40 | 17K | |
![[IMG]](/icons/image2.gif) | 1567021259ABD2.png | 2019-08-28 19:40 | 111K | |
![[IMG]](/icons/image2.gif) | 1567021258abd1.png | 2019-08-28 19:40 | 161K | |
![[IMG]](/icons/image2.gif) | 1567021051boxer.png | 2019-08-28 19:37 | 57K | |
![[IMG]](/icons/image2.gif) | 1567021051child.png | 2019-08-28 19:37 | 62K | |
![[IMG]](/icons/image2.gif) | 1567021051hand rot.png | 2019-08-28 19:37 | 78K | |
![[IMG]](/icons/image2.gif) | 1567021051Picture7_2.png | 2019-08-28 19:37 | 232K | |
![[IMG]](/icons/image2.gif) | 1567021051Picture6_2.jpg | 2019-08-28 19:37 | 15K | |
![[IMG]](/icons/image2.gif) | 15670210511506344230hand lat rotation.jpg | 2019-08-28 19:37 | 27K | |
![[IMG]](/icons/image2.gif) | 1567021051Picture2.png | 2019-08-28 19:37 | 179K | |
![[IMG]](/icons/image2.gif) | 1567021051finger.png | 2019-08-28 19:37 | 40K | |
![[IMG]](/icons/image2.gif) | 15670210511506344230Hand anatomy_2.jpg | 2019-08-28 19:37 | 29K | |
![[IMG]](/icons/image2.gif) | 15670210511506344230thumb obl.jpg | 2019-08-28 19:37 | 11K | |
![[IMG]](/icons/image2.gif) | 15670210511506344230Hand anatomy_3.jpg | 2019-08-28 19:37 | 29K | |
![[IMG]](/icons/image2.gif) | 15670210511506344230Hand anatomy_4.jpg | 2019-08-28 19:37 | 29K | |
![[IMG]](/icons/image2.gif) | 15670210511506344230finger lat_1.jpg | 2019-08-28 19:37 | 7.8K | |
![[IMG]](/icons/image2.gif) | 15670210511506344230Hand anatomy_1.jpg | 2019-08-28 19:37 | 29K | |
![[IMG]](/icons/image2.gif) | 15670210511506344230Hand anatomy.jpg | 2019-08-28 19:37 | 29K | |
![[IMG]](/icons/image2.gif) | 1567021051AP forearm_1.jpg | 2019-08-28 19:37 | 20K | |
![[IMG]](/icons/image2.gif) | 1567021051img 10 lat elbow.jpg | 2019-08-28 19:37 | 21K | |
![[IMG]](/icons/image2.gif) | 1567021051img 9 lat elbow.jpg | 2019-08-28 19:37 | 19K | |
![[IMG]](/icons/image2.gif) | 1567021051img 8 obl wrist.jpg | 2019-08-28 19:37 | 10K | |
![[IMG]](/icons/image2.gif) | 1567021051img 7 navi.jpg | 2019-08-28 19:37 | 13K | |
![[IMG]](/icons/image2.gif) | 1567021051image 6 navi.jpg | 2019-08-28 19:37 | 13K | |
![[IMG]](/icons/image2.gif) | 1567021051AP forearm (pilot).jpg | 2019-08-28 19:37 | 12K | |
![[IMG]](/icons/image2.gif) | 1567021051lateral forearm.jpg | 2019-08-28 19:37 | 20K | |
![[IMG]](/icons/image2.gif) | 1567021051Lateral oblique elbow.jpg | 2019-08-28 19:37 | 15K | |
![[IMG]](/icons/image2.gif) | 1567021051med obl.png | 2019-08-28 19:37 | 68K | |
![[IMG]](/icons/image2.gif) | 1567021051diagram 7 lat elbow.jpg | 2019-08-28 19:37 | 22K | |
![[IMG]](/icons/image2.gif) | 1567021051diagram 7 lat elbow_1.jpg | 2019-08-28 19:37 | 22K | |
![[IMG]](/icons/image2.gif) | 15670210511506344229Diagram 5_1.jpg | 2019-08-28 19:37 | 16K | |
![[IMG]](/icons/image2.gif) | 1567021050diagram 4 wrist.jpg | 2019-08-28 19:37 | 19K | |
![[IMG]](/icons/image2.gif) | 1567021050replacement lat wrist.png | 2019-08-28 19:37 | 24K | |
![[IMG]](/icons/image2.gif) | 1567021050diagram 3.png | 2019-08-28 19:37 | 97K | |
![[IMG]](/icons/image2.gif) | 1567021050diagram 3_1.png | 2019-08-28 19:37 | 97K | |
![[IMG]](/icons/image2.gif) | 1567021050diagram 3_2.png | 2019-08-28 19:37 | 97K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229lat pigg.jpg | 2019-08-28 19:37 | 19K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229PA pigg.jpg | 2019-08-28 19:37 | 33K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229CXR Collimation.jpg | 2019-08-28 19:37 | 65K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229sufficient lat.jpg | 2019-08-28 19:37 | 17K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229Good CXR.jpg | 2019-08-28 19:37 | 27K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229bad PA CXR 2_1.jpg | 2019-08-28 19:37 | 18K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229bad lat CXR 2.jpg | 2019-08-28 19:37 | 30K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229Bad PA CXR smaller.jpg | 2019-08-28 19:37 | 67K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229Bad lat CXR.jpg | 2019-08-28 19:37 | 25K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229PA CXR smaller.jpg | 2019-08-28 19:37 | 77K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229L Lat CXR.jpg | 2019-08-28 19:37 | 20K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229Lingula.jpg | 2019-08-28 19:37 | 17K | |
![[IMG]](/icons/image2.gif) | 15670210501506344229Lungs.jpg | 2019-08-28 19:37 | 23K | |
![[IMG]](/icons/image2.gif) | 15670210501506344228Decub 02.jpg | 2019-08-28 19:37 | 59K | |
![[IMG]](/icons/image2.gif) | 15670210501506344228Decub 01.jpg | 2019-08-28 19:37 | 61K | |
![[IMG]](/icons/image2.gif) | 15670210501506344228AP erect 2.jpg | 2019-08-28 19:37 | 75K | |
![[IMG]](/icons/image2.gif) | 15670210501506344228Lat CXR.jpg | 2019-08-28 19:37 | 49K | |
![[IMG]](/icons/image2.gif) | 15670210501506344228AP erect rotation.jpg | 2019-08-28 19:37 | 46K | |
![[IMG]](/icons/image2.gif) | 15670210501506344228Image 03.jpg | 2019-08-28 19:37 | 37K | |
![[IMG]](/icons/image2.gif) | 15670210501506344228Image 02.jpg | 2019-08-28 19:37 | 20K | |
![[IMG]](/icons/image2.gif) | 15670210501506344228Image 01.jpg | 2019-08-28 19:37 | 21K | |
![[IMG]](/icons/image2.gif) | Picture4_9.png | 2019-08-15 18:25 | 121K | |
![[IMG]](/icons/image2.gif) | Picture3_18.png | 2019-08-15 18:18 | 81K | |
![[IMG]](/icons/image2.gif) | Picture1_24.png | 2019-08-15 18:15 | 134K | |
![[IMG]](/icons/image2.gif) | Picture2_17_1.jpg | 2019-08-14 18:42 | 13K | |
![[IMG]](/icons/image2.gif) | Final Transverse Abdomen A through H_2.png | 2019-07-30 19:26 | 103K | |
![[IMG]](/icons/image2.gif) | Final Transverse Liver HV.png | 2019-07-30 19:26 | 96K | |
![[IMG]](/icons/image2.gif) | Final Liver Transverse LV CL LLL.png | 2019-07-30 19:25 | 506K | |
![[IMG]](/icons/image2.gif) | Final 18 19 20.png | 2019-07-30 19:24 | 48K | |
![[IMG]](/icons/image2.gif) | Final Long GB.png | 2019-07-30 19:23 | 41K | |
![[IMG]](/icons/image2.gif) | Final Transverse Abdomen A through H_1.png | 2019-07-30 19:22 | 103K | |
![[IMG]](/icons/image2.gif) | Final Transverse Abdomen A through H.png | 2019-07-30 19:22 | 103K | |
![[IMG]](/icons/image2.gif) | Chapter 09 Identify what structure the arrows are pointing to.png | 2019-07-30 19:20 | 268K | |
![[IMG]](/icons/image2.gif) | Chapter 11 What is being measured in this image accessory.png | 2019-07-30 19:20 | 296K | |
![[IMG]](/icons/image2.gif) | Final Long Aorta with Branches.png | 2019-07-30 19:19 | 76K | |
![[IMG]](/icons/image2.gif) | Chapter 15 What structures are the arrows pointing to and 24_1.png | 2019-07-30 19:19 | 593K | |
![[IMG]](/icons/image2.gif) | Final Double Right Ureteral Jets.png | 2019-07-30 19:18 | 354K | |
![[IMG]](/icons/image2.gif) | Chapter 08 Celiac Axis transverse branches.png | 2019-07-30 19:16 | 227K | |
![[IMG]](/icons/image2.gif) | Chapter 16 What structure is 23 24 25_2.png | 2019-07-30 18:18 | 550K | |
![[IMG]](/icons/image2.gif) | Chapter 16 What structure is 23 24 25_1.png | 2019-07-30 18:18 | 550K | |
![[IMG]](/icons/image2.gif) | Chapter 16 What structure is 23 24 25.png | 2019-07-30 18:18 | 550K | |
![[IMG]](/icons/image2.gif) | Chapter 15 What part of the kidney is the arrow.png | 2019-07-30 18:11 | 354K | |
![[IMG]](/icons/image2.gif) | Chapter 15 What structures are the arrows pointing to and 24.png | 2019-07-30 18:09 | 593K | |
![[IMG]](/icons/image2.gif) | Chapter 12 Transverse abdomen A through H and 24 25_6.png | 2019-07-26 20:42 | 80K | |
![[IMG]](/icons/image2.gif) | Chapter 12 Transverse abdomen A through H and 24 25_5.png | 2019-07-26 20:42 | 80K | |
![[IMG]](/icons/image2.gif) | Chapter 12 Transverse abdomen A through H and 24 25_4.png | 2019-07-26 20:41 | 80K | |
![[IMG]](/icons/image2.gif) | Chapter 12 Transverse abdomen A through H and 24 25_3.png | 2019-07-26 20:41 | 80K | |
![[IMG]](/icons/image2.gif) | Chapter 12 Transverse abdomen A through H and 24 25_2.png | 2019-07-26 20:41 | 80K | |
![[IMG]](/icons/image2.gif) | Chapter 12 Transverse abdomen A through H and 24 25_1.png | 2019-07-26 20:41 | 80K | |
![[IMG]](/icons/image2.gif) | Chapter 12 Transverse abdomen A through H and 24 25.png | 2019-07-26 20:40 | 80K | |
![[IMG]](/icons/image2.gif) | Chapter 11 What splenic measurement is being obtained scan plan and identify 25_2.png | 2019-07-26 18:09 | 483K | |
![[IMG]](/icons/image2.gif) | Chapter 11 What splenic measurement is being obtained scan plan and identify 25_1.png | 2019-07-26 18:09 | 483K | |
![[IMG]](/icons/image2.gif) | Chapter 11 What splenic measurement is being obtained scan plan and identify 25.png | 2019-07-26 18:09 | 483K | |
![[IMG]](/icons/image2.gif) | Chapter 11 What is being measured in this image wandering.png | 2019-07-26 18:06 | 296K | |
![[IMG]](/icons/image2.gif) | Chapter 11 What scan plane was this image obtained trv.png | 2019-07-26 18:06 | 389K | |
![[IMG]](/icons/image2.gif) | Chapter 11 What scan plane was this image obtained sag.png | 2019-07-26 18:04 | 419K | |
![[IMG]](/icons/image2.gif) | Chapter 10 Whar part of the GB is 23 24 25_3.png | 2019-07-26 17:16 | 141K | |
![[IMG]](/icons/image2.gif) | Chapter 10 Whar part of the GB is 23 24 25_2.png | 2019-07-26 17:16 | 141K | |
![[IMG]](/icons/image2.gif) | Chapter 10 Whar part of the GB is 23 24 25_1.png | 2019-07-26 17:16 | 141K | |
![[IMG]](/icons/image2.gif) | Chapter 10 Whar part of the GB is 23 24 25.png | 2019-07-26 17:15 | 141K | |
![[IMG]](/icons/image2.gif) | Chapter 10 What scan plane was this image taken trv.png | 2019-07-26 17:14 | 251K | |
![[IMG]](/icons/image2.gif) | Chapter 09 What lobe is 34 or structure is 35_1.png | 2019-07-26 15:34 | 253K | |
![[IMG]](/icons/image2.gif) | Chapter 09 What lobe is 34 or structure is 35.png | 2019-07-26 15:33 | 253K | |
![[IMG]](/icons/image2.gif) | Chapter 09 What vessel or structure is identified as 31 32 33_2.png | 2019-07-26 15:32 | 369K | |
![[IMG]](/icons/image2.gif) | Chapter 09 What vessel or structure is identified as 31 32 33_1.png | 2019-07-26 15:32 | 369K | |
![[IMG]](/icons/image2.gif) | Chapter 09 What vessel or structure is identified as 31 32 33.png | 2019-07-26 15:31 | 369K | |
![[IMG]](/icons/image2.gif) | Chapter 09 What structure is identified as 28 29 30_2.png | 2019-07-26 15:29 | 289K | |
![[IMG]](/icons/image2.gif) | Chapter 09 What structure is identified as 28 29 30_1.png | 2019-07-26 15:29 | 289K | |
![[IMG]](/icons/image2.gif) | Chapter 09 What structure is identified as 28 29 30.png | 2019-07-26 15:29 | 289K | |
![[IMG]](/icons/image2.gif) | Chapter 9 Identify what structure the arrows are pointing to_1.png | 2019-07-26 15:24 | 268K | |
![[IMG]](/icons/image2.gif) | Chapter 9 Identify what structure the arrows are pointing to.png | 2019-07-26 15:24 | 268K | |
![[IMG]](/icons/image2.gif) | Chapter 8 Celiac Axis transverse branches_2.png | 2019-07-25 16:28 | 227K | |
![[IMG]](/icons/image2.gif) | Chapter 8 Celiac Axis transverse branches_1.png | 2019-07-25 16:28 | 227K | |
![[IMG]](/icons/image2.gif) | Chapter 8 Celiac Axis transverse branches.png | 2019-07-25 16:27 | 227K | |
![[IMG]](/icons/image2.gif) | Chapter 8 What structure is labeled as 16 or 17_1.png | 2019-07-25 16:27 | 170K | |
![[IMG]](/icons/image2.gif) | Chapter 8 What structure is labeled as 16 or 17.png | 2019-07-25 16:27 | 170K | |
![[IMG]](/icons/image2.gif) | Chapter 42 This image demonstrates a ____ uterus.png | 2019-07-24 21:20 | 322K | |
![[IMG]](/icons/image2.gif) | Chapter 45 Patient hx pelvic fullness discomfort.emf.jpg | 2019-07-24 21:18 | 41K | |
![[IMG]](/icons/image2.gif) | Chapter 43 Sagittal image shows a.jpg | 2019-07-24 21:17 | 20K | |
![[IMG]](/icons/image2.gif) | Chapter 43 This image demonstrates an echogenic.png_1.jpg | 2019-07-24 21:16 | 53K | |
![[IMG]](/icons/image2.gif) | Chapter 43 EV view demonstrates an _1.jpg | 2019-07-24 21:15 | 79K | |
![[IMG]](/icons/image2.gif) | Chapter 42 The endometrium is during ___ phase.png | 2019-07-24 21:15 | 395K | |
![[IMG]](/icons/image2.gif) | Chapter 46 This image demonstrate mulitple choice.jpg | 2019-07-24 21:09 | 32K | |
![[IMG]](/icons/image2.gif) | Chapter 46 String of Pearls.jpg | 2019-07-24 20:56 | 61K | |
![[IMG]](/icons/image2.gif) | Chapter 46 Normal ovary in follicular phase.jpg | 2019-07-24 20:55 | 45K | |
![[IMG]](/icons/image2.gif) | Chapter 46 Vascular pedicle.jpg | 2019-07-24 20:54 | 63K | |
![[IMG]](/icons/image2.gif) | Chapter 46 This image demonstrates ___ extending from.emf.jpg | 2019-07-24 20:52 | 50K | |
![[IMG]](/icons/image2.gif) | Chapter 46 This image demonstrate mulitple choice.emf.jpg | 2019-07-24 20:50 | 32K | |
![[IMG]](/icons/image2.gif) | Chapter 45 An endometrioma is well-defined.jpg | 2019-07-24 20:42 | 35K | |
![[IMG]](/icons/image2.gif) | Chapter 45 Patient hx fever vaginal discharge and acute.png | 2019-07-24 20:40 | 397K | |
![[IMG]](/icons/image2.gif) | Chapter 45 Patient hx pelvic fullness discomfort.emf_1.jpg | 2019-07-24 20:39 | 41K | |
![[IMG]](/icons/image2.gif) | Chapter 44 Transbadominal image of this ovary.jpg | 2019-07-24 20:23 | 35K | |
![[IMG]](/icons/image2.gif) | Chapter 44 This mass demonstrates a.jpg | 2019-07-24 20:22 | 85K | |
![[IMG]](/icons/image2.gif) | Chapter 44 This sagittal image of the RUQ.jpg | 2019-07-24 20:20 | 103K | |
![[IMG]](/icons/image2.gif) | Chapter 44 This TV coronal image.jpg | 2019-07-24 20:19 | 41K | |
![[IMG]](/icons/image2.gif) | Chapter 44 The term.jpg | 2019-07-24 20:16 | 41K | |
![[IMG]](/icons/image2.gif) | Picture2_10.png | 2019-07-24 19:00 | 138K | |
![[IMG]](/icons/image2.gif) | Picture1_19.jpg | 2019-07-24 18:58 | 34K | |
![[IMG]](/icons/image2.gif) | Chapter 43 This image demonstrates an echogenic.png.jpg | 2019-07-24 17:57 | 53K | |
![[IMG]](/icons/image2.gif) | Chapter 43 EV view demonstrates an .jpg | 2019-07-24 17:55 | 79K | |
![[IMG]](/icons/image2.gif) | Chapter 43 These arrows are pointing to.jpg | 2019-07-24 17:54 | 61K | |
![[IMG]](/icons/image2.gif) | Chapter 43 Calcific myoma.jpg | 2019-07-24 17:52 | 61K | |
![[IMG]](/icons/image2.gif) | Chapter 43 Sagittal image.jpg | 2019-07-24 17:00 | 58K | |
![[IMG]](/icons/image2.gif) | Odontoid anatomy_1.jpg | 2019-07-18 16:47 | 56K | |
![[IMG]](/icons/image2.gif) | Odontoid anatomy.jpg | 2019-07-18 16:47 | 56K | |
![[IMG]](/icons/image2.gif) | Pilot AP C-spine.jpg | 2019-07-18 16:36 | 61K | |
![[IMG]](/icons/image2.gif) | 1563456783Picture1_10.png | 2019-07-18 13:33 | 155K | |
![[IMG]](/icons/image2.gif) | 15634567831525354525AP c spine_1.jpg | 2019-07-18 13:33 | 43K | |
![[IMG]](/icons/image2.gif) | 15634567831525354525AP c spine.jpg | 2019-07-18 13:33 | 43K | |
![[IMG]](/icons/image2.gif) | 15634567831525354525Obl diagram_1.jpg | 2019-07-18 13:33 | 56K | |
![[IMG]](/icons/image2.gif) | 15634567831525354525lat c image.jpg | 2019-07-18 13:33 | 65K | |
![[IMG]](/icons/image2.gif) | 15634567831525354525odontoid.jpg | 2019-07-18 13:33 | 29K | |
![[IMG]](/icons/image2.gif) | 15634567831525354525Picture3_7.jpg | 2019-07-18 13:33 | 30K | |
![[IMG]](/icons/image2.gif) | 15634567821525354525Obl diagram.jpg | 2019-07-18 13:33 | 56K | |
![[IMG]](/icons/image2.gif) | 15634567821525354525STN.jpg | 2019-07-18 13:33 | 44K | |
![[IMG]](/icons/image2.gif) | 15634567821525354525STN diagram_1.jpg | 2019-07-18 13:33 | 44K | |
![[IMG]](/icons/image2.gif) | 15634567821525354525Oble c-spine.jpg | 2019-07-18 13:33 | 56K | |
![[IMG]](/icons/image2.gif) | 15634567821525354525Lat c-spine anatomy_1.jpg | 2019-07-18 13:33 | 72K | |
![[IMG]](/icons/image2.gif) | 15634567821525354524STN image.jpg | 2019-07-18 13:33 | 56K | |
![[IMG]](/icons/image2.gif) | 15634567821525354524STN diagram.jpg | 2019-07-18 13:33 | 44K | |
![[IMG]](/icons/image2.gif) | 15634567821525354524Lat c-spine anatomy.jpg | 2019-07-18 13:33 | 72K | |
![[IMG]](/icons/image2.gif) | 1562955027Picture1_10.png | 2019-07-12 18:10 | 155K | |
![[IMG]](/icons/image2.gif) | 1562955027Picture1_8.png | 2019-07-12 18:10 | 1.0M | |
![[IMG]](/icons/image2.gif) | 15629550271525354525AP c spine_1.jpg | 2019-07-12 18:10 | 43K | |
![[IMG]](/icons/image2.gif) | 15629550271525354525AP c spine.jpg | 2019-07-12 18:10 | 43K | |
![[IMG]](/icons/image2.gif) | 15629550271525354525Obl diagram_1.jpg | 2019-07-12 18:10 | 56K | |
![[IMG]](/icons/image2.gif) | 15629550271525354525lat c image.jpg | 2019-07-12 18:10 | 65K | |
![[IMG]](/icons/image2.gif) | 15629550271525354525odontoid.jpg | 2019-07-12 18:10 | 29K | |
![[IMG]](/icons/image2.gif) | 15629550271525354525Picture3_7.jpg | 2019-07-12 18:10 | 30K | |
![[IMG]](/icons/image2.gif) | 15629550271525354525Picture1_15.jpg | 2019-07-12 18:10 | 75K | |
![[IMG]](/icons/image2.gif) | 15629550271525354525Picture1_14.jpg | 2019-07-12 18:10 | 75K | |
![[IMG]](/icons/image2.gif) | 15629550271525354525Obl diagram.jpg | 2019-07-12 18:10 | 56K | |
![[IMG]](/icons/image2.gif) | 15629550271525354525STN.jpg | 2019-07-12 18:10 | 44K | |
![[IMG]](/icons/image2.gif) | 15629550271525354525STN diagram_1.jpg | 2019-07-12 18:10 | 44K | |
![[IMG]](/icons/image2.gif) | 15629550271525354525Oble c-spine.jpg | 2019-07-12 18:10 | 56K | |
![[IMG]](/icons/image2.gif) | 15629550271525354525Lat c-spine anatomy_1.jpg | 2019-07-12 18:10 | 72K | |
![[IMG]](/icons/image2.gif) | 15629550271525354524STN image.jpg | 2019-07-12 18:10 | 56K | |
![[IMG]](/icons/image2.gif) | 15629550271525354524STN diagram.jpg | 2019-07-12 18:10 | 44K | |
![[IMG]](/icons/image2.gif) | 15629550271525354524Lat c-spine anatomy.jpg | 2019-07-12 18:10 | 72K | |
![[IMG]](/icons/image2.gif) | Picture3_16.png | 2019-07-09 13:54 | 364K | |
![[IMG]](/icons/image2.gif) | Picture2_17.jpg | 2019-07-09 13:35 | 13K | |
![[IMG]](/icons/image2.gif) | Picture1_23.png | 2019-07-09 13:04 | 637K | |
![[IMG]](/icons/image2.gif) | Picture2_16.jpg | 2019-06-26 13:07 | 36K | |
![[IMG]](/icons/image2.gif) | Picture1_22.png | 2019-06-26 13:01 | 122K | |
![[IMG]](/icons/image2.gif) | Picture2_9.png | 2019-06-10 16:24 | 150K | |
![[IMG]](/icons/image2.gif) | Picture1_20.jpg | 2019-06-10 16:17 | 213K | |
![[IMG]](/icons/image2.gif) | ME9.JPG | 2019-06-10 12:07 | 60K | |
![[IMG]](/icons/image2.gif) | ME7.JPG | 2019-06-10 12:07 | 83K | |
![[IMG]](/icons/image2.gif) | ME4.JPG | 2019-06-10 12:05 | 64K | |
![[IMG]](/icons/image2.gif) | ME3.JPG | 2019-06-10 12:03 | 81K | |
![[IMG]](/icons/image2.gif) | lat_1.png | 2019-05-23 12:39 | 79K | |
![[IMG]](/icons/image2.gif) | ap.png | 2019-05-23 12:37 | 139K | |
![[IMG]](/icons/image2.gif) | Picture4_8.png | 2019-05-17 13:38 | 1.1M | |
![[IMG]](/icons/image2.gif) | Picture1_21.png | 2019-05-17 12:28 | 230K | |
![[IMG]](/icons/image2.gif) | Frog l hip with pelvis rotation.jpg | 2019-05-14 14:58 | 50K | |
![[IMG]](/icons/image2.gif) | Pelvis frog.jpg | 2019-05-06 16:41 | 60K | |
![[IMG]](/icons/image2.gif) | AP pelvis w cutoff.jpg | 2019-05-06 16:39 | 50K | |
![[IMG]](/icons/image2.gif) | Good LPO pelvis.jpg | 2019-05-06 14:29 | 63K | |
![[IMG]](/icons/image2.gif) | Xtable hip diagram_1.jpg | 2019-05-06 14:24 | 51K | |
![[IMG]](/icons/image2.gif) | Xtable hip diagram.jpg | 2019-05-06 14:22 | 51K | |
![[IMG]](/icons/image2.gif) | LPO pelvis.jpg | 2019-05-06 14:14 | 48K | |
![[IMG]](/icons/image2.gif) | Pelvic columns.jpg | 2019-05-06 14:10 | 50K | |
![[IMG]](/icons/image2.gif) | 1557151400Picture1_20.png | 2019-05-06 14:03 | 202K | |
![[IMG]](/icons/image2.gif) | 15571514001552580670Obl SI jt underrotated.png | 2019-05-06 14:03 | 143K | |
![[IMG]](/icons/image2.gif) | 15571514001552580670Pilot image 2.png | 2019-05-06 14:03 | 71K | |
![[IMG]](/icons/image2.gif) | 15571514001552580670Pilot AP sacrum.png | 2019-05-06 14:03 | 144K | |
![[IMG]](/icons/image2.gif) | 155715140015525806701524597110Left SI jt obl.png | 2019-05-06 14:03 | 416K | |
![[IMG]](/icons/image2.gif) | 155715140015525806701524597110Right SI obl.png | 2019-05-06 14:03 | 323K | |
![[IMG]](/icons/image2.gif) | 155715140015525806701524597110lat coccyx.png | 2019-05-06 14:03 | 127K | |
![[IMG]](/icons/image2.gif) | 155715140015525806701524597110lat sacrum.png | 2019-05-06 14:03 | 169K | |
![[IMG]](/icons/image2.gif) | 155715140015525806701524597110ob sli joint.png | 2019-05-06 14:03 | 144K | |
![[IMG]](/icons/image2.gif) | 155715140015525806701524597110AP Sacrum 2.png | 2019-05-06 14:03 | 176K | |
![[IMG]](/icons/image2.gif) | 155715140015525806701524597110ap sacrum 3.png | 2019-05-06 14:03 | 147K | |
![[IMG]](/icons/image2.gif) | 15571514001552580670AP Sacrum_1.png | 2019-05-06 14:03 | 206K | |
![[IMG]](/icons/image2.gif) | 155715140015525806701524597110sacral canal iamge.png | 2019-05-06 14:03 | 83K | |
![[IMG]](/icons/image2.gif) | 155715140015525806701524597110lat diagram.png | 2019-05-06 14:03 | 112K | |
![[IMG]](/icons/image2.gif) | 155715140015525806701524597110ap diagram_2.png | 2019-05-06 14:03 | 134K | |
![[IMG]](/icons/image2.gif) | 155715140015525806701524597110ap diagram_1.png | 2019-05-06 14:03 | 134K | |
![[IMG]](/icons/image2.gif) | 155715140015525806701524597110ap diagram.png | 2019-05-06 14:03 | 134K | |
![[IMG]](/icons/image2.gif) | 155715140015514696311524597110Ribs pilot.png | 2019-05-06 14:03 | 322K | |
![[IMG]](/icons/image2.gif) | 15571514001551469630Sternum RAO.jpg | 2019-05-06 14:03 | 66K | |
![[IMG]](/icons/image2.gif) | 155715140015514696301524597110new.jpg | 2019-05-06 14:03 | 53K | |
![[IMG]](/icons/image2.gif) | 15571514001551469630Ribs R obl.png.jpg | 2019-05-06 14:03 | 65K | |
![[IMG]](/icons/image2.gif) | 155715140015514696301524597110Picture1_8.jpg | 2019-05-06 14:03 | 79K | |
![[IMG]](/icons/image2.gif) | 15571514001551469630Picture1_3.jpg | 2019-05-06 14:03 | 47K | |
![[IMG]](/icons/image2.gif) | 1557151400155146963015245971102 sternum.jpg | 2019-05-06 14:03 | 21K | |
![[IMG]](/icons/image2.gif) | 155715140015514696301524597110NEW sternum lat diag.jpg | 2019-05-06 14:03 | 30K | |
![[IMG]](/icons/image2.gif) | 155715140015514696301524597110SternumDia1.png | 2019-05-06 14:03 | 61K | |
![[IMG]](/icons/image2.gif) | 155715140015514696301524597110Picture1_3.png | 2019-05-06 14:03 | 148K | |
![[IMG]](/icons/image2.gif) | 15571514001551469630Sternum RAO 2.jpg | 2019-05-06 14:03 | 76K | |
![[IMG]](/icons/image2.gif) | 155715140015514696301524597110LObl Ribs.png | 2019-05-06 14:03 | 137K | |
![[IMG]](/icons/image2.gif) | 155715140015514696301524597110RibDia1.png | 2019-05-06 14:03 | 26K | |
![[IMG]](/icons/image2.gif) | 15571514001551469630AP Ribs2.png | 2019-05-06 14:03 | 126K | |
![[IMG]](/icons/image2.gif) | 15571513991524506853xTHip.png | 2019-05-06 14:03 | 158K | |
![[IMG]](/icons/image2.gif) | 15571513991524506853IM oblpelvis2.png | 2019-05-06 14:03 | 235K | |
![[IMG]](/icons/image2.gif) | 15571513991524506853Frog pelvis.jpg | 2019-05-06 14:03 | 39K | |
![[IMG]](/icons/image2.gif) | 15571513991524506853Pelvisdia2.png | 2019-05-06 14:03 | 427K | |
![[IMG]](/icons/image2.gif) | 15571513991524506853Pelvisdia1.png | 2019-05-06 14:03 | 427K | |
![[IMG]](/icons/image2.gif) | 15571513991524506853HIpdia3.png | 2019-05-06 14:03 | 105K | |
![[IMG]](/icons/image2.gif) | 15571513991524506853hipdiagram2.png | 2019-05-06 14:03 | 106K | |
![[IMG]](/icons/image2.gif) | 15571513991524506853hipdiagram1.png | 2019-05-06 14:03 | 106K | |
![[IMG]](/icons/image2.gif) | 15571513991524506852IMFroghip_1.png | 2019-05-06 14:03 | 77K | |
![[IMG]](/icons/image2.gif) | 15571513991524506852IMFroghip.png | 2019-05-06 14:03 | 77K | |
![[IMG]](/icons/image2.gif) | 15571513991524506852Im AP Pelvis.png | 2019-05-06 14:03 | 127K | |
![[IMG]](/icons/image2.gif) | Sims.jpg | 2019-05-02 15:31 | 15K | |
![[IMG]](/icons/image2.gif) | LLD position.jpg | 2019-05-02 15:29 | 27K | |
![[IMG]](/icons/image2.gif) | 12.jpg | 2019-04-18 18:03 | 33K | |
![[IMG]](/icons/image2.gif) | 11.jpg | 2019-04-18 18:01 | 29K | |
![[IMG]](/icons/image2.gif) | 10.jpg | 2019-04-18 18:00 | 30K | |
![[IMG]](/icons/image2.gif) | 8.jpg | 2019-04-18 17:56 | 32K | |
![[IMG]](/icons/image2.gif) | 6.jpg | 2019-04-18 17:53 | 31K | |
![[IMG]](/icons/image2.gif) | 5.jpg | 2019-04-18 17:51 | 354K | |
![[IMG]](/icons/image2.gif) | 2_2.jpg | 2019-04-18 17:45 | 30K | |
![[IMG]](/icons/image2.gif) | 1_2.jpg | 2019-04-18 17:43 | 28K | |
![[IMG]](/icons/image2.gif) | inferior stemi.jpg | 2019-04-18 17:33 | 149K | |
![[IMG]](/icons/image2.gif) | 143.png | 2019-04-18 17:22 | 253K | |
![[IMG]](/icons/image2.gif) | 132.png | 2019-04-18 17:21 | 2.3M | |
![[IMG]](/icons/image2.gif) | 131.png | 2019-04-18 17:21 | 2.3M | |
![[IMG]](/icons/image2.gif) | 130.jpg | 2019-04-18 17:20 | 347K | |
![[IMG]](/icons/image2.gif) | ribs.png | 2019-04-18 15:00 | 117K | |
![[IMG]](/icons/image2.gif) | sternum.png | 2019-04-18 14:58 | 426K | |
![[IMG]](/icons/image2.gif) | wrist fracture_1.png | 2019-03-26 16:08 | 33K | |
![[IMG]](/icons/image2.gif) | forearm.jpg | 2019-03-26 16:07 | 9.6K | |
![[IMG]](/icons/image2.gif) | Picture1_20.png | 2019-03-15 12:52 | 202K | |
![[IMG]](/icons/image2.gif) | 1552580670Obl SI jt underrotated.png | 2019-03-14 16:24 | 143K | |
![[IMG]](/icons/image2.gif) | 1552580670Pilot image 2.png | 2019-03-14 16:24 | 71K | |
![[IMG]](/icons/image2.gif) | 1552580670Pilot AP sacrum.png | 2019-03-14 16:24 | 144K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110Left SI jt obl.png | 2019-03-14 16:24 | 416K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110Right SI obl.png | 2019-03-14 16:24 | 323K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110lat coccyx.png | 2019-03-14 16:24 | 127K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110lat sacrum.png | 2019-03-14 16:24 | 169K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110ob sli joint.png | 2019-03-14 16:24 | 144K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110AP Sacrum 2.png | 2019-03-14 16:24 | 176K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110ap sacrum 3.png | 2019-03-14 16:24 | 147K | |
![[IMG]](/icons/image2.gif) | 1552580670AP Sacrum_1.png | 2019-03-14 16:24 | 206K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110sacral canal iamge.png | 2019-03-14 16:24 | 83K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110ap diagram_2.png | 2019-03-14 16:24 | 134K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110ap diagram_1.png | 2019-03-14 16:24 | 134K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110Ribs pilot.png | 2019-03-14 16:24 | 322K | |
![[IMG]](/icons/image2.gif) | 1552580670Sternum RAO.jpg | 2019-03-14 16:24 | 66K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110new.jpg | 2019-03-14 16:24 | 53K | |
![[IMG]](/icons/image2.gif) | 1552580670Ribs R obl.png.jpg | 2019-03-14 16:24 | 65K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110Picture1_8.jpg | 2019-03-14 16:24 | 79K | |
![[IMG]](/icons/image2.gif) | 1552580670Picture1_3.jpg | 2019-03-14 16:24 | 47K | |
![[IMG]](/icons/image2.gif) | 155258067015245971102 sternum.jpg | 2019-03-14 16:24 | 21K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110NEW sternum lat diag.jpg | 2019-03-14 16:24 | 30K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110SternumDia1.png | 2019-03-14 16:24 | 61K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110Picture1_3.png | 2019-03-14 16:24 | 148K | |
![[IMG]](/icons/image2.gif) | 1552580670Sternum RAO 2.jpg | 2019-03-14 16:24 | 76K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110LObl Ribs.png | 2019-03-14 16:24 | 137K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110RibDia1.png | 2019-03-14 16:24 | 26K | |
![[IMG]](/icons/image2.gif) | 1552580670AP Ribs2.png | 2019-03-14 16:24 | 126K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110xTHip.png | 2019-03-14 16:24 | 158K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110IM oblpelvis2.png | 2019-03-14 16:24 | 235K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110Frog pelvis.jpg | 2019-03-14 16:24 | 39K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110Pelvisdia2.png | 2019-03-14 16:24 | 427K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110Pelvisdia1.png | 2019-03-14 16:24 | 427K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110HIpdia3.png | 2019-03-14 16:24 | 105K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110hipdiagram2.png | 2019-03-14 16:24 | 106K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110hipdiagram1.png | 2019-03-14 16:24 | 106K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110column.png | 2019-03-14 16:24 | 234K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110IMFroghip_1.png | 2019-03-14 16:24 | 77K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110IMFroghip.png | 2019-03-14 16:24 | 77K | |
![[IMG]](/icons/image2.gif) | 15525806701524597110Im AP Pelvis.png | 2019-03-14 16:24 | 127K | |
![[IMG]](/icons/image2.gif) | Wires.jpg | 2019-03-11 13:01 | 34K | |
![[IMG]](/icons/image2.gif) | caudad angle.jpg | 2019-03-11 12:57 | 36K | |
![[IMG]](/icons/image2.gif) | Pilot 6_1.jpg | 2019-03-06 15:41 | 20K | |
![[IMG]](/icons/image2.gif) | pilot 5_1.jpg | 2019-03-06 15:38 | 19K | |
![[IMG]](/icons/image2.gif) | Picture1_18.jpg | 2019-03-06 14:48 | 19K | |
![[IMG]](/icons/image2.gif) | 1551469631Obl SI jt underrotated.png | 2019-03-01 19:47 | 143K | |
![[IMG]](/icons/image2.gif) | 1551469631Pilot image 2.png | 2019-03-01 19:47 | 71K | |
![[IMG]](/icons/image2.gif) | 1551469631Pilot AP sacrum.png | 2019-03-01 19:47 | 144K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110Left SI jt obl.png | 2019-03-01 19:47 | 416K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110Right SI obl.png | 2019-03-01 19:47 | 323K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110lat coccyx.png | 2019-03-01 19:47 | 127K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110lat sacrum.png | 2019-03-01 19:47 | 169K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110ob sli joint.png | 2019-03-01 19:47 | 144K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110AP Sacrum 2.png | 2019-03-01 19:47 | 176K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110ap sacrum 3.png | 2019-03-01 19:47 | 147K | |
![[IMG]](/icons/image2.gif) | 1551469631AP Sacrum_1.png | 2019-03-01 19:47 | 206K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110sacral canal iamge.png | 2019-03-01 19:47 | 83K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110lat diagram.png | 2019-03-01 19:47 | 112K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110ap diagram_2.png | 2019-03-01 19:47 | 134K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110ap diagram_1.png | 2019-03-01 19:47 | 134K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110ap diagram.png | 2019-03-01 19:47 | 134K | |
![[IMG]](/icons/image2.gif) | 15514696311524597110Ribs pilot.png | 2019-03-01 19:47 | 322K | |
![[IMG]](/icons/image2.gif) | 1551469630Sternum RAO.jpg | 2019-03-01 19:47 | 66K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110new.jpg | 2019-03-01 19:47 | 53K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110Picture1_8.jpg | 2019-03-01 19:47 | 79K | |
![[IMG]](/icons/image2.gif) | 155146963015245971102 sternum.jpg | 2019-03-01 19:47 | 21K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110NEW sternum lat diag.jpg | 2019-03-01 19:47 | 30K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110SternumDia1.png | 2019-03-01 19:47 | 61K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110Picture1_3.png | 2019-03-01 19:47 | 148K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110LObl Ribs.png | 2019-03-01 19:47 | 137K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110RibDia1.png | 2019-03-01 19:47 | 26K | |
![[IMG]](/icons/image2.gif) | 1551469630AP Ribs2.png | 2019-03-01 19:47 | 126K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110xTHip.png | 2019-03-01 19:47 | 158K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110IM oblpelvis2.png | 2019-03-01 19:47 | 235K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110Frog pelvis.jpg | 2019-03-01 19:47 | 39K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110Pelvisdia2.png | 2019-03-01 19:47 | 427K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110Pelvisdia1.png | 2019-03-01 19:47 | 427K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110HIpdia3.png | 2019-03-01 19:47 | 105K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110hipdiagram2.png | 2019-03-01 19:47 | 106K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110hipdiagram1.png | 2019-03-01 19:47 | 106K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110column.png | 2019-03-01 19:47 | 234K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110IMFroghip_1.png | 2019-03-01 19:47 | 77K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110IMFroghip.png | 2019-03-01 19:47 | 77K | |
![[IMG]](/icons/image2.gif) | 15514696301524597110Im AP Pelvis.png | 2019-03-01 19:47 | 127K | |
![[IMG]](/icons/image2.gif) | MR Head.png | 2019-02-27 20:36 | 59K | |
![[IMG]](/icons/image2.gif) | MRI Coronal Abdomen.png | 2019-02-27 20:35 | 255K | |
![[IMG]](/icons/image2.gif) | MRA Abdominal Ao and branches_1.png | 2019-02-27 20:34 | 154K | |
![[IMG]](/icons/image2.gif) | MRA Abdominal Ao and branches.png | 2019-02-27 20:33 | 154K | |
![[IMG]](/icons/image2.gif) | Brain final.png | 2019-02-27 20:31 | 27K | |
![[IMG]](/icons/image2.gif) | RUQ Regions.png | 2019-02-27 20:29 | 41K | |
![[IMG]](/icons/image2.gif) | Bladder UT Ov 18 19 20_2.png | 2019-02-27 20:14 | 59K | |
![[IMG]](/icons/image2.gif) | Bladder UT Ov 18 19 20_1.png | 2019-02-27 20:13 | 59K | |
![[IMG]](/icons/image2.gif) | Bladder UT Ov 18 19 20.png | 2019-02-27 20:12 | 59K | |
![[IMG]](/icons/image2.gif) | Bladder UT Ov.png | 2019-02-27 20:10 | 54K | |
![[IMG]](/icons/image2.gif) | Bladder ureters.png | 2019-02-27 20:09 | 199K | |
![[IMG]](/icons/image2.gif) | Spleen 2.png | 2019-02-27 20:05 | 287K | |
![[IMG]](/icons/image2.gif) | Spleen 1.png | 2019-02-27 20:04 | 274K | |
![[IMG]](/icons/image2.gif) | CT Abdomen 14 15 16 17 18_4.png | 2019-02-27 20:03 | 45K | |
![[IMG]](/icons/image2.gif) | CT Abdomen 14 15 16 17 18_3.png | 2019-02-27 20:03 | 45K | |
![[IMG]](/icons/image2.gif) | CT Abdomen 14 15 16 17 18_2.png | 2019-02-27 20:02 | 45K | |
![[IMG]](/icons/image2.gif) | CT Abdomen 14 15 16 17 18_1.png | 2019-02-27 20:02 | 45K | |
![[IMG]](/icons/image2.gif) | CT Abdomen 14 15 16 17 18.png | 2019-02-27 20:01 | 45K | |
![[IMG]](/icons/image2.gif) | Kidney Chapter 07.png | 2019-02-27 19:42 | 66K | |
![[IMG]](/icons/image2.gif) | Kidney 16 17 18 19_3.png | 2019-02-27 19:41 | 267K | |
![[IMG]](/icons/image2.gif) | Kidney 16 17 18 19_2.png | 2019-02-27 19:41 | 267K | |
![[IMG]](/icons/image2.gif) | Kidney 16 17 18 19_1.png | 2019-02-27 19:41 | 267K | |
![[IMG]](/icons/image2.gif) | Kidney 16 17 18 19.png | 2019-02-27 19:40 | 267K | |
![[IMG]](/icons/image2.gif) | Pancreas 19 20_1.png | 2019-02-27 19:32 | 48K | |
![[IMG]](/icons/image2.gif) | Pancreas 19 20.png | 2019-02-27 19:32 | 48K | |
![[IMG]](/icons/image2.gif) | CT Abdomen 16 17 18_2.png | 2019-02-27 19:31 | 207K | |
![[IMG]](/icons/image2.gif) | CT Abdomen 16 17 18_1.png | 2019-02-27 19:31 | 207K | |
![[IMG]](/icons/image2.gif) | CT Abdomen 16 17 18.png | 2019-02-27 19:30 | 207K | |
![[IMG]](/icons/image2.gif) | CT Abdomen 18 19 20_2.png | 2019-02-27 19:24 | 189K | |
![[IMG]](/icons/image2.gif) | CT Abdomen 18 19 20_1.png | 2019-02-27 19:24 | 189K | |
![[IMG]](/icons/image2.gif) | CT Abdomen 18 19 20.png | 2019-02-27 19:24 | 189K | |
![[IMG]](/icons/image2.gif) | Gallbladder 17.png | 2019-02-27 19:23 | 37K | |
![[IMG]](/icons/image2.gif) | Pancreas with CBD and Vessels 16.png | 2019-02-27 19:22 | 163K | |
![[IMG]](/icons/image2.gif) | Liver1_2.png | 2019-02-27 19:06 | 56K | |
![[IMG]](/icons/image2.gif) | Liver1_1.png | 2019-02-27 19:06 | 56K | |
![[IMG]](/icons/image2.gif) | Liver1.png | 2019-02-27 19:05 | 56K | |
![[IMG]](/icons/image2.gif) | Panc and Surrounding structures_4.png | 2019-02-27 19:00 | 50K | |
![[IMG]](/icons/image2.gif) | Panc and Surrounding structures_3.png | 2019-02-27 18:59 | 50K | |
![[IMG]](/icons/image2.gif) | Panc and Surrounding structures_2.png | 2019-02-27 18:59 | 50K | |
![[IMG]](/icons/image2.gif) | Panc and Surrounding structures_1.png | 2019-02-27 18:59 | 50K | |
![[IMG]](/icons/image2.gif) | Panc and Surrounding structures.png | 2019-02-27 18:58 | 50K | |
![[IMG]](/icons/image2.gif) | IVC and HV_3.png | 2019-02-27 18:57 | 43K | |
![[IMG]](/icons/image2.gif) | IVC and HV_2.png | 2019-02-27 18:57 | 43K | |
![[IMG]](/icons/image2.gif) | IVC and HV_1.png | 2019-02-27 18:57 | 43K | |
![[IMG]](/icons/image2.gif) | IVC and HV.png | 2019-02-27 18:56 | 43K | |
![[IMG]](/icons/image2.gif) | AO and branches_2.png | 2019-02-27 18:56 | 314K | |
![[IMG]](/icons/image2.gif) | AO and branches_1.png | 2019-02-27 18:55 | 314K | |
![[IMG]](/icons/image2.gif) | AO and branches.png | 2019-02-27 18:55 | 314K | |
![[IMG]](/icons/image2.gif) | Panc and Vessels.png | 2019-02-27 18:41 | 442K | |
![[IMG]](/icons/image2.gif) | Brain2.png | 2019-02-27 18:40 | 138K | |
![[IMG]](/icons/image2.gif) | Brain1.png | 2019-02-27 18:38 | 193K | |
![[IMG]](/icons/image2.gif) | BrainStructures_4.png | 2019-02-27 18:28 | 152K | |
![[IMG]](/icons/image2.gif) | BrainStructures_3.png | 2019-02-27 18:28 | 152K | |
![[IMG]](/icons/image2.gif) | BrainStructures_2.png | 2019-02-27 18:28 | 152K | |
![[IMG]](/icons/image2.gif) | BrainStructures_1.png | 2019-02-27 18:28 | 152K | |
![[IMG]](/icons/image2.gif) | BrainStructures.png | 2019-02-27 18:27 | 152K | |
![[IMG]](/icons/image2.gif) | Pilot Scapular Y image_1.png | 2019-02-26 12:59 | 37K | |
![[IMG]](/icons/image2.gif) | Pilot SC joint image.png | 2019-02-21 14:23 | 39K | |
![[IMG]](/icons/image2.gif) | Pilot Clavicle image.png | 2019-02-21 14:21 | 129K | |
![[IMG]](/icons/image2.gif) | Uterus2.png | 2019-02-18 17:28 | 322K | |
![[IMG]](/icons/image2.gif) | Endo1.png | 2019-02-18 17:27 | 395K | |
![[IMG]](/icons/image2.gif) | Uterus1.jpg | 2019-02-18 17:25 | 26K | |
![[IMG]](/icons/image2.gif) | critical thinking_1.jpg | 2019-02-14 20:29 | 25K | |
![[IMG]](/icons/image2.gif) | 2 Image Critique Pilot.jpg | 2019-02-14 20:23 | 18K | |
![[IMG]](/icons/image2.gif) | 1- image critique pilot.jpg | 2019-02-14 20:21 | 26K | |
![[IMG]](/icons/image2.gif) | Over.jpg | 2019-02-07 20:04 | 22K | |
![[IMG]](/icons/image2.gif) | patella pilot.png | 2019-02-01 19:53 | 78K | |
![[IMG]](/icons/image2.gif) | 1548946329APSacrum pilot.png | 2019-01-31 14:52 | 100K | |
![[IMG]](/icons/image2.gif) | 1548946329sacrum gas.png | 2019-01-31 14:52 | 56K | |
![[IMG]](/icons/image2.gif) | 1548946329Left SI jt obl.png | 2019-01-31 14:52 | 416K | |
![[IMG]](/icons/image2.gif) | 1548946329Right SI obl.png | 2019-01-31 14:52 | 323K | |
![[IMG]](/icons/image2.gif) | 1548946329lat coccyx.png | 2019-01-31 14:52 | 127K | |
![[IMG]](/icons/image2.gif) | 1548946329lat sacrum.png | 2019-01-31 14:52 | 169K | |
![[IMG]](/icons/image2.gif) | 1548946329ob sli joint.png | 2019-01-31 14:52 | 144K | |
![[IMG]](/icons/image2.gif) | 1548946329AP Sacrum 2.png | 2019-01-31 14:52 | 176K | |
![[IMG]](/icons/image2.gif) | 1548946329ap sacrum 3.png | 2019-01-31 14:52 | 147K | |
![[IMG]](/icons/image2.gif) | 1548946329AP Sacrum.png | 2019-01-31 14:52 | 122K | |
![[IMG]](/icons/image2.gif) | 1548946329sacral canal iamge.png | 2019-01-31 14:52 | 83K | |
![[IMG]](/icons/image2.gif) | 1548946329lat diagram.png | 2019-01-31 14:52 | 112K | |
![[IMG]](/icons/image2.gif) | 1548946329ap diagram_2.png | 2019-01-31 14:52 | 134K | |
![[IMG]](/icons/image2.gif) | 1548946329ap diagram_1.png | 2019-01-31 14:52 | 134K | |
![[IMG]](/icons/image2.gif) | 1548946329ap diagram.png | 2019-01-31 14:52 | 134K | |
![[IMG]](/icons/image2.gif) | 1548946329Ribs pilot.png | 2019-01-31 14:52 | 322K | |
![[IMG]](/icons/image2.gif) | 1548946329RAO sternum pilot .png | 2019-01-31 14:52 | 82K | |
![[IMG]](/icons/image2.gif) | 1548946329new.jpg | 2019-01-31 14:52 | 53K | |
![[IMG]](/icons/image2.gif) | 1548946329Picture1_9.jpg | 2019-01-31 14:52 | 76K | |
![[IMG]](/icons/image2.gif) | 1548946329Picture1_8.jpg | 2019-01-31 14:52 | 79K | |
![[IMG]](/icons/image2.gif) | 1548946329AP RIbs.png | 2019-01-31 14:52 | 78K | |
![[IMG]](/icons/image2.gif) | 15489463282 sternum.jpg | 2019-01-31 14:52 | 21K | |
![[IMG]](/icons/image2.gif) | 1548946328NEW sternum lat diag.jpg | 2019-01-31 14:52 | 30K | |
![[IMG]](/icons/image2.gif) | 1548946328SternumDia1.png | 2019-01-31 14:52 | 61K | |
![[IMG]](/icons/image2.gif) | 1548946328Picture1_3.png | 2019-01-31 14:52 | 148K | |
![[IMG]](/icons/image2.gif) | 1548946328RAOSternumIMAGE.png | 2019-01-31 14:52 | 177K | |
![[IMG]](/icons/image2.gif) | 1548946328LObl Ribs.png | 2019-01-31 14:52 | 137K | |
![[IMG]](/icons/image2.gif) | 1548946328RibDia1.png | 2019-01-31 14:52 | 26K | |
![[IMG]](/icons/image2.gif) | 1548946328AP Ribs1.png | 2019-01-31 14:52 | 94K | |
![[IMG]](/icons/image2.gif) | 1548946328xTHip.png | 2019-01-31 14:52 | 158K | |
![[IMG]](/icons/image2.gif) | 1548946328IM oblpelvis2.png | 2019-01-31 14:52 | 235K | |
![[IMG]](/icons/image2.gif) | 1548946328Frog pelvis.jpg | 2019-01-31 14:52 | 39K | |
![[IMG]](/icons/image2.gif) | 1548946328Pelvisdia2.png | 2019-01-31 14:52 | 427K | |
![[IMG]](/icons/image2.gif) | 1548946328Pelvisdia1.png | 2019-01-31 14:52 | 427K | |
![[IMG]](/icons/image2.gif) | 1548946328HIpdia3.png | 2019-01-31 14:52 | 105K | |
![[IMG]](/icons/image2.gif) | 1548946328hipdiagram2.png | 2019-01-31 14:52 | 106K | |
![[IMG]](/icons/image2.gif) | 1548946328hipdiagram1.png | 2019-01-31 14:52 | 106K | |
![[IMG]](/icons/image2.gif) | 1548946328column.png | 2019-01-31 14:52 | 234K | |
![[IMG]](/icons/image2.gif) | 1548946328IMFroghip_1.png | 2019-01-31 14:52 | 77K | |
![[IMG]](/icons/image2.gif) | 1548946328IMFroghip.png | 2019-01-31 14:52 | 77K | |
![[IMG]](/icons/image2.gif) | 1548946328Im AP Pelvis.png | 2019-01-31 14:52 | 127K | |
![[IMG]](/icons/image2.gif) | Picture2_8.png | 2018-12-06 17:47 | 230K | |
![[IMG]](/icons/image2.gif) | Picture1_19.png | 2018-12-06 17:38 | 241K | |
![[IMG]](/icons/image2.gif) | Picture1_18.png | 2018-12-06 17:33 | 241K | |
![[IMG]](/icons/image2.gif) | Picture1_17.png | 2018-12-06 17:30 | 241K | |
![[IMG]](/icons/image2.gif) | Picture1_16.png | 2018-12-06 17:14 | 241K | |
![[IMG]](/icons/image2.gif) | Picture1_5.jpg | 2018-11-19 15:08 | 7.3K | |
![[IMG]](/icons/image2.gif) | Picture7_4.png | 2018-11-14 20:01 | 183K | |
![[IMG]](/icons/image2.gif) | Picture5_11.png | 2018-11-14 19:57 | 74K | |
![[IMG]](/icons/image2.gif) | Picture3_17.png | 2018-11-14 19:00 | 64K | |
![[IMG]](/icons/image2.gif) | Picture1_15.png | 2018-11-14 18:49 | 50K | |
![[IMG]](/icons/image2.gif) | Picture1_14.png | 2018-11-12 15:54 | 241K | |
![[IMG]](/icons/image2.gif) | Picture1_13.png | 2018-11-12 15:53 | 241K | |
![[IMG]](/icons/image2.gif) | Figure 5_6.png | 2018-11-12 15:35 | 216K | |
![[IMG]](/icons/image2.gif) | Picture1_12.png | 2018-10-29 18:40 | 217K | |
![[IMG]](/icons/image2.gif) | Image 9.png | 2018-10-29 18:36 | 202K | |
![[IMG]](/icons/image2.gif) | Picture2_6.png | 2018-10-24 16:05 | 98K | |
![[IMG]](/icons/image2.gif) | Picture1_11.png | 2018-10-24 15:58 | 608K | |
![[IMG]](/icons/image2.gif) | Celiac Axis Transverse Branches_2.png | 2018-10-19 18:19 | 227K | |
![[IMG]](/icons/image2.gif) | Celiac Axis Transverse Branches_1.png | 2018-10-19 18:19 | 227K | |
![[IMG]](/icons/image2.gif) | Celiac Axis Transverse Branches.png | 2018-10-19 18:19 | 227K | |
![[IMG]](/icons/image2.gif) | AO SMA CA Sagittal_1.png | 2018-10-19 18:16 | 170K | |
![[IMG]](/icons/image2.gif) | AO SMA CA Sagittal.png | 2018-10-19 18:15 | 170K | |
![[IMG]](/icons/image2.gif) | elbow small.png | 2018-10-12 14:28 | 85K | |
![[IMG]](/icons/image2.gif) | elbow big.png | 2018-10-12 14:27 | 399K | |
![[IMG]](/icons/image2.gif) | 1536868041boxer.png | 2018-09-13 19:47 | 57K | |
![[IMG]](/icons/image2.gif) | 1536868041child.png | 2018-09-13 19:47 | 62K | |
![[IMG]](/icons/image2.gif) | 1536868041hand rot.png | 2018-09-13 19:47 | 78K | |
![[IMG]](/icons/image2.gif) | 1536868041Picture7_2.png | 2018-09-13 19:47 | 232K | |
![[IMG]](/icons/image2.gif) | 1536868041Picture6_2.jpg | 2018-09-13 19:47 | 15K | |
![[IMG]](/icons/image2.gif) | 15368680411506344230hand_20w_20nail.jpg | 2018-09-13 19:47 | 35K | |
![[IMG]](/icons/image2.gif) | 1536868041Picture3_13.png | 2018-09-13 19:47 | 45K | |
![[IMG]](/icons/image2.gif) | 15368680411506344230hand lat rotation.jpg | 2018-09-13 19:47 | 27K | |
![[IMG]](/icons/image2.gif) | 15368680411506344230Finger pa collimation.jpg | 2018-09-13 19:47 | 27K | |
![[IMG]](/icons/image2.gif) | 15368680411506344230hand obl.jpg | 2018-09-13 19:47 | 28K | |
![[IMG]](/icons/image2.gif) | 1536868041ulna.png | 2018-09-13 19:47 | 30K | |
![[IMG]](/icons/image2.gif) | 15368680411506344230Hand lat 2.jpg | 2018-09-13 19:47 | 44K | |
![[IMG]](/icons/image2.gif) | 15368680411506344230thumb ap.jpg | 2018-09-13 19:47 | 40K | |
![[IMG]](/icons/image2.gif) | 1536868041Picture2.png | 2018-09-13 19:47 | 179K | |
![[IMG]](/icons/image2.gif) | 1536868041finger.png | 2018-09-13 19:47 | 40K | |
![[IMG]](/icons/image2.gif) | 15368680411506344230Hand anatomy_2.jpg | 2018-09-13 19:47 | 29K | |
![[IMG]](/icons/image2.gif) | 15368680411506344230thumb obl.jpg | 2018-09-13 19:47 | 11K | |
![[IMG]](/icons/image2.gif) | 15368680401506344230Hand anatomy_3.jpg | 2018-09-13 19:47 | 29K | |
![[IMG]](/icons/image2.gif) | 15368680401506344230Hand anatomy_4.jpg | 2018-09-13 19:47 | 29K | |
![[IMG]](/icons/image2.gif) | 15368680401506344230finger lat_1.jpg | 2018-09-13 19:47 | 7.8K | |
![[IMG]](/icons/image2.gif) | 15368680401506344230Hand anatomy_1.jpg | 2018-09-13 19:47 | 29K | |
![[IMG]](/icons/image2.gif) | 15368680401506344230Hand anatomy.jpg | 2018-09-13 19:47 | 29K | |
![[IMG]](/icons/image2.gif) | 1536868040AP forearm_1.jpg | 2018-09-13 19:47 | 20K | |
![[IMG]](/icons/image2.gif) | 1536868040img 10 lat elbow.jpg | 2018-09-13 19:47 | 21K | |
![[IMG]](/icons/image2.gif) | 1536868040img 9 lat elbow.jpg | 2018-09-13 19:47 | 19K | |
![[IMG]](/icons/image2.gif) | 1536868040img 8 obl wrist.jpg | 2018-09-13 19:47 | 10K | |
![[IMG]](/icons/image2.gif) | 1536868040img 7 navi.jpg | 2018-09-13 19:47 | 13K | |
![[IMG]](/icons/image2.gif) | 1536868040image 6 navi.jpg | 2018-09-13 19:47 | 13K | |
![[IMG]](/icons/image2.gif) | 1536868040AP forearm (pilot).jpg | 2018-09-13 19:47 | 12K | |
![[IMG]](/icons/image2.gif) | 1536868040lateral forearm.jpg | 2018-09-13 19:47 | 20K | |
![[IMG]](/icons/image2.gif) | 1536868040Lateral oblique elbow.jpg | 2018-09-13 19:47 | 15K | |
![[IMG]](/icons/image2.gif) | 1536868040med obl.png | 2018-09-13 19:47 | 68K | |
![[IMG]](/icons/image2.gif) | 1536868040diagram 7 lat elbow.jpg | 2018-09-13 19:47 | 22K | |
![[IMG]](/icons/image2.gif) | 1536868040diagram 7 lat elbow_1.jpg | 2018-09-13 19:47 | 22K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229Diagram 5_1.jpg | 2018-09-13 19:47 | 16K | |
![[IMG]](/icons/image2.gif) | 1536868040diagram 4 wrist.jpg | 2018-09-13 19:47 | 19K | |
![[IMG]](/icons/image2.gif) | 1536868040replacement lat wrist.png | 2018-09-13 19:47 | 24K | |
![[IMG]](/icons/image2.gif) | 1536868040diagram 3.png | 2018-09-13 19:47 | 97K | |
![[IMG]](/icons/image2.gif) | 1536868040diagram 3_1.png | 2018-09-13 19:47 | 97K | |
![[IMG]](/icons/image2.gif) | 1536868040diagram 3_2.png | 2018-09-13 19:47 | 97K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229lat pigg.jpg | 2018-09-13 19:47 | 19K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229PA pigg.jpg | 2018-09-13 19:47 | 33K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229CXR Collimation.jpg | 2018-09-13 19:47 | 65K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229sufficient lat.jpg | 2018-09-13 19:47 | 17K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229Good CXR.jpg | 2018-09-13 19:47 | 27K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229bad PA CXR 2_1.jpg | 2018-09-13 19:47 | 18K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229bad lat CXR 2.jpg | 2018-09-13 19:47 | 30K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229Bad PA CXR smaller.jpg | 2018-09-13 19:47 | 67K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229Bad lat CXR.jpg | 2018-09-13 19:47 | 25K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229PA CXR smaller.jpg | 2018-09-13 19:47 | 77K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229L Lat CXR.jpg | 2018-09-13 19:47 | 20K | |
![[IMG]](/icons/image2.gif) | 15368680401506344229Lingula.jpg | 2018-09-13 19:47 | 17K | |
![[IMG]](/icons/image2.gif) | 15368680391506344229Lungs.jpg | 2018-09-13 19:47 | 23K | |
![[IMG]](/icons/image2.gif) | 15368680391506344228Decub 02.jpg | 2018-09-13 19:47 | 59K | |
![[IMG]](/icons/image2.gif) | 15368680391506344228Decub 01.jpg | 2018-09-13 19:47 | 61K | |
![[IMG]](/icons/image2.gif) | 15368680391506344228AP erect 2.jpg | 2018-09-13 19:47 | 75K | |
![[IMG]](/icons/image2.gif) | 15368680391506344228Lat CXR.jpg | 2018-09-13 19:47 | 49K | |
![[IMG]](/icons/image2.gif) | 15368680391506344228AP erect rotation.jpg | 2018-09-13 19:47 | 46K | |
![[IMG]](/icons/image2.gif) | 15368680391506344228Image 03.jpg | 2018-09-13 19:47 | 37K | |
![[IMG]](/icons/image2.gif) | 15368680391506344228Image 02.jpg | 2018-09-13 19:47 | 20K | |
![[IMG]](/icons/image2.gif) | 15368680391506344228Image 01.jpg | 2018-09-13 19:47 | 21K | |
![[IMG]](/icons/image2.gif) | Lateral with chair in pic.png | 2018-08-31 18:00 | 74K | |
![[IMG]](/icons/image2.gif) | AP erect chin rotation.png | 2018-08-31 17:59 | 224K | |
![[IMG]](/icons/image2.gif) | good lat decub.png | 2018-08-31 17:58 | 88K | |
![[IMG]](/icons/image2.gif) | decub chest.png | 2018-08-31 17:58 | 104K | |
![[IMG]](/icons/image2.gif) | AP chest wires.png | 2018-08-31 17:57 | 397K | |
![[IMG]](/icons/image2.gif) | Lat arms not erect.png | 2018-08-31 17:57 | 116K | |
![[IMG]](/icons/image2.gif) | Pilot AP Erect.png | 2018-08-31 17:56 | 107K | |
![[IMG]](/icons/image2.gif) | Pilot 2.jpg | 2018-08-31 14:46 | 17K | |
![[IMG]](/icons/image2.gif) | mortise ankle labeling_2.jpg | 2018-08-21 14:31 | 16K | |
![[IMG]](/icons/image2.gif) | mortise ankle labeling_1.jpg | 2018-08-21 14:31 | 16K | |
![[IMG]](/icons/image2.gif) | mortise ankle labeling.jpg | 2018-08-21 14:27 | 16K | |
![[IMG]](/icons/image2.gif) | tibial plateaus.jpg | 2018-08-21 14:26 | 10K | |
![[IMG]](/icons/image2.gif) | dorsiflexed lateral ankle critique_1.jpg | 2018-08-21 14:26 | 17K | |
![[IMG]](/icons/image2.gif) | dorsiflexed lateral ankle critique.jpg | 2018-08-21 14:26 | 17K | |
![[IMG]](/icons/image2.gif) | mortise critique with dorsiflexion.jpg | 2018-08-21 14:25 | 16K | |
![[IMG]](/icons/image2.gif) | lateral ankle critique_2.jpg | 2018-08-21 14:24 | 16K | |
![[IMG]](/icons/image2.gif) | lateral ankle critique_1.jpg | 2018-08-21 14:24 | 16K | |
![[IMG]](/icons/image2.gif) | lateral ankle critique.jpg | 2018-08-21 14:23 | 16K | |
![[IMG]](/icons/image2.gif) | lateral ankle labeling.jpg | 2018-08-21 14:23 | 39K | |
![[IMG]](/icons/image2.gif) | tibfib ap labeling.jpg | 2018-08-21 14:22 | 15K | |
![[IMG]](/icons/image2.gif) | tibial tuberosity.jpg | 2018-08-21 14:22 | 11K | |
![[IMG]](/icons/image2.gif) | ap mrotise critique_2.jpg | 2018-08-21 14:21 | 10K | |
![[IMG]](/icons/image2.gif) | ap mrotise critique_1.jpg | 2018-08-21 14:21 | 10K | |
![[IMG]](/icons/image2.gif) | ap mrotise critique.jpg | 2018-08-21 14:21 | 10K | |
![[IMG]](/icons/image2.gif) | replacement lat wrist.png | 2018-08-17 17:30 | 24K | |
![[IMG]](/icons/image2.gif) | diagram 3.png | 2018-08-17 14:26 | 97K | |
![[IMG]](/icons/image2.gif) | Lat elbow (pilot).jpg | 2018-08-17 14:24 | 14K | |
![[IMG]](/icons/image2.gif) | img 9 lat elbow.jpg | 2018-08-17 14:23 | 19K | |
![[IMG]](/icons/image2.gif) | img 10 lat elbow.jpg | 2018-08-17 14:23 | 21K | |
![[IMG]](/icons/image2.gif) | diagram 7 lat elbow_1.jpg | 2018-08-17 14:21 | 22K | |
![[IMG]](/icons/image2.gif) | diagram 7 lat elbow.jpg | 2018-08-17 14:20 | 22K | |
![[IMG]](/icons/image2.gif) | diagram 3_2.png | 2018-08-17 14:18 | 97K | |
![[IMG]](/icons/image2.gif) | diagram 3_1.png | 2018-08-17 14:17 | 97K | |
![[IMG]](/icons/image2.gif) | diagram 4 wrist.jpg | 2018-08-17 14:07 | 19K | |
![[IMG]](/icons/image2.gif) | image 6 navi.jpg | 2018-08-17 14:06 | 13K | |
![[IMG]](/icons/image2.gif) | img 7 navi.jpg | 2018-08-17 14:05 | 13K | |
![[IMG]](/icons/image2.gif) | img 8 obl wrist.jpg | 2018-08-17 14:05 | 10K | |
![[IMG]](/icons/image2.gif) | AP forearm_1.jpg | 2018-08-17 14:02 | 20K | |
![[IMG]](/icons/image2.gif) | AP forearm (pilot).jpg | 2018-08-17 13:59 | 12K | |
![[IMG]](/icons/image2.gif) | lateral forearm.jpg | 2018-08-17 13:58 | 20K | |
![[IMG]](/icons/image2.gif) | Lateral oblique elbow.jpg | 2018-08-17 13:43 | 15K | |
![[IMG]](/icons/image2.gif) | med obl.png | 2018-08-17 13:36 | 68K | |
![[IMG]](/icons/image2.gif) | Picture1_10.png | 2018-07-12 19:28 | 155K | |
![[IMG]](/icons/image2.gif) | Obl SI jt underrotated.png | 2018-06-28 13:34 | 143K | |
![[IMG]](/icons/image2.gif) | AP Sacrum_1.png | 2018-06-28 12:26 | 206K | |
![[IMG]](/icons/image2.gif) | Pilot AP sacrum.png | 2018-06-28 12:16 | 144K | |
![[IMG]](/icons/image2.gif) | Pilot image 2.png | 2018-06-28 12:15 | 71K | |
![[IMG]](/icons/image2.gif) | Picture6_3.jpg | 2018-06-12 15:51 | 30K | |
![[IMG]](/icons/image2.gif) | Picture5_2.jpg | 2018-06-12 15:47 | 49K | |
![[IMG]](/icons/image2.gif) | Picture3.jpg | 2018-06-12 15:09 | 24K | |
![[IMG]](/icons/image2.gif) | Picture1_17.jpg | 2018-06-12 15:05 | 39K | |
![[IMG]](/icons/image2.gif) | Picture2_5.png | 2018-06-12 12:37 | 161K | |
![[IMG]](/icons/image2.gif) | Picture1_9.png | 2018-06-12 12:22 | 70K | |
![[IMG]](/icons/image2.gif) | 1528290058lat t-spine 2.jpg | 2018-06-06 13:00 | 43K | |
![[IMG]](/icons/image2.gif) | 1528290058Scoliosis 2.jpg | 2018-06-06 13:00 | 62K | |
![[IMG]](/icons/image2.gif) | 1528290058Obl lspine 2.jpg | 2018-06-06 13:00 | 43K | |
![[IMG]](/icons/image2.gif) | 1528290058AP lspine.jpg | 2018-06-06 13:00 | 32K | |
![[IMG]](/icons/image2.gif) | 1528290058Lat lspine.jpg | 2018-06-06 13:00 | 43K | |
![[IMG]](/icons/image2.gif) | 1528290058Lat T 3.jpg | 2018-06-06 13:00 | 27K | |
![[IMG]](/icons/image2.gif) | 1528290058Picture3_6.jpg | 2018-06-06 13:00 | 46K | |
![[IMG]](/icons/image2.gif) | 1528290058Picture3_5.jpg | 2018-06-06 13:00 | 46K | |
![[IMG]](/icons/image2.gif) | 1528290058Picture3_4.jpg | 2018-06-06 13:00 | 46K | |
![[IMG]](/icons/image2.gif) | 1528290057Picture3_3.jpg | 2018-06-06 13:00 | 46K | |
![[IMG]](/icons/image2.gif) | 1528290057Picture2_12.jpg | 2018-06-06 13:00 | 48K | |
![[IMG]](/icons/image2.gif) | 1528290057Picture2_11.jpg | 2018-06-06 13:00 | 48K | |
![[IMG]](/icons/image2.gif) | 1528290057Picture2_10.jpg | 2018-06-06 13:00 | 48K | |
![[IMG]](/icons/image2.gif) | 1528290057Picture1_13.jpg | 2018-06-06 13:00 | 61K | |
![[IMG]](/icons/image2.gif) | 1528290057Picture1_12.jpg | 2018-06-06 13:00 | 61K | |
![[IMG]](/icons/image2.gif) | 1528290057Picture1_11.jpg | 2018-06-06 13:00 | 61K | |
![[IMG]](/icons/image2.gif) | 1528290057Picture1_10.jpg | 2018-06-06 13:00 | 61K | |
![[IMG]](/icons/image2.gif) | 1528290057AP c spine_1.jpg | 2018-06-06 13:00 | 43K | |
![[IMG]](/icons/image2.gif) | 1528290057AP c spine.jpg | 2018-06-06 13:00 | 43K | |
![[IMG]](/icons/image2.gif) | 1528290057Obl diagram_1.jpg | 2018-06-06 13:00 | 56K | |
![[IMG]](/icons/image2.gif) | 1528290057lat c image.jpg | 2018-06-06 13:00 | 65K | |
![[IMG]](/icons/image2.gif) | 1528290057odontoid.jpg | 2018-06-06 13:00 | 29K | |
![[IMG]](/icons/image2.gif) | 1528290057Picture3_7.jpg | 2018-06-06 13:00 | 30K | |
![[IMG]](/icons/image2.gif) | 1528290057Picture1_15.jpg | 2018-06-06 13:00 | 75K | |
![[IMG]](/icons/image2.gif) | 1528290057Picture1_14.jpg | 2018-06-06 13:00 | 75K | |
![[IMG]](/icons/image2.gif) | 1528290057Obl diagram.jpg | 2018-06-06 13:00 | 56K | |
![[IMG]](/icons/image2.gif) | 1528290057STN.jpg | 2018-06-06 13:00 | 44K | |
![[IMG]](/icons/image2.gif) | 1528290057STN diagram_1.jpg | 2018-06-06 13:00 | 44K | |
![[IMG]](/icons/image2.gif) | 1528290057Oble c-spine.jpg | 2018-06-06 13:00 | 56K | |
![[IMG]](/icons/image2.gif) | 1528290057Lat c-spine anatomy_1.jpg | 2018-06-06 13:00 | 72K | |
![[IMG]](/icons/image2.gif) | 1528290057STN image.jpg | 2018-06-06 13:00 | 56K | |
![[IMG]](/icons/image2.gif) | 1528290057STN diagram.jpg | 2018-06-06 13:00 | 44K | |
![[IMG]](/icons/image2.gif) | 1528290057Lat c-spine anatomy.jpg | 2018-06-06 13:00 | 72K | |
![[IMG]](/icons/image2.gif) | Sternum RAO 2.jpg | 2018-05-08 18:29 | 76K | |
![[IMG]](/icons/image2.gif) | Picture2_4.png | 2018-05-04 15:59 | 299K | |
![[IMG]](/icons/image2.gif) | Picture1_8.png | 2018-05-04 15:53 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1525354525lat t-spine 2.jpg | 2018-05-03 13:35 | 43K | |
![[IMG]](/icons/image2.gif) | 1525354525Scoliosis 2.jpg | 2018-05-03 13:35 | 62K | |
![[IMG]](/icons/image2.gif) | 1525354525Obl lspine 2.jpg | 2018-05-03 13:35 | 43K | |
![[IMG]](/icons/image2.gif) | 1525354525Obl lspine.jpg | 2018-05-03 13:35 | 113K | |
![[IMG]](/icons/image2.gif) | 1525354525AP lspine.jpg | 2018-05-03 13:35 | 32K | |
![[IMG]](/icons/image2.gif) | 1525354525Lat lspine.jpg | 2018-05-03 13:35 | 43K | |
![[IMG]](/icons/image2.gif) | 1525354525Lat T 3.jpg | 2018-05-03 13:35 | 27K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture3_6.jpg | 2018-05-03 13:35 | 46K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture3_5.jpg | 2018-05-03 13:35 | 46K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture3_4.jpg | 2018-05-03 13:35 | 46K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture3_3.jpg | 2018-05-03 13:35 | 46K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture2_12.jpg | 2018-05-03 13:35 | 48K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture2_11.jpg | 2018-05-03 13:35 | 48K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture2_10.jpg | 2018-05-03 13:35 | 48K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture1_13.jpg | 2018-05-03 13:35 | 61K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture1_12.jpg | 2018-05-03 13:35 | 61K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture1_11.jpg | 2018-05-03 13:35 | 61K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture1_10.jpg | 2018-05-03 13:35 | 61K | |
![[IMG]](/icons/image2.gif) | 1525354525AP c spine_1.jpg | 2018-05-03 13:35 | 43K | |
![[IMG]](/icons/image2.gif) | 1525354525AP c spine.jpg | 2018-05-03 13:35 | 43K | |
![[IMG]](/icons/image2.gif) | 1525354525Obl diagram_1.jpg | 2018-05-03 13:35 | 56K | |
![[IMG]](/icons/image2.gif) | 1525354525lat c image.jpg | 2018-05-03 13:35 | 65K | |
![[IMG]](/icons/image2.gif) | 1525354525odontoid.jpg | 2018-05-03 13:35 | 29K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture3_7.jpg | 2018-05-03 13:35 | 30K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture1_15.jpg | 2018-05-03 13:35 | 75K | |
![[IMG]](/icons/image2.gif) | 1525354525Picture1_14.jpg | 2018-05-03 13:35 | 75K | |
![[IMG]](/icons/image2.gif) | 1525354525Obl diagram.jpg | 2018-05-03 13:35 | 56K | |
![[IMG]](/icons/image2.gif) | 1525354525STN.jpg | 2018-05-03 13:35 | 44K | |
![[IMG]](/icons/image2.gif) | 1525354525STN diagram_1.jpg | 2018-05-03 13:35 | 44K | |
![[IMG]](/icons/image2.gif) | 1525354525Oble c-spine.jpg | 2018-05-03 13:35 | 56K | |
![[IMG]](/icons/image2.gif) | 1525354525Lat c-spine anatomy_1.jpg | 2018-05-03 13:35 | 72K | |
![[IMG]](/icons/image2.gif) | 1525354524STN image.jpg | 2018-05-03 13:35 | 56K | |
![[IMG]](/icons/image2.gif) | 1525354524STN diagram.jpg | 2018-05-03 13:35 | 44K | |
![[IMG]](/icons/image2.gif) | 1525354524Lat c-spine anatomy.jpg | 2018-05-03 13:35 | 72K | |
![[IMG]](/icons/image2.gif) | Picture3_15.png | 2018-05-02 18:00 | 708K | |
![[IMG]](/icons/image2.gif) | Picture2_3.png | 2018-05-02 17:08 | 568K | |
![[IMG]](/icons/image2.gif) | Picture2_2.png | 2018-05-02 17:01 | 568K | |
![[IMG]](/icons/image2.gif) | Picture5_9.png | 2018-05-01 19:15 | 439K | |
![[IMG]](/icons/image2.gif) | Picture4_7.png | 2018-05-01 19:10 | 294K | |
![[IMG]](/icons/image2.gif) | Picture3_14.png | 2018-05-01 19:01 | 144K | |
![[IMG]](/icons/image2.gif) | Picture2_1.png | 2018-05-01 18:56 | 353K | |
![[IMG]](/icons/image2.gif) | Sternum RAO.jpg | 2018-04-25 17:51 | 66K | |
![[IMG]](/icons/image2.gif) | Ribs R obl.png.jpg | 2018-04-25 17:43 | 65K | |
![[IMG]](/icons/image2.gif) | Picture1_3.jpg | 2018-04-25 17:39 | 47K | |
![[IMG]](/icons/image2.gif) | AP Ribs2.png | 2018-04-25 17:21 | 126K | |
![[IMG]](/icons/image2.gif) | 1524597110Left SI jt obl.png | 2018-04-24 19:11 | 416K | |
![[IMG]](/icons/image2.gif) | 1524597110Right SI obl.png | 2018-04-24 19:11 | 323K | |
![[IMG]](/icons/image2.gif) | 1524597110lat coccyx.png | 2018-04-24 19:11 | 127K | |
![[IMG]](/icons/image2.gif) | 1524597110lat sacrum.png | 2018-04-24 19:11 | 169K | |
![[IMG]](/icons/image2.gif) | 1524597110ob sli joint.png | 2018-04-24 19:11 | 144K | |
![[IMG]](/icons/image2.gif) | 1524597110AP Sacrum 2.png | 2018-04-24 19:11 | 176K | |
![[IMG]](/icons/image2.gif) | 1524597110ap sacrum 3.png | 2018-04-24 19:11 | 147K | |
![[IMG]](/icons/image2.gif) | 1524597110sacral canal iamge.png | 2018-04-24 19:11 | 83K | |
![[IMG]](/icons/image2.gif) | 1524597110lat diagram.png | 2018-04-24 19:11 | 112K | |
![[IMG]](/icons/image2.gif) | 1524597110ap diagram_2.png | 2018-04-24 19:11 | 134K | |
![[IMG]](/icons/image2.gif) | 1524597110ap diagram_1.png | 2018-04-24 19:11 | 134K | |
![[IMG]](/icons/image2.gif) | 1524597110ap diagram.png | 2018-04-24 19:11 | 134K | |
![[IMG]](/icons/image2.gif) | 1524597110Ribs pilot.png | 2018-04-24 19:11 | 322K | |
![[IMG]](/icons/image2.gif) | 1524597110new.jpg | 2018-04-24 19:11 | 53K | |
![[IMG]](/icons/image2.gif) | 1524597110Picture1_8.jpg | 2018-04-24 19:11 | 79K | |
![[IMG]](/icons/image2.gif) | 15245971102 sternum.jpg | 2018-04-24 19:11 | 21K | |
![[IMG]](/icons/image2.gif) | 1524597110NEW sternum lat diag.jpg | 2018-04-24 19:11 | 30K | |
![[IMG]](/icons/image2.gif) | 1524597110SternumDia1.png | 2018-04-24 19:11 | 61K | |
![[IMG]](/icons/image2.gif) | 1524597110Picture1_3.png | 2018-04-24 19:11 | 148K | |
![[IMG]](/icons/image2.gif) | 1524597110LObl Ribs.png | 2018-04-24 19:11 | 137K | |
![[IMG]](/icons/image2.gif) | 1524597110RibDia1.png | 2018-04-24 19:11 | 26K | |
![[IMG]](/icons/image2.gif) | 1524597110xTHip.png | 2018-04-24 19:11 | 158K | |
![[IMG]](/icons/image2.gif) | 1524597110IM oblpelvis2.png | 2018-04-24 19:11 | 235K | |
![[IMG]](/icons/image2.gif) | 1524597110Frog pelvis.jpg | 2018-04-24 19:11 | 39K | |
![[IMG]](/icons/image2.gif) | 1524597110Pelvisdia2.png | 2018-04-24 19:11 | 427K | |
![[IMG]](/icons/image2.gif) | 1524597110Pelvisdia1.png | 2018-04-24 19:11 | 427K | |
![[IMG]](/icons/image2.gif) | 1524597110HIpdia3.png | 2018-04-24 19:11 | 105K | |
![[IMG]](/icons/image2.gif) | 1524597110hipdiagram2.png | 2018-04-24 19:11 | 106K | |
![[IMG]](/icons/image2.gif) | 1524597110hipdiagram1.png | 2018-04-24 19:11 | 106K | |
![[IMG]](/icons/image2.gif) | 1524597110column.png | 2018-04-24 19:11 | 234K | |
![[IMG]](/icons/image2.gif) | 1524597110IMFroghip_1.png | 2018-04-24 19:11 | 77K | |
![[IMG]](/icons/image2.gif) | 1524597110IMFroghip.png | 2018-04-24 19:11 | 77K | |
![[IMG]](/icons/image2.gif) | 1524597110Im AP Pelvis.png | 2018-04-24 19:11 | 127K | |
![[IMG]](/icons/image2.gif) | unit 2 trach exam image.png | 2018-04-24 14:01 | 180K | |
![[IMG]](/icons/image2.gif) | Unit 2 EKG exam image_2.png | 2018-04-24 13:46 | 48K | |
![[IMG]](/icons/image2.gif) | Unit 2 EKG exam image_1.png | 2018-04-24 13:45 | 48K | |
![[IMG]](/icons/image2.gif) | Unit 2 EKG exam image.png | 2018-04-24 13:44 | 48K | |
![[IMG]](/icons/image2.gif) | piggostat exam image.png | 2018-04-23 18:48 | 558K | |
![[IMG]](/icons/image2.gif) | supine test image.jpg | 2018-04-23 18:42 | 15K | |
![[IMG]](/icons/image2.gif) | 1524506854APSacrum pilot.png | 2018-04-23 18:07 | 100K | |
![[IMG]](/icons/image2.gif) | 1524506854sacrum gas.png | 2018-04-23 18:07 | 56K | |
![[IMG]](/icons/image2.gif) | 1524506854Left SI jt obl.png | 2018-04-23 18:07 | 416K | |
![[IMG]](/icons/image2.gif) | 1524506854Right SI obl.png | 2018-04-23 18:07 | 323K | |
![[IMG]](/icons/image2.gif) | 1524506854lat coccyx.png | 2018-04-23 18:07 | 127K | |
![[IMG]](/icons/image2.gif) | 1524506854lat sacrum.png | 2018-04-23 18:07 | 169K | |
![[IMG]](/icons/image2.gif) | 1524506854ob sli joint.png | 2018-04-23 18:07 | 144K | |
![[IMG]](/icons/image2.gif) | 1524506854AP Sacrum 2.png | 2018-04-23 18:07 | 176K | |
![[IMG]](/icons/image2.gif) | 1524506854ap sacrum 3.png | 2018-04-23 18:07 | 147K | |
![[IMG]](/icons/image2.gif) | 1524506853AP Sacrum.png | 2018-04-23 18:07 | 122K | |
![[IMG]](/icons/image2.gif) | 1524506853sacral canal iamge.png | 2018-04-23 18:07 | 83K | |
![[IMG]](/icons/image2.gif) | 1524506853lat diagram.png | 2018-04-23 18:07 | 112K | |
![[IMG]](/icons/image2.gif) | 1524506853ap diagram_2.png | 2018-04-23 18:07 | 134K | |
![[IMG]](/icons/image2.gif) | 1524506853ap diagram_1.png | 2018-04-23 18:07 | 134K | |
![[IMG]](/icons/image2.gif) | 1524506853ap diagram.png | 2018-04-23 18:07 | 134K | |
![[IMG]](/icons/image2.gif) | 1524506853Ribs pilot.png | 2018-04-23 18:07 | 322K | |
![[IMG]](/icons/image2.gif) | 1524506853RAO sternum pilot .png | 2018-04-23 18:07 | 82K | |
![[IMG]](/icons/image2.gif) | 1524506853new.jpg | 2018-04-23 18:07 | 53K | |
![[IMG]](/icons/image2.gif) | 1524506853Picture1_9.jpg | 2018-04-23 18:07 | 76K | |
![[IMG]](/icons/image2.gif) | 1524506853Picture1_8.jpg | 2018-04-23 18:07 | 79K | |
![[IMG]](/icons/image2.gif) | 1524506853AP RIbs.png | 2018-04-23 18:07 | 78K | |
![[IMG]](/icons/image2.gif) | 15245068532 sternum.jpg | 2018-04-23 18:07 | 21K | |
![[IMG]](/icons/image2.gif) | 1524506853NEW sternum lat diag.jpg | 2018-04-23 18:07 | 30K | |
![[IMG]](/icons/image2.gif) | 1524506853SternumDia1.png | 2018-04-23 18:07 | 61K | |
![[IMG]](/icons/image2.gif) | 1524506853Picture1_3.png | 2018-04-23 18:07 | 148K | |
![[IMG]](/icons/image2.gif) | 1524506853RAOSternumIMAGE.png | 2018-04-23 18:07 | 177K | |
![[IMG]](/icons/image2.gif) | 1524506853LObl Ribs.png | 2018-04-23 18:07 | 137K | |
![[IMG]](/icons/image2.gif) | 1524506853RibDia1.png | 2018-04-23 18:07 | 26K | |
![[IMG]](/icons/image2.gif) | 1524506853AP Ribs1.png | 2018-04-23 18:07 | 94K | |
![[IMG]](/icons/image2.gif) | 1524506853xTHip.png | 2018-04-23 18:07 | 158K | |
![[IMG]](/icons/image2.gif) | 1524506853IM oblpelvis2.png | 2018-04-23 18:07 | 235K | |
![[IMG]](/icons/image2.gif) | 1524506853Frog pelvis.jpg | 2018-04-23 18:07 | 39K | |
![[IMG]](/icons/image2.gif) | 1524506853Pelvisdia2.png | 2018-04-23 18:07 | 427K | |
![[IMG]](/icons/image2.gif) | 1524506853Pelvisdia1.png | 2018-04-23 18:07 | 427K | |
![[IMG]](/icons/image2.gif) | 1524506853HIpdia3.png | 2018-04-23 18:07 | 105K | |
![[IMG]](/icons/image2.gif) | 1524506853hipdiagram2.png | 2018-04-23 18:07 | 106K | |
![[IMG]](/icons/image2.gif) | 1524506853hipdiagram1.png | 2018-04-23 18:07 | 106K | |
![[IMG]](/icons/image2.gif) | 1524506852column.png | 2018-04-23 18:07 | 234K | |
![[IMG]](/icons/image2.gif) | 1524506852IMFroghip_1.png | 2018-04-23 18:07 | 77K | |
![[IMG]](/icons/image2.gif) | 1524506852IMFroghip.png | 2018-04-23 18:07 | 77K | |
![[IMG]](/icons/image2.gif) | 1524506852Im AP Pelvis.png | 2018-04-23 18:07 | 127K | |
![[IMG]](/icons/image2.gif) | Elbow - Olecranon Process.jpg | 2018-04-06 12:39 | 22K | |
![[IMG]](/icons/image2.gif) | Foot - 1st Cuneiform.jpg | 2018-04-04 00:45 | 29K | |
![[IMG]](/icons/image2.gif) | Lat. Tib.Fib - Image Critique.jpg | 2018-04-04 00:15 | 12K | |
![[IMG]](/icons/image2.gif) | Lat. Ankle - Talus.jpg | 2018-04-04 00:10 | 26K | |
![[IMG]](/icons/image2.gif) | Non-Trauma Ext. Shoulder - Acromion.jpg | 2018-04-03 23:42 | 34K | |
![[IMG]](/icons/image2.gif) | Non-Trauma Ext. Shoulder - Glenoid.jpg | 2018-04-03 23:38 | 32K | |
![[IMG]](/icons/image2.gif) | Non-Trauma Ext. Shoulder - coracoid.jpg | 2018-04-03 23:35 | 36K | |
![[IMG]](/icons/image2.gif) | Non-Trauma Ext Shoulder - Image Critique.jpg | 2018-04-03 23:32 | 26K | |
![[IMG]](/icons/image2.gif) | Lateral Scapula - Image Critique.jpg | 2018-04-03 23:23 | 28K | |
![[IMG]](/icons/image2.gif) | Elbow - Coronoid.jpg | 2018-04-03 23:13 | 29K | |
![[IMG]](/icons/image2.gif) | Foot Cuboid.jpg | 2018-04-03 23:09 | 27K | |
![[IMG]](/icons/image2.gif) | Oblique Foot - Image Critique.jpg | 2018-04-02 19:49 | 22K | |
![[IMG]](/icons/image2.gif) | Thumb - Metacarpophalangeal Joint_1.jpg | 2018-04-02 19:46 | 11K | |
![[IMG]](/icons/image2.gif) | Thumb - Metacarpophalangeal Joint.jpg | 2018-04-02 19:44 | 11K | |
![[IMG]](/icons/image2.gif) | 2nd Digit (finger) - Proximal Interphalangeal Joint.jpg | 2018-04-02 19:42 | 15K | |
![[IMG]](/icons/image2.gif) | Medial Obl. Elbow Image Critique.jpg | 2018-04-02 19:37 | 21K | |
![[IMG]](/icons/image2.gif) | Lateral Elbow - Cornoid Fossa.jpg | 2018-04-02 19:33 | 27K | |
![[IMG]](/icons/image2.gif) | Elbow - Radius.jpg | 2018-04-02 19:31 | 18K | |
![[IMG]](/icons/image2.gif) | Elbow - Medial Epicondyle.jpg | 2018-04-02 19:29 | 19K | |
![[IMG]](/icons/image2.gif) | Elbow - Capitulum.jpg | 2018-04-02 19:28 | 17K | |
![[IMG]](/icons/image2.gif) | Humerus - Anatomy_1.jpg | 2018-04-02 19:23 | 14K | |
![[IMG]](/icons/image2.gif) | Humerus - Anatomy.jpg | 2018-04-02 19:21 | 14K | |
![[IMG]](/icons/image2.gif) | Lateral Femur - Image Critique.jpg | 2018-04-02 16:11 | 13K | |
![[IMG]](/icons/image2.gif) | Lateral Femur - Lesser Trochanter.jpg | 2018-04-02 16:08 | 14K | |
![[IMG]](/icons/image2.gif) | Lateral Femur - Greater Trochanter.jpg | 2018-04-02 16:04 | 18K | |
![[IMG]](/icons/image2.gif) | Lateral Knee - Image Critique.jpg | 2018-04-02 15:57 | 17K | |
![[IMG]](/icons/image2.gif) | Lat. Oblique Knee - Image Critique_1.jpg | 2018-04-02 15:12 | 19K | |
![[IMG]](/icons/image2.gif) | Lat. Oblique Knee - Image Critique.jpg | 2018-04-02 15:10 | 19K | |
![[IMG]](/icons/image2.gif) | AP Knee - Image Critique.jpg | 2018-04-02 15:08 | 21K | |
![[IMG]](/icons/image2.gif) | Knee.jpg | 2018-04-02 14:59 | 26K | |
![[IMG]](/icons/image2.gif) | Axillary Shoulder Acromion.jpg | 2018-04-02 14:57 | 14K | |
![[IMG]](/icons/image2.gif) | Axillary Shoulder Coracoid_1.jpg | 2018-04-02 14:56 | 15K | |
![[IMG]](/icons/image2.gif) | Foot.jpg | 2018-04-02 14:50 | 32K | |
![[IMG]](/icons/image2.gif) | Axillary Shoulder.jpg | 2018-04-02 14:47 | 13K | |
![[IMG]](/icons/image2.gif) | Foot Navicular.png | 2017-12-20 18:28 | 87K | |
![[IMG]](/icons/image2.gif) | Acromion.png | 2017-12-20 17:42 | 46K | |
![[IMG]](/icons/image2.gif) | Greater tubercle.png | 2017-12-20 17:33 | 63K | |
![[IMG]](/icons/image2.gif) | Trochlea.jpg | 2017-12-20 17:27 | 7.8K | |
![[IMG]](/icons/image2.gif) | Coronoid Process.png | 2017-12-20 17:11 | 88K | |
![[IMG]](/icons/image2.gif) | Scaphoid.png | 2017-12-20 17:01 | 20K | |
![[IMG]](/icons/image2.gif) | pa mand.png | 2017-12-12 20:46 | 2.0M | |
![[IMG]](/icons/image2.gif) | picture 03.jpg | 2017-11-30 13:46 | 16K | |
![[IMG]](/icons/image2.gif) | stupid picture.png | 2017-11-17 20:50 | 158K | |
![[IMG]](/icons/image2.gif) | decub baby.png | 2017-11-17 19:33 | 86K | |
![[IMG]](/icons/image2.gif) | ABD2_1.png | 2017-11-15 18:01 | 111K | |
![[IMG]](/icons/image2.gif) | ABD2.png | 2017-11-15 17:57 | 111K | |
![[IMG]](/icons/image2.gif) | ap foot.png | 2017-10-25 18:20 | 76K | |
![[IMG]](/icons/image2.gif) | heel.png | 2017-10-25 17:40 | 36K | |
![[IMG]](/icons/image2.gif) | toes obl.png | 2017-10-25 15:52 | 193K | |
![[IMG]](/icons/image2.gif) | toe.png | 2017-10-25 14:17 | 28K | |
![[IMG]](/icons/image2.gif) | lat.png | 2017-10-25 14:11 | 259K | |
![[IMG]](/icons/image2.gif) | tarsal_1.png | 2017-10-25 13:45 | 212K | |
![[IMG]](/icons/image2.gif) | tarsal.png | 2017-10-25 13:44 | 212K | |
![[IMG]](/icons/image2.gif) | Picture1_7.png | 2017-10-16 17:06 | 259K | |
![[IMG]](/icons/image2.gif) | Picture2_14_1.jpg | 2017-10-06 18:58 | 83K | |
![[IMG]](/icons/image2.gif) | Towne Bad_1.png | 2017-10-06 18:49 | 60K | |
![[IMG]](/icons/image2.gif) | 7_1.png | 2017-10-06 18:44 | 108K | |
![[IMG]](/icons/image2.gif) | lateral_1.png | 2017-10-06 18:39 | 122K | |
![[IMG]](/icons/image2.gif) | yeagles_1.png | 2017-10-06 18:20 | 29K | |
![[IMG]](/icons/image2.gif) | waters_1.png | 2017-10-06 18:17 | 118K | |
![[IMG]](/icons/image2.gif) | Picture7_3.png | 2017-10-06 18:15 | 563K | |
![[IMG]](/icons/image2.gif) | Picture6_1_1.png | 2017-10-06 18:06 | 917K | |
![[IMG]](/icons/image2.gif) | Lat obl elbow.jpg | 2017-10-03 13:58 | 34K | |
![[IMG]](/icons/image2.gif) | ulna.png | 2017-09-28 14:13 | 30K | |
![[IMG]](/icons/image2.gif) | finger.png | 2017-09-28 14:09 | 40K | |
![[IMG]](/icons/image2.gif) | child.png | 2017-09-28 13:58 | 62K | |
![[IMG]](/icons/image2.gif) | boxer.png | 2017-09-28 13:57 | 57K | |
![[IMG]](/icons/image2.gif) | hand rot.png | 2017-09-28 12:44 | 78K | |
![[IMG]](/icons/image2.gif) | Picture7_2.png | 2017-09-25 16:29 | 232K | |
![[IMG]](/icons/image2.gif) | Picture6_2.jpg | 2017-09-25 16:23 | 15K | |
![[IMG]](/icons/image2.gif) | 1506344230hand_20w_20nail.jpg | 2017-09-25 16:14 | 35K | |
![[IMG]](/icons/image2.gif) | Picture3_13.png | 2017-09-25 16:06 | 45K | |
![[IMG]](/icons/image2.gif) | Picture2.png | 2017-09-25 14:53 | 179K | |
![[IMG]](/icons/image2.gif) | 1506344230hand lat rotation.jpg | 2017-09-25 12:57 | 27K | |
![[IMG]](/icons/image2.gif) | 1506344230Finger pa collimation.jpg | 2017-09-25 12:57 | 27K | |
![[IMG]](/icons/image2.gif) | 1506344230Finger PA marker.jpg | 2017-09-25 12:57 | 18K | |
![[IMG]](/icons/image2.gif) | 1506344230hand obl.jpg | 2017-09-25 12:57 | 28K | |
![[IMG]](/icons/image2.gif) | 1506344230hand w nail.jpg | 2017-09-25 12:57 | 35K | |
![[IMG]](/icons/image2.gif) | 1506344230finger lat bad.jpg | 2017-09-25 12:57 | 26K | |
![[IMG]](/icons/image2.gif) | 1506344230Hand lat 2.jpg | 2017-09-25 12:57 | 44K | |
![[IMG]](/icons/image2.gif) | 1506344230thumb ap.jpg | 2017-09-25 12:57 | 40K | |
![[IMG]](/icons/image2.gif) | 1506344230Hand anatomy_2.jpg | 2017-09-25 12:57 | 29K | |
![[IMG]](/icons/image2.gif) | 1506344230thumb obl.jpg | 2017-09-25 12:57 | 11K | |
![[IMG]](/icons/image2.gif) | 1506344230thumb ap_1.jpg | 2017-09-25 12:57 | 40K | |
![[IMG]](/icons/image2.gif) | 1506344230Hand anatomy_3.jpg | 2017-09-25 12:57 | 29K | |
![[IMG]](/icons/image2.gif) | 1506344230Hand anatomy_4.jpg | 2017-09-25 12:57 | 29K | |
![[IMG]](/icons/image2.gif) | 1506344230finger lat_1.jpg | 2017-09-25 12:57 | 7.8K | |
![[IMG]](/icons/image2.gif) | 1506344230Hand anatomy_1.jpg | 2017-09-25 12:57 | 29K | |
![[IMG]](/icons/image2.gif) | 1506344230Hand anatomy.jpg | 2017-09-25 12:57 | 29K | |
![[IMG]](/icons/image2.gif) | 1506344229Diagram 5_1.jpg | 2017-09-25 12:57 | 16K | |
![[IMG]](/icons/image2.gif) | 1506344229lat pigg.jpg | 2017-09-25 12:57 | 19K | |
![[IMG]](/icons/image2.gif) | 1506344229PA pigg.jpg | 2017-09-25 12:57 | 33K | |
![[IMG]](/icons/image2.gif) | 1506344229CXR Collimation.jpg | 2017-09-25 12:57 | 65K | |
![[IMG]](/icons/image2.gif) | 1506344229sufficient lat.jpg | 2017-09-25 12:57 | 17K | |
![[IMG]](/icons/image2.gif) | 1506344229Good CXR.jpg | 2017-09-25 12:57 | 27K | |
![[IMG]](/icons/image2.gif) | 1506344229bad PA CXR 2_1.jpg | 2017-09-25 12:57 | 18K | |
![[IMG]](/icons/image2.gif) | 1506344229bad lat CXR 2.jpg | 2017-09-25 12:57 | 30K | |
![[IMG]](/icons/image2.gif) | 1506344229Bad PA CXR smaller.jpg | 2017-09-25 12:57 | 67K | |
![[IMG]](/icons/image2.gif) | 1506344229Bad lat CXR.jpg | 2017-09-25 12:57 | 25K | |
![[IMG]](/icons/image2.gif) | 1506344229PA CXR smaller.jpg | 2017-09-25 12:57 | 77K | |
![[IMG]](/icons/image2.gif) | 1506344229L Lat CXR.jpg | 2017-09-25 12:57 | 20K | |
![[IMG]](/icons/image2.gif) | 1506344229Lingula.jpg | 2017-09-25 12:57 | 17K | |
![[IMG]](/icons/image2.gif) | 1506344229Lungs.jpg | 2017-09-25 12:57 | 23K | |
![[IMG]](/icons/image2.gif) | 1506344228Decub 02.jpg | 2017-09-25 12:57 | 59K | |
![[IMG]](/icons/image2.gif) | 1506344228Decub 01.jpg | 2017-09-25 12:57 | 61K | |
![[IMG]](/icons/image2.gif) | 1506344228AP erect 2.jpg | 2017-09-25 12:57 | 75K | |
![[IMG]](/icons/image2.gif) | 1506344228Lat CXR.jpg | 2017-09-25 12:57 | 49K | |
![[IMG]](/icons/image2.gif) | 1506344228AP erect rotation.jpg | 2017-09-25 12:57 | 46K | |
![[IMG]](/icons/image2.gif) | 1506344228Image 03.jpg | 2017-09-25 12:57 | 37K | |
![[IMG]](/icons/image2.gif) | 1506344228Image 02.jpg | 2017-09-25 12:57 | 20K | |
![[IMG]](/icons/image2.gif) | 1506344228Image 01.jpg | 2017-09-25 12:57 | 21K | |
![[IMG]](/icons/image2.gif) | PA CXR smaller.jpg | 2017-09-15 14:37 | 77K | |
![[IMG]](/icons/image2.gif) | Pilot 4 test image.png | 2017-08-03 17:39 | 54K | |
![[IMG]](/icons/image2.gif) | Pilot 3 test image.png | 2017-08-03 17:39 | 106K | |
![[IMG]](/icons/image2.gif) | Pilot - Lateral stomach test image.png | 2017-07-21 15:53 | 47K | |
![[IMG]](/icons/image2.gif) | Pilot - Scout test image.png | 2017-07-21 15:50 | 33K | |
![[IMG]](/icons/image2.gif) | sacrum gas.png | 2017-06-15 14:32 | 56K | |
![[IMG]](/icons/image2.gif) | APSacrum pilot.png | 2017-05-23 17:19 | 100K | |
![[IMG]](/icons/image2.gif) | Left SI jt obl.png | 2017-05-23 16:43 | 416K | |
![[IMG]](/icons/image2.gif) | Right SI obl.png | 2017-05-23 16:36 | 323K | |
![[IMG]](/icons/image2.gif) | wrist fracture.png | 2017-03-27 22:29 | 33K | |
![[IMG]](/icons/image2.gif) | fractured clavicle.jpg | 2017-03-27 22:26 | 11K | |
![[IMG]](/icons/image2.gif) | Ribs pilot.png | 2017-03-08 15:59 | 322K | |
![[IMG]](/icons/image2.gif) | RAO sternum pilot .png | 2017-03-08 15:54 | 82K | |
![[IMG]](/icons/image2.gif) | Scapula.png | 2017-02-14 20:52 | 89K | |
![[IMG]](/icons/image2.gif) | clavicle.png | 2017-02-14 20:44 | 127K | |
![[IMG]](/icons/image2.gif) | ap axial clavicle test image.png | 2017-02-14 17:30 | 45K | |
![[IMG]](/icons/image2.gif) | odontoid with arrows rotation.png | 2017-02-03 18:22 | 169K | |
![[IMG]](/icons/image2.gif) | odontoid.png | 2017-02-03 18:14 | 107K | |
![[IMG]](/icons/image2.gif) | pilot 5.jpg | 2017-01-20 20:49 | 19K | |
![[IMG]](/icons/image2.gif) | Pilot 6.jpg | 2017-01-20 20:48 | 20K | |
![[IMG]](/icons/image2.gif) | 1483549285gm.png | 2017-01-04 17:01 | 135K | |
![[IMG]](/icons/image2.gif) | 1483549284carm.jpg | 2017-01-04 17:01 | 13K | |
![[IMG]](/icons/image2.gif) | 1483549284bucky slot.jpg | 2017-01-04 17:01 | 37K | |
![[IMG]](/icons/image2.gif) | 1483549284cone.jpg | 2017-01-04 17:01 | 42K | |
![[IMG]](/icons/image2.gif) | 1483549284scatter.png | 2017-01-04 17:01 | 558K | |
![[IMG]](/icons/image2.gif) | 1483549284PBL.jpg | 2017-01-04 17:01 | 36K | |
![[IMG]](/icons/image2.gif) | 1483549284piggostat.jpg | 2017-01-04 17:01 | 30K | |
![[IMG]](/icons/image2.gif) | Knee Pilot 6.png | 2016-12-20 16:30 | 57K | |
![[IMG]](/icons/image2.gif) | Knee Pilot 5.png | 2016-12-20 16:26 | 14K | |
![[IMG]](/icons/image2.gif) | Picture3_10.jpg | 2016-12-16 14:31 | 36K | |
![[IMG]](/icons/image2.gif) | Picture2_15.jpg | 2016-12-16 14:10 | 22K | |
![[IMG]](/icons/image2.gif) | Picture1_16.jpg | 2016-12-16 14:05 | 29K | |
![[IMG]](/icons/image2.gif) | critical thinking.jpg | 2016-12-16 13:58 | 25K | |
![[IMG]](/icons/image2.gif) | Picture2_14.jpg | 2016-11-23 20:26 | 83K | |
![[IMG]](/icons/image2.gif) | Picture1_6.png | 2016-11-23 20:23 | 314K | |
![[IMG]](/icons/image2.gif) | yeagles.png | 2016-10-27 14:31 | 29K | |
![[IMG]](/icons/image2.gif) | waters.png | 2016-10-27 14:30 | 118K | |
![[IMG]](/icons/image2.gif) | MRA_2.jpg | 2016-10-25 20:10 | 63K | |
![[IMG]](/icons/image2.gif) | MRA_1.jpg | 2016-10-25 20:09 | 63K | |
![[IMG]](/icons/image2.gif) | MRA.jpg | 2016-10-25 20:08 | 63K | |
![[IMG]](/icons/image2.gif) | AP erect.jpg | 2016-10-24 14:08 | 86K | |
![[IMG]](/icons/image2.gif) | Towne Bad.png | 2016-10-17 17:39 | 60K | |
![[IMG]](/icons/image2.gif) | skull lat.jpg | 2016-10-17 17:35 | 35K | |
![[IMG]](/icons/image2.gif) | Test image 2.jpg | 2016-09-30 17:05 | 40K | |
![[IMG]](/icons/image2.gif) | Hand lat 2.jpg | 2016-09-15 13:34 | 44K | |
![[IMG]](/icons/image2.gif) | Picture3_8.jpg | 2016-09-14 18:32 | 44K | |
![[IMG]](/icons/image2.gif) | RAO esoph_1.png | 2016-09-09 19:45 | 149K | |
![[IMG]](/icons/image2.gif) | RAO esoph.png | 2016-09-09 19:40 | 149K | |
![[IMG]](/icons/image2.gif) | lat pigg.jpg | 2016-09-06 14:21 | 19K | |
![[IMG]](/icons/image2.gif) | PA pigg.jpg | 2016-09-06 13:53 | 33K | |
![[IMG]](/icons/image2.gif) | CXR Collimation.jpg | 2016-09-01 15:02 | 65K | |
![[IMG]](/icons/image2.gif) | CXR image.jpg | 2016-09-01 14:33 | 48K | |
![[IMG]](/icons/image2.gif) | curves_2.jpg | 2016-07-20 13:49 | 72K | |
![[IMG]](/icons/image2.gif) | lat c image.jpg | 2016-06-30 12:41 | 65K | |
![[IMG]](/icons/image2.gif) | odontoid.jpg | 2016-06-30 12:39 | 29K | |
![[IMG]](/icons/image2.gif) | AP c spine_1.jpg | 2016-06-30 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | AP c spine.jpg | 2016-06-30 12:02 | 43K | |
![[IMG]](/icons/image2.gif) | Obl diagram_1.jpg | 2016-06-29 19:38 | 56K | |
![[IMG]](/icons/image2.gif) | Picture3_7.jpg | 2016-06-29 19:19 | 30K | |
![[IMG]](/icons/image2.gif) | Picture1_15.jpg | 2016-06-29 19:11 | 75K | |
![[IMG]](/icons/image2.gif) | Picture1_14.jpg | 2016-06-29 19:11 | 75K | |
![[IMG]](/icons/image2.gif) | Obl diagram.jpg | 2016-06-29 12:10 | 56K | |
![[IMG]](/icons/image2.gif) | STN.jpg | 2016-06-28 13:33 | 44K | |
![[IMG]](/icons/image2.gif) | STN diagram_1.jpg | 2016-06-28 13:27 | 44K | |
![[IMG]](/icons/image2.gif) | Oble c-spine.jpg | 2016-06-28 12:43 | 56K | |
![[IMG]](/icons/image2.gif) | Lat c-spine anatomy_1.jpg | 2016-06-28 12:23 | 72K | |
![[IMG]](/icons/image2.gif) | Lat 3.jpg | 2016-06-28 12:19 | 69K | |
![[IMG]](/icons/image2.gif) | Scoliosis 2.jpg | 2016-06-10 12:23 | 62K | |
![[IMG]](/icons/image2.gif) | Lat T 3.jpg | 2016-06-07 12:57 | 27K | |
![[IMG]](/icons/image2.gif) | Frog pelvis.jpg | 2016-05-19 12:38 | 39K | |
![[IMG]](/icons/image2.gif) | STN image.jpg | 2016-05-12 19:31 | 56K | |
![[IMG]](/icons/image2.gif) | STN diagram.jpg | 2016-05-12 19:08 | 44K | |
![[IMG]](/icons/image2.gif) | Lat c-spine anatomy.jpg | 2016-05-12 19:01 | 72K | |
![[IMG]](/icons/image2.gif) | lat t-spine 2.jpg | 2016-05-10 16:34 | 43K | |
![[IMG]](/icons/image2.gif) | scoliosis.jpg | 2016-05-10 16:16 | 36K | |
![[IMG]](/icons/image2.gif) | Obl lspine 2.jpg | 2016-05-10 15:22 | 43K | |
![[IMG]](/icons/image2.gif) | Obl lspine.jpg | 2016-05-10 15:15 | 113K | |
![[IMG]](/icons/image2.gif) | AP lspine.jpg | 2016-05-10 15:10 | 32K | |
![[IMG]](/icons/image2.gif) | Lat lspine.jpg | 2016-05-10 15:04 | 43K | |
![[IMG]](/icons/image2.gif) | Picture3_6.jpg | 2016-05-10 14:50 | 46K | |
![[IMG]](/icons/image2.gif) | Picture3_5.jpg | 2016-05-10 14:47 | 46K | |
![[IMG]](/icons/image2.gif) | Picture3_4.jpg | 2016-05-10 14:43 | 46K | |
![[IMG]](/icons/image2.gif) | Picture3_3.jpg | 2016-05-10 14:41 | 46K | |
![[IMG]](/icons/image2.gif) | Picture2_12.jpg | 2016-05-10 14:36 | 48K | |
![[IMG]](/icons/image2.gif) | Picture2_11.jpg | 2016-05-10 14:35 | 48K | |
![[IMG]](/icons/image2.gif) | Picture2_10.jpg | 2016-05-10 14:33 | 48K | |
![[IMG]](/icons/image2.gif) | Picture1_13.jpg | 2016-05-10 14:32 | 61K | |
![[IMG]](/icons/image2.gif) | Picture1_12.jpg | 2016-05-10 14:29 | 61K | |
![[IMG]](/icons/image2.gif) | Picture1_11.jpg | 2016-05-10 14:29 | 61K | |
![[IMG]](/icons/image2.gif) | Picture1_10.jpg | 2016-05-10 14:28 | 61K | |
![[IMG]](/icons/image2.gif) | new.jpg | 2016-05-05 17:46 | 53K | |
![[IMG]](/icons/image2.gif) | Picture1_9.jpg | 2016-05-04 19:18 | 76K | |
![[IMG]](/icons/image2.gif) | Picture1_8.jpg | 2016-05-04 19:07 | 79K | |
![[IMG]](/icons/image2.gif) | AP RIbs.png | 2016-05-03 19:38 | 78K | |
![[IMG]](/icons/image2.gif) | 2 sternum.jpg | 2016-05-03 14:08 | 21K | |
![[IMG]](/icons/image2.gif) | NEW sternum lat diag.jpg | 2016-05-03 14:05 | 30K | |
![[IMG]](/icons/image2.gif) | IMG_4375.JPG | 2016-04-19 18:16 | 2.2M | |
![[IMG]](/icons/image2.gif) | Med vs Lat oblique_1.png | 2016-04-18 17:08 | 132K | |
![[IMG]](/icons/image2.gif) | IMG_4374.JPG | 2016-04-18 15:34 | 37K | |
![[IMG]](/icons/image2.gif) | carm.jpg | 2016-03-21 14:46 | 13K | |
![[IMG]](/icons/image2.gif) | bucky slot.jpg | 2016-03-21 14:43 | 37K | |
![[IMG]](/icons/image2.gif) | cone.jpg | 2016-03-18 15:06 | 42K | |
![[IMG]](/icons/image2.gif) | piggostat.jpg | 2016-03-18 15:03 | 30K | |
![[IMG]](/icons/image2.gif) | PBL.jpg | 2016-03-09 16:57 | 36K | |
![[IMG]](/icons/image2.gif) | KUB.jpg | 2016-03-01 19:41 | 44K | |
![[IMG]](/icons/image2.gif) | keofeed.jpg | 2016-03-01 19:37 | 13K | |
![[IMG]](/icons/image2.gif) | 40_1.jpg | 2016-01-22 18:22 | 20K | |
![[IMG]](/icons/image2.gif) | 25.jpg | 2016-01-22 16:10 | 19K | |
![[IMG]](/icons/image2.gif) | 16_1.jpg | 2016-01-20 16:23 | 12K | |
![[IMG]](/icons/image2.gif) | 18.jpg | 2016-01-20 16:19 | 14K | |
![[IMG]](/icons/image2.gif) | 48.jpg | 2016-01-08 18:22 | 28K | |
![[IMG]](/icons/image2.gif) | 39, 41, 43, 46_3.jpg | 2016-01-08 18:22 | 6.6K | |
![[IMG]](/icons/image2.gif) | 39, 41, 43, 46_2.jpg | 2016-01-08 18:21 | 6.6K | |
![[IMG]](/icons/image2.gif) | 40.jpg | 2016-01-08 18:21 | 19K | |
![[IMG]](/icons/image2.gif) | 39, 41, 43, 46.jpg | 2016-01-08 18:20 | 6.6K | |
![[IMG]](/icons/image2.gif) | 28, 30, 35_2.jpg | 2016-01-08 18:20 | 18K | |
![[IMG]](/icons/image2.gif) | 36.jpg | 2016-01-08 18:19 | 13K | |
![[IMG]](/icons/image2.gif) | 33.jpg | 2016-01-08 18:18 | 24K | |
![[IMG]](/icons/image2.gif) | 28, 30, 35_1.jpg | 2016-01-08 18:18 | 18K | |
![[IMG]](/icons/image2.gif) | 28, 30, 35.jpg | 2016-01-08 18:18 | 18K | |
![[IMG]](/icons/image2.gif) | 26.jpg | 2016-01-08 18:17 | 21K | |
![[IMG]](/icons/image2.gif) | 22.jpg | 2016-01-08 18:16 | 28K | |
![[IMG]](/icons/image2.gif) | 14.jpg | 2016-01-08 18:01 | 17K | |
![[IMG]](/icons/image2.gif) | lat knee labeling_2.png | 2016-01-08 17:09 | 91K | |
![[IMG]](/icons/image2.gif) | comminuted.jpg | 2016-01-06 16:47 | 11K | |
![[IMG]](/icons/image2.gif) | impacted.jpg | 2016-01-06 16:46 | 11K | |
![[IMG]](/icons/image2.gif) | fx_2.jpg | 2016-01-06 16:42 | 39K | |
![[IMG]](/icons/image2.gif) | fx_1.jpg | 2016-01-06 15:44 | 39K | |
![[IMG]](/icons/image2.gif) | fx.jpg | 2016-01-06 15:42 | 39K | |
![[IMG]](/icons/image2.gif) | regions.jpg | 2016-01-06 15:28 | 42K | |
![[IMG]](/icons/image2.gif) | curves_1.jpg | 2016-01-06 14:25 | 72K | |
![[IMG]](/icons/image2.gif) | curves.jpg | 2016-01-06 14:23 | 72K | |
![[IMG]](/icons/image2.gif) | AP scapula.jpg | 2016-01-05 20:09 | 56K | |
![[IMG]](/icons/image2.gif) | scapula 01_1.jpg | 2016-01-05 20:04 | 61K | |
![[IMG]](/icons/image2.gif) | scapula 01.jpg | 2016-01-05 19:52 | 61K | |
![[IMG]](/icons/image2.gif) | scapula 02.jpg | 2016-01-05 19:51 | 41K | |
![[IMG]](/icons/image2.gif) | clavilce axial.jpg | 2016-01-05 19:33 | 52K | |
![[IMG]](/icons/image2.gif) | AC jt w weight.jpg | 2016-01-05 19:28 | 59K | |
![[IMG]](/icons/image2.gif) | Picture1_7.jpg | 2016-01-05 15:30 | 21K | |
![[IMG]](/icons/image2.gif) | Figure 4_10.png | 2015-12-07 16:06 | 158K | |
![[IMG]](/icons/image2.gif) | 1448457897foot d.png | 2015-11-25 13:24 | 243K | |
![[IMG]](/icons/image2.gif) | 1448457897Picture1_5.png | 2015-11-25 13:24 | 107K | |
![[IMG]](/icons/image2.gif) | 1448457897Picture6_1.jpg | 2015-11-25 13:24 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457897Picture5_1.jpg | 2015-11-25 13:24 | 20K | |
![[IMG]](/icons/image2.gif) | 1448457897Picture5.jpg | 2015-11-25 13:24 | 20K | |
![[IMG]](/icons/image2.gif) | 1448457897Picture2_7.jpg | 2015-11-25 13:24 | 21K | |
![[IMG]](/icons/image2.gif) | 1448457897Picture2_6.jpg | 2015-11-25 13:24 | 21K | |
![[IMG]](/icons/image2.gif) | 1448457897Picture1_2.jpg | 2015-11-25 13:24 | 14K | |
![[IMG]](/icons/image2.gif) | 1448457897Picture1_1.jpg | 2015-11-25 13:24 | 14K | |
![[IMG]](/icons/image2.gif) | 1448457896lat foot img_2.jpg | 2015-11-25 13:24 | 19K | |
![[IMG]](/icons/image2.gif) | 1448457896lat foot img_1.jpg | 2015-11-25 13:24 | 19K | |
![[IMG]](/icons/image2.gif) | 1448457896lat foot img.jpg | 2015-11-25 13:24 | 19K | |
![[IMG]](/icons/image2.gif) | 1448457896heel img anatomy_1.jpg | 2015-11-25 13:24 | 9.6K | |
![[IMG]](/icons/image2.gif) | 1448457896heel img anatomy.jpg | 2015-11-25 13:24 | 9.6K | |
![[IMG]](/icons/image2.gif) | 1448457896oblique img anatomy B.jpg | 2015-11-25 13:24 | 14K | |
![[IMG]](/icons/image2.gif) | 1448457896oblique img anatomy A.jpg | 2015-11-25 13:24 | 19K | |
![[IMG]](/icons/image2.gif) | 1448457896diagram 1_1.jpg | 2015-11-25 13:24 | 28K | |
![[IMG]](/icons/image2.gif) | 1448457896diagram 1.jpg | 2015-11-25 13:24 | 28K | |
![[IMG]](/icons/image2.gif) | 1448457896foot movement_1.jpg | 2015-11-25 13:24 | 22K | |
![[IMG]](/icons/image2.gif) | 1448457896foot movement.jpg | 2015-11-25 13:24 | 22K | |
![[IMG]](/icons/image2.gif) | 14484578962 tibs.jpg | 2015-11-25 13:24 | 13K | |
![[IMG]](/icons/image2.gif) | 1448457896ap ank.jpg | 2015-11-25 13:24 | 47K | |
![[IMG]](/icons/image2.gif) | 1448457896lat ankle no r_1.jpg | 2015-11-25 13:24 | 38K | |
![[IMG]](/icons/image2.gif) | 1448457896lat ankle no r.jpg | 2015-11-25 13:24 | 38K | |
![[IMG]](/icons/image2.gif) | 1448457896lat ankle r_2.jpg | 2015-11-25 13:24 | 34K | |
![[IMG]](/icons/image2.gif) | 1448457896lat ankle r_1.jpg | 2015-11-25 13:24 | 34K | |
![[IMG]](/icons/image2.gif) | 1448457896lat ankle r.jpg | 2015-11-25 13:24 | 34K | |
![[IMG]](/icons/image2.gif) | 1448457896prox tib_1.jpg | 2015-11-25 13:24 | 9.3K | |
![[IMG]](/icons/image2.gif) | 1448457896prox tib.jpg | 2015-11-25 13:24 | 9.3K | |
![[IMG]](/icons/image2.gif) | 1448457896distal tib_2.jpg | 2015-11-25 13:24 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457896distal tib.jpg | 2015-11-25 13:24 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457896distal tib_1.jpg | 2015-11-25 13:24 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture3_2.jpg | 2015-11-25 13:24 | 16K | |
![[IMG]](/icons/image2.gif) | 1448457896tibfib ant.jpg | 2015-11-25 13:24 | 20K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture1_5.jpg | 2015-11-25 13:24 | 90K | |
![[IMG]](/icons/image2.gif) | 1448457896tibfib a.jpg | 2015-11-25 13:24 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457896ankle ant_2.jpg | 2015-11-25 13:24 | 24K | |
![[IMG]](/icons/image2.gif) | 1448457896ankle ant_1.jpg | 2015-11-25 13:24 | 24K | |
![[IMG]](/icons/image2.gif) | 1448457896ankle ant.jpg | 2015-11-25 13:24 | 24K | |
![[IMG]](/icons/image2.gif) | 1448457896fgggggggggggggggggggggggg.png | 2015-11-25 13:24 | 60K | |
![[IMG]](/icons/image2.gif) | 1448457896tttttt.jpg | 2015-11-25 13:24 | 14K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture3_1.jpg | 2015-11-25 13:24 | 2.1K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture2_9.jpg | 2015-11-25 13:24 | 3.6K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture1_4.jpg | 2015-11-25 13:24 | 3.8K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture12.jpg | 2015-11-25 13:24 | 24K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture11.jpg | 2015-11-25 13:24 | 15K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture10.jpg | 2015-11-25 13:24 | 23K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture9.jpg | 2015-11-25 13:24 | 19K | |
![[IMG]](/icons/image2.gif) | 1448457896xxxxxxxx.jpg | 2015-11-25 13:24 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture7.jpg | 2015-11-25 13:24 | 19K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture6.jpg | 2015-11-25 13:24 | 18K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture1_6.jpg | 2015-11-25 13:24 | 16K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture4.jpg | 2015-11-25 13:24 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture3.jpg | 2015-11-25 13:24 | 18K | |
![[IMG]](/icons/image2.gif) | 1448457896Picture1_3.jpg | 2015-11-25 13:24 | 22K | |
![[IMG]](/icons/image2.gif) | 1448457675foot d.png | 2015-11-25 13:21 | 243K | |
![[IMG]](/icons/image2.gif) | 1448457675Picture1_5.png | 2015-11-25 13:21 | 107K | |
![[IMG]](/icons/image2.gif) | 1448457675Picture6_1.jpg | 2015-11-25 13:21 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457675Picture5_1.jpg | 2015-11-25 13:21 | 20K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture5.jpg | 2015-11-25 13:21 | 20K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture2_7.jpg | 2015-11-25 13:21 | 21K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture2_6.jpg | 2015-11-25 13:21 | 21K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture1_2.jpg | 2015-11-25 13:21 | 14K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture1_1.jpg | 2015-11-25 13:21 | 14K | |
![[IMG]](/icons/image2.gif) | 1448457674lat foot img_2.jpg | 2015-11-25 13:21 | 19K | |
![[IMG]](/icons/image2.gif) | 1448457674lat foot img_1.jpg | 2015-11-25 13:21 | 19K | |
![[IMG]](/icons/image2.gif) | 1448457674lat foot img.jpg | 2015-11-25 13:21 | 19K | |
![[IMG]](/icons/image2.gif) | 1448457674heel img anatomy_1.jpg | 2015-11-25 13:21 | 9.6K | |
![[IMG]](/icons/image2.gif) | 1448457674heel img anatomy.jpg | 2015-11-25 13:21 | 9.6K | |
![[IMG]](/icons/image2.gif) | 1448457674oblique img anatomy B.jpg | 2015-11-25 13:21 | 14K | |
![[IMG]](/icons/image2.gif) | 1448457674oblique img anatomy A.jpg | 2015-11-25 13:21 | 19K | |
![[IMG]](/icons/image2.gif) | 1448457674diagram 1_1.jpg | 2015-11-25 13:21 | 28K | |
![[IMG]](/icons/image2.gif) | 1448457674diagram 1.jpg | 2015-11-25 13:21 | 28K | |
![[IMG]](/icons/image2.gif) | 1448457674foot movement_1.jpg | 2015-11-25 13:21 | 22K | |
![[IMG]](/icons/image2.gif) | 1448457674foot movement.jpg | 2015-11-25 13:21 | 22K | |
![[IMG]](/icons/image2.gif) | 14484576742 tibs.jpg | 2015-11-25 13:21 | 13K | |
![[IMG]](/icons/image2.gif) | 1448457674ap ank.jpg | 2015-11-25 13:21 | 47K | |
![[IMG]](/icons/image2.gif) | 1448457674lat ankle no r_1.jpg | 2015-11-25 13:21 | 38K | |
![[IMG]](/icons/image2.gif) | 1448457674lat ankle no r.jpg | 2015-11-25 13:21 | 38K | |
![[IMG]](/icons/image2.gif) | 1448457674lat ankle r_2.jpg | 2015-11-25 13:21 | 34K | |
![[IMG]](/icons/image2.gif) | 1448457674lat ankle r_1.jpg | 2015-11-25 13:21 | 34K | |
![[IMG]](/icons/image2.gif) | 1448457674lat ankle r.jpg | 2015-11-25 13:21 | 34K | |
![[IMG]](/icons/image2.gif) | 1448457674prox tib_1.jpg | 2015-11-25 13:21 | 9.3K | |
![[IMG]](/icons/image2.gif) | 1448457674prox tib.jpg | 2015-11-25 13:21 | 9.3K | |
![[IMG]](/icons/image2.gif) | 1448457674distal tib_2.jpg | 2015-11-25 13:21 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457674distal tib.jpg | 2015-11-25 13:21 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457674distal tib_1.jpg | 2015-11-25 13:21 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture3_2.jpg | 2015-11-25 13:21 | 16K | |
![[IMG]](/icons/image2.gif) | 1448457674tibfib ant.jpg | 2015-11-25 13:21 | 20K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture1_5.jpg | 2015-11-25 13:21 | 90K | |
![[IMG]](/icons/image2.gif) | 1448457674tibfib a.jpg | 2015-11-25 13:21 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457674ankle ant_2.jpg | 2015-11-25 13:21 | 24K | |
![[IMG]](/icons/image2.gif) | 1448457674ankle ant_1.jpg | 2015-11-25 13:21 | 24K | |
![[IMG]](/icons/image2.gif) | 1448457674ankle ant.jpg | 2015-11-25 13:21 | 24K | |
![[IMG]](/icons/image2.gif) | 1448457674fgggggggggggggggggggggggg.png | 2015-11-25 13:21 | 60K | |
![[IMG]](/icons/image2.gif) | 1448457674tttttt.jpg | 2015-11-25 13:21 | 14K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture3_1.jpg | 2015-11-25 13:21 | 2.1K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture2_9.jpg | 2015-11-25 13:21 | 3.6K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture1_4.jpg | 2015-11-25 13:21 | 3.8K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture12.jpg | 2015-11-25 13:21 | 24K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture11.jpg | 2015-11-25 13:21 | 15K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture10.jpg | 2015-11-25 13:21 | 23K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture9.jpg | 2015-11-25 13:21 | 19K | |
![[IMG]](/icons/image2.gif) | 1448457674xxxxxxxx.jpg | 2015-11-25 13:21 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture7.jpg | 2015-11-25 13:21 | 19K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture6.jpg | 2015-11-25 13:21 | 18K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture1_6.jpg | 2015-11-25 13:21 | 16K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture4.jpg | 2015-11-25 13:21 | 17K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture3.jpg | 2015-11-25 13:21 | 18K | |
![[IMG]](/icons/image2.gif) | 1448457674Picture1_3.jpg | 2015-11-25 13:21 | 22K | |
![[IMG]](/icons/image2.gif) | FIgure 9_6.png | 2015-11-18 20:10 | 226K | |
![[IMG]](/icons/image2.gif) | FIgure 9_5.png | 2015-11-18 20:10 | 226K | |
![[IMG]](/icons/image2.gif) | FIgure 9_4.png | 2015-11-18 20:09 | 226K | |
![[IMG]](/icons/image2.gif) | FIgure 9_3.png | 2015-11-18 20:08 | 226K | |
![[IMG]](/icons/image2.gif) | FIgure 9_2.png | 2015-11-18 20:07 | 226K | |
![[IMG]](/icons/image2.gif) | FIgure 9_1.png | 2015-11-18 20:06 | 226K | |
![[IMG]](/icons/image2.gif) | FIgure 9.png | 2015-11-18 20:06 | 226K | |
![[IMG]](/icons/image2.gif) | Figure 6_26.png | 2015-11-18 20:05 | 133K | |
![[IMG]](/icons/image2.gif) | Figure 6_25.png | 2015-11-18 20:04 | 133K | |
![[IMG]](/icons/image2.gif) | Figure 6_24.png | 2015-11-18 20:04 | 133K | |
![[IMG]](/icons/image2.gif) | Figure 6_23.png | 2015-11-18 20:03 | 133K | |
![[IMG]](/icons/image2.gif) | Figure 6_22.png | 2015-11-18 20:03 | 133K | |
![[IMG]](/icons/image2.gif) | Figure 4_9.png | 2015-11-18 20:02 | 158K | |
![[IMG]](/icons/image2.gif) | Figure 4_8.png | 2015-11-18 20:01 | 158K | |
![[IMG]](/icons/image2.gif) | Figure 4_7.png | 2015-11-18 20:00 | 158K | |
![[IMG]](/icons/image2.gif) | Figure 4_6.png | 2015-11-18 19:59 | 158K | |
![[IMG]](/icons/image2.gif) | Figure 4_5.png | 2015-11-18 19:55 | 158K | |
![[IMG]](/icons/image2.gif) | Figure 3_6.png | 2015-11-18 19:54 | 175K | |
![[IMG]](/icons/image2.gif) | Figure 3_5.png | 2015-11-18 19:54 | 175K | |
![[IMG]](/icons/image2.gif) | Figure 3_4.png | 2015-11-18 19:53 | 175K | |
![[IMG]](/icons/image2.gif) | Figure 6_21.png | 2015-11-18 19:38 | 133K | |
![[IMG]](/icons/image2.gif) | Figure 6_20.png | 2015-11-18 19:38 | 133K | |
![[IMG]](/icons/image2.gif) | Figure 6_19.png | 2015-11-18 19:37 | 133K | |
![[IMG]](/icons/image2.gif) | Figure 6_18.png | 2015-11-18 19:36 | 133K | |
![[IMG]](/icons/image2.gif) | Figure 6_17.png | 2015-11-18 19:35 | 133K | |
![[IMG]](/icons/image2.gif) | Figure 6_16.png | 2015-11-18 19:35 | 133K | |
![[IMG]](/icons/image2.gif) | Figure 6_15.png | 2015-11-18 19:34 | 133K | |
![[IMG]](/icons/image2.gif) | Figure 3_3.png | 2015-11-18 19:32 | 154K | |
![[IMG]](/icons/image2.gif) | Figure 3_2.png | 2015-11-18 19:32 | 154K | |
![[IMG]](/icons/image2.gif) | Figure 3_1.png | 2015-11-18 19:31 | 154K | |
![[IMG]](/icons/image2.gif) | Figure 3.png | 2015-11-18 19:30 | 154K | |
![[IMG]](/icons/image2.gif) | FIgure 7_1.png | 2015-11-18 18:46 | 157K | |
![[IMG]](/icons/image2.gif) | FIgure 7.png | 2015-11-18 18:45 | 157K | |
![[IMG]](/icons/image2.gif) | Figure 6_14.png | 2015-11-18 18:45 | 180K | |
![[IMG]](/icons/image2.gif) | Figure 6_13.png | 2015-11-18 18:44 | 180K | |
![[IMG]](/icons/image2.gif) | Figure 6_12.png | 2015-11-18 17:14 | 180K | |
![[IMG]](/icons/image2.gif) | Figure 6_11.png | 2015-11-18 17:13 | 180K | |
![[IMG]](/icons/image2.gif) | Figure 5_5.png | 2015-11-18 17:12 | 216K | |
![[IMG]](/icons/image2.gif) | Figure 5_4.png | 2015-11-17 20:16 | 216K | |
![[IMG]](/icons/image2.gif) | Figure 5_3.png | 2015-11-17 20:15 | 216K | |
![[IMG]](/icons/image2.gif) | Figure 5_2.png | 2015-11-17 20:15 | 216K | |
![[IMG]](/icons/image2.gif) | Figure 5_1.png | 2015-11-17 20:14 | 216K | |
![[IMG]](/icons/image2.gif) | Figure 5.png | 2015-11-17 20:13 | 216K | |
![[IMG]](/icons/image2.gif) | Image 8_2.png | 2015-11-17 20:10 | 174K | |
![[IMG]](/icons/image2.gif) | Image 8_1.png | 2015-11-17 20:08 | 174K | |
![[IMG]](/icons/image2.gif) | Image 8.png | 2015-11-17 20:07 | 174K | |
![[IMG]](/icons/image2.gif) | Image 6_2.png | 2015-11-17 20:06 | 251K | |
![[IMG]](/icons/image2.gif) | Image 6_1.png | 2015-11-17 20:04 | 251K | |
![[IMG]](/icons/image2.gif) | Image 6.png | 2015-11-17 18:42 | 251K | |
![[IMG]](/icons/image2.gif) | Image 5_2.png | 2015-11-17 18:41 | 246K | |
![[IMG]](/icons/image2.gif) | Image 5_1.png | 2015-11-17 18:40 | 246K | |
![[IMG]](/icons/image2.gif) | Image 5.png | 2015-11-17 15:49 | 246K | |
![[IMG]](/icons/image2.gif) | Image 4_6.png | 2015-11-17 15:27 | 255K | |
![[IMG]](/icons/image2.gif) | Image 4_5.png | 2015-11-17 15:26 | 255K | |
![[IMG]](/icons/image2.gif) | Image 4_4.png | 2015-11-17 15:25 | 255K | |
![[IMG]](/icons/image2.gif) | Figure 7_3.png | 2015-11-17 15:22 | 173K | |
![[IMG]](/icons/image2.gif) | Figure 7_2.png | 2015-11-17 15:22 | 173K | |
![[IMG]](/icons/image2.gif) | Figure 7_1.png | 2015-11-17 15:21 | 173K | |
![[IMG]](/icons/image2.gif) | Figure 7.png | 2015-11-17 15:20 | 173K | |
![[IMG]](/icons/image2.gif) | Figure 4_4.png | 2015-11-17 15:19 | 186K | |
![[IMG]](/icons/image2.gif) | Figure 4_3.png | 2015-11-17 15:18 | 186K | |
![[IMG]](/icons/image2.gif) | Figure 4_2.png | 2015-11-17 13:28 | 186K | |
![[IMG]](/icons/image2.gif) | Figure 4_1.png | 2015-11-17 13:27 | 186K | |
![[IMG]](/icons/image2.gif) | Figure 2_3.png | 2015-11-17 13:26 | 161K | |
![[IMG]](/icons/image2.gif) | tttttt.jpg | 2015-11-12 15:17 | 14K | |
![[IMG]](/icons/image2.gif) | Picture1_6.jpg | 2015-11-12 15:01 | 16K | |
![[IMG]](/icons/image2.gif) | Figure 8.png | 2015-11-04 17:54 | 152K | |
![[IMG]](/icons/image2.gif) | Figure 4.png | 2015-11-04 17:53 | 158K | |
![[IMG]](/icons/image2.gif) | Figure 2_2.png | 2015-11-03 16:14 | 161K | |
![[IMG]](/icons/image2.gif) | Figure 2_1.png | 2015-11-03 16:13 | 161K | |
![[IMG]](/icons/image2.gif) | Figure 2.png | 2015-11-03 16:12 | 161K | |
![[IMG]](/icons/image2.gif) | Figure 12_1.png | 2015-11-03 16:10 | 211K | |
![[IMG]](/icons/image2.gif) | Figure 12.png | 2015-11-03 16:08 | 211K | |
![[IMG]](/icons/image2.gif) | Figure 11_1.png | 2015-11-03 16:07 | 295K | |
![[IMG]](/icons/image2.gif) | Figure 11.png | 2015-11-03 16:04 | 295K | |
![[IMG]](/icons/image2.gif) | Figure 6_10.png | 2015-11-03 15:30 | 145K | |
![[IMG]](/icons/image2.gif) | Figure 6_9.png | 2015-11-03 15:29 | 145K | |
![[IMG]](/icons/image2.gif) | Figure 6_8.png | 2015-11-03 15:24 | 145K | |
![[IMG]](/icons/image2.gif) | Figure 6_7.png | 2015-11-03 15:23 | 145K | |
![[IMG]](/icons/image2.gif) | Image 4_3.png | 2015-11-03 15:22 | 313K | |
![[IMG]](/icons/image2.gif) | Image 4_2.png | 2015-11-03 15:21 | 313K | |
![[IMG]](/icons/image2.gif) | Image 4_1.png | 2015-11-03 15:20 | 313K | |
![[IMG]](/icons/image2.gif) | Image 4.png | 2015-11-03 14:29 | 313K | |
![[IMG]](/icons/image2.gif) | Foot Image 2_1.png | 2015-11-03 13:55 | 249K | |
![[IMG]](/icons/image2.gif) | Foot Image 2.png | 2015-11-03 13:53 | 249K | |
![[IMG]](/icons/image2.gif) | Image 08.jpg | 2015-10-23 15:04 | 19K | |
![[IMG]](/icons/image2.gif) | Picture1_5.png | 2015-10-21 19:24 | 107K | |
![[IMG]](/icons/image2.gif) | foot d.png | 2015-10-21 19:22 | 243K | |
![[IMG]](/icons/image2.gif) | Image 06.jpg | 2015-10-21 15:04 | 26K | |
![[IMG]](/icons/image2.gif) | image 05.jpg | 2015-10-21 14:51 | 33K | |
![[IMG]](/icons/image2.gif) | Image 04_1.jpg | 2015-10-21 14:19 | 25K | |
![[IMG]](/icons/image2.gif) | Image 04.jpg | 2015-10-10 13:25 | 14K | |
![[IMG]](/icons/image2.gif) | image 08.jpg | 2015-10-10 13:23 | 27K | |
![[IMG]](/icons/image2.gif) | image 10.jpg | 2015-10-10 13:22 | 23K | |
![[IMG]](/icons/image2.gif) | image 7.jpg | 2015-10-10 13:13 | 25K | |
![[IMG]](/icons/image2.gif) | Image 9.jpg | 2015-10-10 13:06 | 21K | |
![[IMG]](/icons/image2.gif) | Ap forearm cutoff.jpg | 2015-10-09 17:05 | 22K | |
![[IMG]](/icons/image2.gif) | Navicular good.jpg | 2015-10-08 13:50 | 31K | |
![[IMG]](/icons/image2.gif) | AP forearm.jpg | 2015-10-08 13:39 | 18K | |
![[IMG]](/icons/image2.gif) | Lat elbow_1.jpg | 2015-10-06 19:06 | 27K | |
![[IMG]](/icons/image2.gif) | Lat elbow.jpg | 2015-10-06 19:06 | 27K | |
![[IMG]](/icons/image2.gif) | Med Obl elbow.jpg | 2015-10-06 19:00 | 12K | |
![[IMG]](/icons/image2.gif) | Diagram 5_1.jpg | 2015-10-06 18:53 | 16K | |
![[IMG]](/icons/image2.gif) | lat wrist.jpg | 2015-10-06 18:51 | 12K | |
![[IMG]](/icons/image2.gif) | Diagram 1_2.jpg | 2015-10-06 18:50 | 30K | |
![[IMG]](/icons/image2.gif) | Diagram 1_1.jpg | 2015-10-06 18:50 | 30K | |
![[IMG]](/icons/image2.gif) | Diagram 1.jpg | 2015-10-06 18:49 | 30K | |
![[IMG]](/icons/image2.gif) | Image 10_1.png | 2015-10-06 15:25 | 162K | |
![[IMG]](/icons/image2.gif) | Image 10.png | 2015-10-05 15:41 | 162K | |
![[IMG]](/icons/image2.gif) | Figure 6_6.png | 2015-09-24 12:07 | 191K | |
![[IMG]](/icons/image2.gif) | Figure 6_5.png | 2015-09-24 12:07 | 191K | |
![[IMG]](/icons/image2.gif) | Figure 6_4.png | 2015-09-24 12:07 | 191K | |
![[IMG]](/icons/image2.gif) | Figure 6_3.png | 2015-09-24 12:06 | 191K | |
![[IMG]](/icons/image2.gif) | Figure 6_2.png | 2015-09-24 12:06 | 191K | |
![[IMG]](/icons/image2.gif) | Figure 6_1.png | 2015-09-24 12:05 | 191K | |
![[IMG]](/icons/image2.gif) | Figure 6.png | 2015-09-24 12:05 | 191K | |
![[IMG]](/icons/image2.gif) | Coronal_3.png | 2015-09-24 12:03 | 403K | |
![[IMG]](/icons/image2.gif) | Coronal_2.png | 2015-09-24 12:01 | 403K | |
![[IMG]](/icons/image2.gif) | Coronal_1.png | 2015-09-23 19:43 | 403K | |
![[IMG]](/icons/image2.gif) | Coronal.png | 2015-09-23 19:13 | 403K | |
![[IMG]](/icons/image2.gif) | Finer lateral.jpg | 2015-09-16 16:30 | 27K | |
![[IMG]](/icons/image2.gif) | Finger PA marker.jpg | 2015-09-15 17:56 | 18K | |
![[IMG]](/icons/image2.gif) | hand lat rotation.jpg | 2015-09-10 15:33 | 27K | |
![[IMG]](/icons/image2.gif) | Finger pa collimation.jpg | 2015-09-10 15:25 | 27K | |
![[IMG]](/icons/image2.gif) | hand obl.jpg | 2015-09-10 15:20 | 28K | |
![[IMG]](/icons/image2.gif) | hand w nail.jpg | 2015-09-10 15:08 | 35K | |
![[IMG]](/icons/image2.gif) | finger lat bad.jpg | 2015-09-10 14:54 | 26K | |
![[IMG]](/icons/image2.gif) | finger lat_1.jpg | 2015-09-10 13:33 | 7.8K | |
![[IMG]](/icons/image2.gif) | thumb ap_1.jpg | 2015-09-10 13:32 | 40K | |
![[IMG]](/icons/image2.gif) | thumb obl.jpg | 2015-09-10 13:32 | 11K | |
![[IMG]](/icons/image2.gif) | thumb ap.jpg | 2015-09-10 13:30 | 40K | |
![[IMG]](/icons/image2.gif) | Hand anatomy_4.jpg | 2015-09-10 13:28 | 29K | |
![[IMG]](/icons/image2.gif) | Hand anatomy_3.jpg | 2015-09-10 13:28 | 29K | |
![[IMG]](/icons/image2.gif) | Hand anatomy_2.jpg | 2015-09-10 13:27 | 29K | |
![[IMG]](/icons/image2.gif) | Hand anatomy_1.jpg | 2015-09-10 13:27 | 29K | |
![[IMG]](/icons/image2.gif) | Hand anatomy.jpg | 2015-09-10 13:26 | 29K | |
![[IMG]](/icons/image2.gif) | Picture1_4.png | 2015-08-28 17:41 | 76K | |
![[IMG]](/icons/image2.gif) | lat coccyx.png | 2015-08-27 14:09 | 127K | |
![[IMG]](/icons/image2.gif) | lat sacrum.png | 2015-08-27 14:05 | 169K | |
![[IMG]](/icons/image2.gif) | ob sli joint.png | 2015-08-27 13:58 | 144K | |
![[IMG]](/icons/image2.gif) | AP Sacrum 2.png | 2015-08-27 13:56 | 176K | |
![[IMG]](/icons/image2.gif) | ap sacrum 3.png | 2015-08-27 13:55 | 147K | |
![[IMG]](/icons/image2.gif) | AP Sacrum.png | 2015-08-27 13:37 | 122K | |
![[IMG]](/icons/image2.gif) | sacral canal iamge.png | 2015-08-27 13:20 | 83K | |
![[IMG]](/icons/image2.gif) | lat diagram.png | 2015-08-27 13:19 | 112K | |
![[IMG]](/icons/image2.gif) | ap diagram_2.png | 2015-08-27 13:17 | 134K | |
![[IMG]](/icons/image2.gif) | ap diagram_1.png | 2015-08-27 13:15 | 134K | |
![[IMG]](/icons/image2.gif) | ap diagram.png | 2015-08-27 13:13 | 134K | |
![[IMG]](/icons/image2.gif) | SternumDia1.png | 2015-08-21 14:04 | 61K | |
![[IMG]](/icons/image2.gif) | Picture1_3.png | 2015-08-21 14:02 | 148K | |
![[IMG]](/icons/image2.gif) | RAOSternumIMAGE.png | 2015-08-21 13:52 | 177K | |
![[IMG]](/icons/image2.gif) | LObl Ribs.png | 2015-08-21 13:09 | 137K | |
![[IMG]](/icons/image2.gif) | RibDia1.png | 2015-08-21 12:58 | 26K | |
![[IMG]](/icons/image2.gif) | AP Ribs1.png | 2015-08-21 12:54 | 94K | |
![[IMG]](/icons/image2.gif) | IM oblpelvis2.png | 2015-08-20 15:04 | 235K | |
![[IMG]](/icons/image2.gif) | Pelvisdia2.png | 2015-08-20 15:02 | 427K | |
![[IMG]](/icons/image2.gif) | Pelvisdia1.png | 2015-08-20 15:02 | 427K | |
![[IMG]](/icons/image2.gif) | HIpdia3.png | 2015-08-20 15:01 | 105K | |
![[IMG]](/icons/image2.gif) | hipdiagram2.png | 2015-08-20 15:00 | 106K | |
![[IMG]](/icons/image2.gif) | hipdiagram1.png | 2015-08-20 15:00 | 106K | |
![[IMG]](/icons/image2.gif) | column.png | 2015-08-20 15:00 | 234K | |
![[IMG]](/icons/image2.gif) | IMFroghip_1.png | 2015-08-20 14:59 | 77K | |
![[IMG]](/icons/image2.gif) | IMFroghip.png | 2015-08-20 14:59 | 77K | |
![[IMG]](/icons/image2.gif) | Im AP Pelvis.png | 2015-08-20 14:58 | 127K | |
![[IMG]](/icons/image2.gif) | xTHip.png | 2015-08-20 14:47 | 158K | |
![[IMG]](/icons/image2.gif) | sufficient lat.jpg | 2015-08-18 13:37 | 17K | |
![[IMG]](/icons/image2.gif) | Good CXR.jpg | 2015-08-18 12:25 | 27K | |
![[IMG]](/icons/image2.gif) | bad PA CXR 2_1.jpg | 2015-08-17 19:06 | 18K | |
![[IMG]](/icons/image2.gif) | bad PA CXR 2.jpg | 2015-08-17 18:57 | 28K | |
![[IMG]](/icons/image2.gif) | bad lat CXR 2.jpg | 2015-08-17 17:52 | 30K | |
![[IMG]](/icons/image2.gif) | Bad lat CXR.jpg | 2015-08-17 17:43 | 25K | |
![[IMG]](/icons/image2.gif) | Picture6_1.jpg | 2015-08-17 17:00 | 17K | |
![[IMG]](/icons/image2.gif) | Picture5_1.jpg | 2015-08-17 16:59 | 20K | |
![[IMG]](/icons/image2.gif) | Picture5.jpg | 2015-08-17 16:58 | 20K | |
![[IMG]](/icons/image2.gif) | Picture2_9.jpg | 2015-08-17 16:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | Picture1_4.jpg | 2015-08-17 16:44 | 3.8K | |
![[IMG]](/icons/image2.gif) | Lingula.jpg | 2015-08-17 13:48 | 17K | |
![[IMG]](/icons/image2.gif) | CXR 01.jpg | 2015-08-17 13:34 | 18K | |
![[IMG]](/icons/image2.gif) | Lungs.jpg | 2015-08-17 13:13 | 23K | |
![[IMG]](/icons/image2.gif) | Picture12.jpg | 2015-08-14 21:09 | 24K | |
![[IMG]](/icons/image2.gif) | Picture10.jpg | 2015-08-14 20:21 | 23K | |
![[IMG]](/icons/image2.gif) | Picture9.jpg | 2015-08-14 20:18 | 19K | |
![[IMG]](/icons/image2.gif) | Picture6.jpg | 2015-08-14 20:10 | 18K | |
![[IMG]](/icons/image2.gif) | Picture4.jpg | 2015-08-14 20:07 | 17K | |
![[IMG]](/icons/image2.gif) | Picture2_8.jpg | 2015-08-14 20:04 | 17K | |
![[IMG]](/icons/image2.gif) | 2 tibs.jpg | 2015-08-14 19:52 | 13K | |
![[IMG]](/icons/image2.gif) | prox tib_1.jpg | 2015-08-14 19:31 | 9.3K | |
![[IMG]](/icons/image2.gif) | prox tib.jpg | 2015-08-14 19:26 | 9.3K | |
![[IMG]](/icons/image2.gif) | Picture2_7.jpg | 2015-08-14 16:24 | 21K | |
![[IMG]](/icons/image2.gif) | Picture2_6.jpg | 2015-08-14 16:23 | 21K | |
![[IMG]](/icons/image2.gif) | Picture1_2.jpg | 2015-08-14 16:20 | 14K | |
![[IMG]](/icons/image2.gif) | Picture1_1.jpg | 2015-08-14 16:19 | 14K | |
![[IMG]](/icons/image2.gif) | 3_2.jpg | 2015-08-04 17:47 | 30K | |
![[IMG]](/icons/image2.gif) | 3_1.jpg | 2015-08-04 17:46 | 30K | |
![[IMG]](/icons/image2.gif) | 3.jpg | 2015-08-04 17:45 | 30K | |
![[IMG]](/icons/image2.gif) | 2_1.jpg | 2015-08-04 17:43 | 32K | |
![[IMG]](/icons/image2.gif) | 2.jpg | 2015-08-04 17:42 | 32K | |
![[IMG]](/icons/image2.gif) | 1_1.jpg | 2015-08-04 17:40 | 25K | |
![[IMG]](/icons/image2.gif) | 1.jpg | 2015-08-04 17:38 | 25K | |
![[IMG]](/icons/image2.gif) | 9.jpg | 2015-08-04 17:36 | 38K | |
![[IMG]](/icons/image2.gif) | open.jpg | 2015-08-04 17:34 | 25K | |
![[IMG]](/icons/image2.gif) | obl mand_3.png | 2015-08-04 17:16 | 501K | |
![[IMG]](/icons/image2.gif) | obl mand_2.png | 2015-08-04 17:15 | 501K | |
![[IMG]](/icons/image2.gif) | obl mand_1.png | 2015-08-04 17:12 | 501K | |
![[IMG]](/icons/image2.gif) | obl mand.png | 2015-08-04 17:10 | 501K | |
![[IMG]](/icons/image2.gif) | diagrammand_2.png | 2015-08-04 17:08 | 476K | |
![[IMG]](/icons/image2.gif) | diagrammand_1.png | 2015-08-04 17:06 | 476K | |
![[IMG]](/icons/image2.gif) | diagrammand.png | 2015-08-04 17:03 | 476K | |
![[IMG]](/icons/image2.gif) | diagram sinus_3.png | 2015-08-04 16:59 | 377K | |
![[IMG]](/icons/image2.gif) | diagram sinus_2.png | 2015-08-04 16:54 | 377K | |
![[IMG]](/icons/image2.gif) | diagram sinus_1.png | 2015-08-04 16:49 | 377K | |
![[IMG]](/icons/image2.gif) | diagram sinus.png | 2015-08-04 16:47 | 377K | |
![[IMG]](/icons/image2.gif) | lateral sinus diag_3.png | 2015-08-04 16:41 | 331K | |
![[IMG]](/icons/image2.gif) | lateral sinus diag_2.png | 2015-08-04 16:37 | 331K | |
![[IMG]](/icons/image2.gif) | lateral sinus diag_1.png | 2015-08-04 16:33 | 331K | |
![[IMG]](/icons/image2.gif) | lateral sinus diag.png | 2015-08-04 16:32 | 331K | |
![[IMG]](/icons/image2.gif) | 8.png | 2015-08-04 15:00 | 193K | |
![[IMG]](/icons/image2.gif) | 7.png | 2015-08-04 14:58 | 108K | |
![[IMG]](/icons/image2.gif) | 6_1.png | 2015-08-04 14:56 | 76K | |
![[IMG]](/icons/image2.gif) | 6.png | 2015-08-04 14:55 | 76K | |
![[IMG]](/icons/image2.gif) | Picture4_6.png | 2015-08-04 14:50 | 105K | |
![[IMG]](/icons/image2.gif) | pa_1.png | 2015-08-04 14:48 | 94K | |
![[IMG]](/icons/image2.gif) | pa.png | 2015-08-04 14:47 | 94K | |
![[IMG]](/icons/image2.gif) | lateral.png | 2015-08-04 14:45 | 123K | |
![[IMG]](/icons/image2.gif) | skull_1.png | 2015-08-04 14:43 | 93K | |
![[IMG]](/icons/image2.gif) | skull.png | 2015-08-04 14:41 | 93K | |
![[IMG]](/icons/image2.gif) | Picture3_12.png | 2015-08-04 14:24 | 118K | |
![[IMG]](/icons/image2.gif) | Picture3_11.png | 2015-08-04 14:19 | 118K | |
![[IMG]](/icons/image2.gif) | Picture3_10.png | 2015-08-04 14:18 | 118K | |
![[IMG]](/icons/image2.gif) | Picture3_9.png | 2015-08-04 14:17 | 118K | |
![[IMG]](/icons/image2.gif) | Picture3_8.png | 2015-08-04 14:16 | 118K | |
![[IMG]](/icons/image2.gif) | Picture3_7.png | 2015-08-04 14:15 | 118K | |
![[IMG]](/icons/image2.gif) | Picture2_5.jpg | 2015-08-04 14:08 | 37K | |
![[IMG]](/icons/image2.gif) | Picture2_4.jpg | 2015-08-04 14:07 | 37K | |
![[IMG]](/icons/image2.gif) | Picture2_3.jpg | 2015-08-04 14:06 | 37K | |
![[IMG]](/icons/image2.gif) | Picture2_2.jpg | 2015-08-04 14:05 | 37K | |
![[IMG]](/icons/image2.gif) | Picture2_1.jpg | 2015-08-04 14:03 | 37K | |
![[IMG]](/icons/image2.gif) | Picture1_2.png | 2015-08-04 13:47 | 136K | |
![[IMG]](/icons/image2.gif) | diagram_6.png | 2015-08-04 13:42 | 135K | |
![[IMG]](/icons/image2.gif) | diagram_5.png | 2015-08-04 13:40 | 135K | |
![[IMG]](/icons/image2.gif) | diagram_4.png | 2015-08-04 13:39 | 135K | |
![[IMG]](/icons/image2.gif) | diagram_3.png | 2015-08-04 13:35 | 135K | |
![[IMG]](/icons/image2.gif) | diagram_2.png | 2015-08-04 13:28 | 135K | |
![[IMG]](/icons/image2.gif) | diagram_1.png | 2015-08-04 13:27 | 135K | |
![[IMG]](/icons/image2.gif) | diagram.png | 2015-08-04 13:23 | 135K | |
![[IMG]](/icons/image2.gif) | lat foot img_2.jpg | 2015-07-28 15:09 | 19K | |
![[IMG]](/icons/image2.gif) | lat foot img.jpg | 2015-07-28 15:05 | 19K | |
![[IMG]](/icons/image2.gif) | heel img anatomy_1.jpg | 2015-07-28 15:01 | 9.6K | |
![[IMG]](/icons/image2.gif) | heel img anatomy.jpg | 2015-07-28 14:59 | 9.6K | |
![[IMG]](/icons/image2.gif) | oblique img anatomy B.jpg | 2015-07-28 14:57 | 14K | |
![[IMG]](/icons/image2.gif) | oblique img anatomy A.jpg | 2015-07-28 14:55 | 19K | |
![[IMG]](/icons/image2.gif) | foot movement_1.jpg | 2015-07-28 14:47 | 22K | |
![[IMG]](/icons/image2.gif) | foot movement.jpg | 2015-07-28 14:45 | 22K | |
![[IMG]](/icons/image2.gif) | Picture10.png | 2015-07-23 17:50 | 580K | |
![[IMG]](/icons/image2.gif) | Picture9_1.png | 2015-07-23 17:46 | 372K | |
![[IMG]](/icons/image2.gif) | Picture9.png | 2015-07-23 17:44 | 372K | |
![[IMG]](/icons/image2.gif) | Picture8_1.png | 2015-07-23 17:41 | 595K | |
![[IMG]](/icons/image2.gif) | Picture8.png | 2015-07-23 17:40 | 595K | |
![[IMG]](/icons/image2.gif) | Picture7_1.png | 2015-07-23 17:36 | 563K | |
![[IMG]](/icons/image2.gif) | Picture7.png | 2015-07-23 17:35 | 563K | |
![[IMG]](/icons/image2.gif) | Picture6_2.png | 2015-07-23 17:32 | 917K | |
![[IMG]](/icons/image2.gif) | Picture6_1.png | 2015-07-23 17:30 | 917K | |
![[IMG]](/icons/image2.gif) | Picture6.png | 2015-07-23 17:27 | 917K | |
![[IMG]](/icons/image2.gif) | Picture5_8.png | 2015-07-23 17:20 | 874K | |
![[IMG]](/icons/image2.gif) | Picture5_7.png | 2015-07-23 17:19 | 874K | |
![[IMG]](/icons/image2.gif) | Picture5_6.png | 2015-07-23 17:16 | 874K | |
![[IMG]](/icons/image2.gif) | Picture5_5.png | 2015-07-23 17:06 | 874K | |
![[IMG]](/icons/image2.gif) | Picture5_4.png | 2015-07-23 16:56 | 874K | |
![[IMG]](/icons/image2.gif) | Picture5_3.png | 2015-07-23 16:55 | 874K | |
![[IMG]](/icons/image2.gif) | Picture5_2.png | 2015-07-23 16:52 | 874K | |
![[IMG]](/icons/image2.gif) | Picture5_1.png | 2015-07-23 16:50 | 874K | |
![[IMG]](/icons/image2.gif) | Picture5.png | 2015-07-23 16:46 | 874K | |
![[IMG]](/icons/image2.gif) | Picture3_6.png | 2015-07-23 14:33 | 283K | |
![[IMG]](/icons/image2.gif) | Picture3_5.png | 2015-07-23 14:31 | 283K | |
![[IMG]](/icons/image2.gif) | Picture3_4.png | 2015-07-23 14:29 | 283K | |
![[IMG]](/icons/image2.gif) | Picture3_3.png | 2015-07-23 14:24 | 283K | |
![[IMG]](/icons/image2.gif) | Picture3_2.png | 2015-07-23 14:22 | 283K | |
![[IMG]](/icons/image2.gif) | Picture3_1.png | 2015-07-23 14:21 | 283K | |
![[IMG]](/icons/image2.gif) | Picture4_5.png | 2015-07-23 14:19 | 269K | |
![[IMG]](/icons/image2.gif) | Picture4_4.png | 2015-07-23 14:18 | 269K | |
![[IMG]](/icons/image2.gif) | Picture4_3.png | 2015-07-23 14:16 | 269K | |
![[IMG]](/icons/image2.gif) | Picture4_2.png | 2015-07-23 14:13 | 269K | |
![[IMG]](/icons/image2.gif) | Picture4_1.png | 2015-07-23 14:11 | 269K | |
![[IMG]](/icons/image2.gif) | Picture3.png | 2015-07-23 14:04 | 283K | |
![[IMG]](/icons/image2.gif) | Picture2.jpg | 2015-07-23 13:50 | 55K | |
![[IMG]](/icons/image2.gif) | carm_2.png | 2015-07-10 19:17 | 97K | |
![[IMG]](/icons/image2.gif) | QRS.png | 2015-07-10 19:02 | 71K | |
![[IMG]](/icons/image2.gif) | Ap Scapula_1.png | 2015-06-25 15:28 | 185K | |
![[IMG]](/icons/image2.gif) | Lat Scap 1_1.png | 2015-06-25 15:25 | 148K | |
![[IMG]](/icons/image2.gif) | Axillary labeling _64.png | 2015-06-24 17:20 | 48K | |
![[IMG]](/icons/image2.gif) | Ext shoulder labeling _63.png | 2015-06-24 15:34 | 156K | |
![[IMG]](/icons/image2.gif) | Shoulder Labeling _56and 58_1.png | 2015-06-24 14:46 | 79K | |
![[IMG]](/icons/image2.gif) | Shoulder Labeling _56and 58.png | 2015-06-24 14:41 | 79K | |
![[IMG]](/icons/image2.gif) | lat knee labeling_1.png | 2015-06-24 12:51 | 91K | |
![[IMG]](/icons/image2.gif) | Y image - under _52.png | 2015-06-24 12:49 | 168K | |
![[IMG]](/icons/image2.gif) | P. NICU CXR _46.png | 2015-06-24 12:23 | 18K | |
![[IMG]](/icons/image2.gif) | GB _3_1.png | 2015-06-23 12:12 | 48K | |
![[IMG]](/icons/image2.gif) | Femur labeling_3.png | 2015-06-23 12:11 | 276K | |
![[IMG]](/icons/image2.gif) | lat knee labeling.png | 2015-06-19 14:09 | 91K | |
![[IMG]](/icons/image2.gif) | Brain_1.png | 2015-06-18 15:14 | 40K | |
![[IMG]](/icons/image2.gif) | Brain.png | 2015-06-17 15:23 | 41K | |
![[IMG]](/icons/image2.gif) | lat knee critique_1.png | 2015-06-16 16:55 | 60K | |
![[IMG]](/icons/image2.gif) | Ap Scapula.png | 2015-06-15 14:00 | 185K | |
![[IMG]](/icons/image2.gif) | Lat Scap 2_1.png | 2015-06-15 13:53 | 207K | |
![[IMG]](/icons/image2.gif) | Lat Scap 1.png | 2015-06-15 13:49 | 148K | |
![[IMG]](/icons/image2.gif) | Lat Scap 2.png | 2015-06-15 13:47 | 207K | |
![[IMG]](/icons/image2.gif) | AC joint 1.png | 2015-06-15 13:33 | 173K | |
![[IMG]](/icons/image2.gif) | GB _4.png | 2015-06-11 15:05 | 64K | |
![[IMG]](/icons/image2.gif) | GB _3.png | 2015-06-11 15:04 | 48K | |
![[IMG]](/icons/image2.gif) | carm_1.png | 2015-06-11 14:58 | 97K | |
![[IMG]](/icons/image2.gif) | carm.png | 2015-06-11 14:57 | 97K | |
![[IMG]](/icons/image2.gif) | Patella_2.png | 2015-06-11 14:20 | 102K | |
![[IMG]](/icons/image2.gif) | Patella.png | 2015-06-11 14:19 | 102K | |
![[IMG]](/icons/image2.gif) | Rt lat Femur.png | 2015-06-11 14:08 | 90K | |
![[IMG]](/icons/image2.gif) | lat knee critique.png | 2015-06-11 14:08 | 60K | |
![[IMG]](/icons/image2.gif) | Med vs Lat oblique.png | 2015-06-11 14:07 | 132K | |
![[IMG]](/icons/image2.gif) | Lat Knee labeling_3.jpg | 2015-06-11 14:06 | 11K | |
![[IMG]](/icons/image2.gif) | Lat Knee labeling_2.jpg | 2015-06-11 14:06 | 11K | |
![[IMG]](/icons/image2.gif) | AP Knee labeling_1.jpg | 2015-06-11 14:05 | 11K | |
![[IMG]](/icons/image2.gif) | lt lat femur anat cutoff_1.png | 2015-06-11 14:05 | 62K | |
![[IMG]](/icons/image2.gif) | lt lat femur anat cutoff.png | 2015-06-11 14:04 | 62K | |
![[IMG]](/icons/image2.gif) | Femur labeling_2.png | 2015-06-11 14:04 | 276K | |
![[IMG]](/icons/image2.gif) | Femur labeling_1.png | 2015-06-11 14:04 | 276K | |
![[IMG]](/icons/image2.gif) | AP Knee labeling.jpg | 2015-06-11 14:03 | 11K | |
![[IMG]](/icons/image2.gif) | Femur labeling.png | 2015-06-11 14:03 | 276K | |
![[IMG]](/icons/image2.gif) | SB critique.png | 2015-06-11 11:56 | 146K | |
![[IMG]](/icons/image2.gif) | Diverticulosis.png | 2015-06-10 15:40 | 100K | |
![[IMG]](/icons/image2.gif) | RPO.png | 2015-06-09 18:56 | 146K | |
![[IMG]](/icons/image2.gif) | Decub 2.png | 2015-06-09 18:47 | 110K | |
![[IMG]](/icons/image2.gif) | lt lat rectum_1.png | 2015-06-09 18:30 | 147K | |
![[IMG]](/icons/image2.gif) | lt lat rectum.png | 2015-06-09 18:30 | 147K | |
![[IMG]](/icons/image2.gif) | sigmoid 2.png | 2015-06-09 18:17 | 184K | |
![[IMG]](/icons/image2.gif) | xtable lat 2_1.png | 2015-06-09 17:54 | 91K | |
![[IMG]](/icons/image2.gif) | xtable lat 1_1.png | 2015-06-09 17:53 | 94K | |
![[IMG]](/icons/image2.gif) | xtable lat 2.png | 2015-06-09 17:52 | 91K | |
![[IMG]](/icons/image2.gif) | xtable lat 1.png | 2015-06-09 17:48 | 94K | |
![[IMG]](/icons/image2.gif) | LPO 1.png | 2015-06-09 17:45 | 167K | |
![[IMG]](/icons/image2.gif) | decub 1.png | 2015-06-09 17:41 | 114K | |
![[IMG]](/icons/image2.gif) | Sigmoid 1.png | 2015-06-09 17:35 | 104K | |
![[IMG]](/icons/image2.gif) | Colon Anatomy_7.png | 2015-06-09 15:28 | 144K | |
![[IMG]](/icons/image2.gif) | Colon Anatomy_6.png | 2015-06-09 15:27 | 144K | |
![[IMG]](/icons/image2.gif) | Colon Anatomy_5.png | 2015-06-09 15:26 | 144K | |
![[IMG]](/icons/image2.gif) | Colon Anatomy_4.png | 2015-06-09 15:25 | 144K | |
![[IMG]](/icons/image2.gif) | Colon Anatomy_3.png | 2015-06-09 15:24 | 144K | |
![[IMG]](/icons/image2.gif) | Colon Anatomy_2.png | 2015-06-09 15:23 | 144K | |
![[IMG]](/icons/image2.gif) | Colon Anatomy_1.png | 2015-06-09 15:22 | 144K | |
![[IMG]](/icons/image2.gif) | Colon Anatomy.png | 2015-06-09 15:21 | 144K | |
![[IMG]](/icons/image2.gif) | SB Anat - Duodenum.png | 2015-06-02 18:48 | 106K | |
![[IMG]](/icons/image2.gif) | SB Anat - Ileum.png | 2015-06-02 18:46 | 104K | |
![[IMG]](/icons/image2.gif) | Rt lateral 3.jpg | 2015-05-22 19:18 | 7.9K | |
![[IMG]](/icons/image2.gif) | Esophagus 2_1.jpg | 2015-05-22 19:06 | 9.0K | |
![[IMG]](/icons/image2.gif) | Esophagus 2.jpg | 2015-05-22 19:06 | 9.0K | |
![[IMG]](/icons/image2.gif) | Stomach - pt position.png | 2015-05-22 19:01 | 109K | |
![[IMG]](/icons/image2.gif) | PA stomach - critique.jpg | 2015-05-22 18:21 | 17K | |
![[IMG]](/icons/image2.gif) | RAO stomach.jpg | 2015-05-22 18:18 | 9.9K | |
![[IMG]](/icons/image2.gif) | R lateral.jpg | 2015-05-22 18:14 | 13K | |
![[IMG]](/icons/image2.gif) | Extra RAO Stomach Image.png | 2015-05-21 19:44 | 78K | |
![[IMG]](/icons/image2.gif) | RAO stomach - Critique_1.png | 2015-05-21 19:34 | 81K | |
![[IMG]](/icons/image2.gif) | RAO stomach - Critique.png | 2015-05-21 19:32 | 81K | |
![[IMG]](/icons/image2.gif) | RT Lat Stomach Image_1.png | 2015-05-21 19:28 | 52K | |
![[IMG]](/icons/image2.gif) | RT Lat Stomach Image.png | 2015-05-21 19:27 | 52K | |
![[IMG]](/icons/image2.gif) | Esophagus - Critique_2.png | 2015-05-21 17:56 | 69K | |
![[IMG]](/icons/image2.gif) | Esophagus - Critique_1.png | 2015-05-21 17:55 | 69K | |
![[IMG]](/icons/image2.gif) | Esophagus - Critique.png | 2015-05-21 17:55 | 69K | |
![[IMG]](/icons/image2.gif) | PA Stomach - critique_1.png | 2015-05-21 17:52 | 113K | |
![[IMG]](/icons/image2.gif) | PA Stomach - critique.png | 2015-05-21 17:50 | 113K | |
![[IMG]](/icons/image2.gif) | Esophagus Anatomy - EG Junction.png | 2015-05-21 17:28 | 105K | |
![[IMG]](/icons/image2.gif) | Esophagus Anatomy - Fundus.png | 2015-05-21 17:27 | 105K | |
![[IMG]](/icons/image2.gif) | Esophagus Anatomy - Cardioesophageal Sphincter.png | 2015-05-21 17:26 | 105K | |
![[IMG]](/icons/image2.gif) | Stomach Anatomy - C-loop.png | 2015-05-21 17:25 | 80K | |
![[IMG]](/icons/image2.gif) | Stomach Anatomh - Pylorus.png | 2015-05-21 17:24 | 76K | |
![[IMG]](/icons/image2.gif) | Stomach Anatomy - Duodenal Bulb.png | 2015-05-21 17:23 | 78K | |
![[IMG]](/icons/image2.gif) | Stomach Anatomy - Fundus.png | 2015-05-21 17:21 | 81K | |
![[IMG]](/icons/image2.gif) | Carm-boom.png | 2015-05-21 13:56 | 49K | |
![[IMG]](/icons/image2.gif) | Sternum.png | 2015-05-21 13:41 | 92K | |
![[IMG]](/icons/image2.gif) | medial oblique elbow-unders.png | 2015-05-21 12:53 | 58K | |
![[IMG]](/icons/image2.gif) | Picture1.jpg | 2015-05-07 18:00 | 52K | |
![[IMG]](/icons/image2.gif) | piggostat.png | 2015-05-07 16:44 | 1.0M | |
![[IMG]](/icons/image2.gif) | supine.jpg | 2015-05-07 16:43 | 16K | |
![[IMG]](/icons/image2.gif) | The_Persistence_of_Memory.jpg | 2014-12-30 21:50 | 50K | |
![[IMG]](/icons/image2.gif) | grey_dot.gif | 2014-12-12 16:25 | 41 | |
![[IMG]](/icons/image2.gif) | brain lobes.jpg | 2014-11-24 16:46 | 34K | |
![[IMG]](/icons/image2.gif) | SB1.png | 2014-10-28 12:04 | 694K | |
![[IMG]](/icons/image2.gif) | Picture4.png | 2014-10-10 13:53 | 1.2M | |
![[IMG]](/icons/image2.gif) | Picture1_1.png | 2014-10-10 13:38 | 289K | |
![[IMG]](/icons/image2.gif) | Picture1.png | 2011-07-19 17:38 | 212K | |
|